Tuyển tập 35 đề thi học sinh giỏi môn Hóa học lớp 11 (có đáp án chi tiết)

211 9,267 138
  • Loading ...
    Loading ...
    Loading ...

Tài liệu hạn chế xem trước, để xem đầy đủ mời bạn chọn Tải xuống

Tài liệu liên quan

Thông tin tài liệu

Ngày đăng: 01/10/2015, 22:40

SỞ GIÁO DỤC VÀ ĐÀO TẠOTỈNH ĐIỆN BIÊNKÌ THI CHỌN HỌC SINH GIỎI CẤP CƠ SỞNĂM HỌC 2012 - 2013ĐỀ CHÍNH THỨCMôn: Hóa học - lớp 11Ngày thi: 15/4/2013Thời gian: 180 phút, không kể thời gian giao đề(Đề thi có 02 trang)ĐỀ BÀICâu 1 (4,5 điểm)1.Viết các phương trình hóa học theo sơ đồ sau (ghi rõ điều kiện phản ứng, nếu có)123456Ca3 P2 ← P → P2O5 → H 3 PO4 → Na2 HPO4 → Na3 PO4 → Ag3 PO42. A là một ancol no mạch hở. Đốt cháy hoàn toàn m gam A, thu được 3,36 lít khí CO2(đktc) và 3,6 gam nước. Xác định công thức phân tử, viết các công thức cấu tạo của A và ghitên thay thế.3. Hấp thụ hoàn toàn 1,568 lít CO2 (đktc) vào 500ml dung dịch NaOH 0,16M, thu đượcdung dịch X. Thêm 250 ml dung dich Y gồm BaCl2 0,16M và Ba(OH)2 a M vào dung dịch X,thu được 3,94 gam kết tủa và dung dịch Z. Tính giá trị của a.Câu 2 (4,0 điểm)1. A là một đồng đẳng của benzen có tỷ khối hơi so với metan bằng 5,75. A tham giachuyển hóa theo sơ đồHãy viết các phương trình hóa học theo sơ đồ trên, các chất hữu cơ viết dạng công thứccấu tạo rút gọn, cho biết B, C, D, E là các chất hữu cơ.2. Hỗn hợp khí X gồm metan, axetilen, propen. Đốt cháy hoàn toàn 5,5 gam hỗn hợp X,thu được 6,3 gam nước. Mặt khác, lấy 5,5 gam X cho tác dụng với dung dịch AgNO3 trongNH3 dư, thu được 24 gam kết tủa. Hãy xác định phần trăm theo thể tích từng chất trong X.Câu 3 (4,0 điểm)1. Nêu hiện tượng và viết phương trình hoá học xảy ra trong các trường hợp sau:a) Cho đồng kim loại vào dung dịch hỗn hợp NaNO3 và H2SO4 loãng.b) Sục khí NH3 đến dư vào dung dịch MgCl2.c) Cho (NH4)2CO3 vào dung dịch Ba(OH)2 .d) Hai lọ hóa chất mở nắp để cạnh nhau: một lọ đựng dung dịch NH3 đậm đặc, một lọđựng dung dịch HCl đặc.1 2. Dung dịch A chứa Na2CO3 0,1M và NaHCO3 0,1M; dung dịch B chứa KHCO3 0,1Ma) Tính thể tích khí CO2 (đktc) thoát ra khi cho từ từ từng giọt đến hết 150 ml dung dịchHCl 0,1M vào 100 ml dung dịch A.b) Xác định số mol các chất có trong dung dịch thu được khi thêm 100 ml dung dịchBa(OH)2 0,1M vào 150 ml dung dịch B.Câu 4 (3,5 điểm)1. Cho 200 ml dung dịch X chứa H2SO4 0,05M và HCl 0,1M tác dụng với 300 ml dungdịch Y chứa Ba(OH)2 a M và KOH 0,05M, thu được m gam kết tủa và 500 ml dung dịch Z cópH = 12. Tính giá trị của m và a.2. Hỗn hợp A gồm Mg, Al, Zn. Hòa tan hoàn toàn 7,5 gam A trong dung dịch HNO3,sau khi phản ứng kết thúc thu được dung dịch B và 1,12 lít hỗn hợp khí NO và N2O có số molbằng nhau. Cô cạn dung dịch B thu được 31,75 gam muối.Tính thể tích dung dịch HNO3 0,5 M tối thiểu để hòa tan hoàn toàn A.Câu 5 (2,0 điểm)Chia 2,24 lít (đktc) hỗn hợp X gồm hai anken phân tử khác nhau 2 nhóm CH2 thành haiphần bằng nhau.Phần 1: Đốt cháy hoàn toàn rồi cho sản phẩm cháy qua dung dịch Ca(OH)2 dư, thu được12,5 gam kết tủa.Phần 2: Cho tác dụng hoàn toàn với nước có xúc tác thu được hỗn hợp chỉ gồm 2 ancol.Đun nóng hỗn hợp 2 ancol với H2SO4 đặc ở 1400C một thời gian, thu được 1,63 gam hỗn hợp3 ete. Hoá hơi lượng ete thu được 0,4256 lít (đktc).a) Xác định công thức cấu tạo của hai anken và tính phần trăm theo thể tích mỗi chấttrong X.b) Xác định hiệu suất tạo ete của mỗi ancol.Câu 6 (2,0 điểm)1. Cho pin điện hóa: H 2 ( Pt ), PH = 1atm / H + :1M2MnO4− :1M , Mn 2+ :1M , H + :1M / PtBiết rằng sức điện động của pin ở 250C là 1,5V.0a) Hãy cho biết phản ứng thực tế xảy ra trong pin và tính EMnO−4Mn 2+b) Sức điện động của pin thay đổi như thế nào khi thêm một ít NaHCO3 vào nửa trái của pin.2. Ion Fe3+(dd) là axit, phản ứng với nước theo cân bằngFe3+ (dd) + H 2O Ç Fe(OH ) 2+ + H 3O + , K a = 10−2,2a) Xác định pH của dung dịch FeCl3 10−3 M .b) Tính nồng độ mol/lít của dung dịch FeCl3 bắt đầu gây ra kết tủa Fe(OH)3 và tính pHcủa dung dịch lúc bắt đầu kết tủa. Cho TFe ( OH ) = 10−38 , K H O = 10 −14 .Cho: H = 1; C = 12; N = 14; O = 16; Na = 23; Mg = 24; Al = 27; S = 32;Cl = 35,5; Ca = 40; Ba = 137; Fe = 56; Cu = 64; Zn = 65; Ag =108.322 …………………….HẾT…………………….SỞ GIÁO DỤC VÀ ĐÀO TẠO KÌ THI CHỌN HỌC SINH GIỎI CẤP CƠ SỞTỈNH ĐIỆN BIÊNNĂM HỌC 2012 - 2013( Hướng dẫn chấm có 5 trang)Môn: Hóa học - Lớp 11ĐÁP ÁN VÀ HƯỚNG DẪN CHẤMCâu1(4,5đ)ý1Nội DungĐiểm1,5 đ0t2 P + 3Ca → Ca3 P20t4 P + 5O2 → 2 P2O52P2O5 + H2O → 2H3PO4H3PO4 + 2NaOH → Na2HPO4 + 2H2ONa2HPO4 + NaOH → Na3PO4 + H2ONa3PO4 + 3AgNO3 →Ag3PO4 + 3NaNO3Đặt công thức của ancol no A: CnH2n+2Oa ( a≤ n)nCO2 = 0,15 mol, nH2O = 0,2 molCnH2n+2Oa +O2 → nCO2 + (n+1) H2O0,150,2→ n=3CT A là: C3H8Oaa =1→ C3H7OHa =2→ C3H6 (OH)2a =3→ C3H5 (OH)330,50,5CH3− CH2−CH2−OHCH3−CH−CH3OHHO−CH2− CH2−CH2−OHCH3−CH−CH2−OHOHOH−CH2−CH− CH2−OHOH0,250,251,568= 0, 07(mol ) ; nNaOH = 0,5 × 0,16 = 0, 08(mol )22, 4= 0, 25 × 0,16 = 0, 04(mol ) ; nBa (OH )2 = 0, 2a(mol )nCO2 =nBaCl23,94= 0, 02(mol )197CO2 + OH- → HCO3 0,07 0,080,07HCO3 + OH → CO32- + H2O0,070,010,012+2−t0Ba + CO3 → BaCO3 ↓0,020,02Do kết tủa thu được bằng 0,02 mol do đó lượng OH- cho thêm vào bằng 0,01molTa có : OH- = 0,5a → 0,5a = 0,01→ a = 0,02MA = 16Đặt công thức A : CnH2n-6 → 14n-6 = 92 → n =7nBaCO3 =2(4,0)10,50,50,52,03 CT :→Phương trình:C6H5-CH3 + Cl2C6H5-CH2Cl + HClC6H5-CH3 + 3H2 dưC6H11-CH3C6H5-CH3 + 3HNO3 → H2SO4đ C6H2(NO2)3-CH3 + 3H2OC6H5-CH3 + 2KMnO4C6H5-COOK + 2MnO2 + KOH + H2O2CH4 + O2 → CO2 + 2H2Oa2aC2H2 + O2 →2CO2 + H2ObbC3H6 + O2 → 3CO2 + 3H2Oc3c2a + b + 3c = 0,3516a + 26b + 42c = 5,5 b = 0,1C2H2 + AgNO3b3(4,0) 12→C2Ag2b2a + 3c = 0, 25Giải hệ phương trình ta được: a = 0,05, c= 0,0516a + 42c = 2,90, 050,1%VCH 4 =× 100% = 25%%VC2 H 2 =× 100% = 50%0, 20, 20, 05%VC3 H 6 =× 100% = 25%0, 2a) Cu tan, dung dịch xuất hiện màu xanh và khí không mầu hóa nâu trongkhông khí3Cu 2+ + 8 H + + 2 NO3− → 3Cu + 2 NO ↑ +4 H 2O2 NO + O2 → 2 NO2b) Có kết tủa trắng không tan2 NH 3 + 2 H 2O + MgCl2 → Mg (OH ) 2 ↓ +2 NH 4Clc) Có kết tủa trắng và có khí2( NH 4 ) 2 CO3 + Ba (OH ) 2 → BaCO3 ↓ +2 NH 3 ↑ +2 H 2Od) Tạo ra khói trắngNH 3( k ) + HCl( k ) → NH 4Cl( r )0,50,50,250,50,250,50,50,50,5a) nCO2− = 0, 01(mol ) ; nHCO − = 0, 01(mol ) ; nH + = 0,015(mol )32−33+−3CO + H → HCO0,01 0,010,02−30,5+HCO + H → CO2 ↑ + H 2O0,005 0,020,0054 V= 0,112 lítb. nHCO − = 0, 015(mol ) ; nBa (OH 2 ) = 0, 01(mol ) ; nOH − = 0, 02(mol )0,53HCO3- + OH- → CO32- + H2O0,015 0,0150,015→ dư 0,005 mol OH2+2Ba + CO3 → BaCO30,010,0150,01Dung dịch sau phản ứng có :KOH 0,005 molK2CO3 0,005 mol4(3,5) 10,50,5nH 2 SO4 = 0, 01(mol ) , nHCl = 0, 02(mol ) ; nBa (OH ) 2 = 0,3a (mol ) ;nKOH = 0, 015(mol ) ; nH + = 0, 04(mol ) ; nOH − = 0, 6a + 0, 015(mol )H+ + OH→H2O0,04 0,6a + 0,015 molDd sau phản ứng có pH = 12 → OH- dư có số mol = 0,5.10-2 = 0,005 molTa có 0,6a + 0,015 - 0,04 = 0,005 → a = 0,05Ba2+ + SO42- → BaSO40,015 0,010,01Khối lượng kết tủa = 2,33 (gam)25(2,0) 1Số mol hỗn hợp khí = 0,05 mol số mol mỗi khí = 0,025 molMg → Mg2+ + 2ea2aAl → Al3+ + 3eb3bZn → Zn2+ + 2ec2c+5N +3e → NO0,0250,0752N+5 + 8e → N2O0,05 0,2N+5 + 8e → NH4+x8xta có :3a + 3b + 2c = 0,275 + 8x31,75 = 7,5 + 62( 0,275 + 8x) + 80x → x = 0,0125Số mol HNO3 tham gia phản ứng = số mol HNO3 tạo khí + số mol HNO3 tạomuối = 0,025 + 0,05 + 0,275 + 8x0,0125 = 0,475(mol)0, 475→ VHNO == 0,95(l )30,512,5Đặt công thức 2 anken là CnH2n ( n≥ 2) ; nCaCO3 == 0,125(mol )1003nCn H 2 n + O2 → nCO2 + nH 2O20,050,05n0,50,50,250,250,50,50,250,250,50,25CO2 + Ca(OH)2 → CaCO3 + H2O0,05n0,1255 n=n1 = 20,125= 2,5 0, 05n2 = 4C2 H 4C4 H 80,25công thức phân tử Số mol C2H4 là a , C4H8 là ba + b = 0, 052a + 4b = 0,125Giải hệ phương trình ta được: a = 0,0375; b =0,0125Phần 2: Vì 2 anken + H2O tạo ra 2 ancol→ C4H8 là But-2-enCH 2 = CH 2 ;CH 3 − CH = CH − CH 3Ta có hệ phương trình: 2+0,250H ,tCH2=CH2 + H2O → CH3CH2OH0,01250,0125 (mol)H + ,t 0CH3−CH=CH−CH3 + H2O → CH3−CH−CH2−CH30,25OH0,0375 (mol)0,0375Gọi số mol C2H5OH phản ứng là xC4H9OH phản ứng là y0H 2 SO4 ,t2 ROH → ROR + H 2O0,038nete = nH 2O =6(2,0)10,250,019 0,0190, 4256= 0, 019(mol )22, 4mancol = mete + mH 2O = 1, 63 + 0, 019 ×18 = 1,972( gam)0,25Số mol ancol phản ứng = 0,038 mol x + y = 0, 038Ta có→ x = 0,03; y = 0,00846 x + 74 y = 1,972Hiệu suất của C2H5OH = 80%; Hiệu suất của C4H9OH = 64%Cho pin điện hóaH 2 ( Pt ), PH 2 = 1atm / H + :1M MnO4− :1M , Mn 2 + :1M , H + :1M / Pt0,25E0 pin 250C =1,5 V, ở điện cực phải có phản ứngMnO4- + H+ + 5e → Mn2+ + H2OĐiện cực trái H2 → 2H+ + 2ePhản ứng xảy ra trong pin :2MnO4- + 6H+ + 5H2 → 2Mn2+ + 8H2OE0pin=E0MnO42−−EMn 2+02H += 1,5(V )0,252−4= 0, 0(V )mà EH20Vậy: EMnO02H +H2= 1,5(V )Mn 2+b) Nếu thêm 1 ít NaHCO3 vào nửa trái của pin xảy ra phản ứngHCO3− + H + → CO2 + H 2OE2 H +H20,250,25+0, 059  H =lg2pH 26 vì nồng độ của ion H+ giảm, do đó E pin = EMnO−4Mn23+a) FeCl310-3Fe 3+ +[]-xKa =b) Fe 3+ + H2O[ ] C-xKa =sẽ tăng0,25H2Ka =0,250,25(1)3thế vào(2)→=0,25T=Từ 1,2 → (C-x) =(C-x) =H+x→ x = 8,78.PH = 3,06Fe(OH)2+ + H+ Ka =xxFe3+ + 3OH- Fe(OH)3Ta có :=→x=− E2 H +-Fe + 3Cl10-3H2OFe(OH)2+ +x=2+→ pH = 1,8→ C = 0,05566M(2).=0,250,25Lưu ý:- Phương trình hóa học thiếu cân bằng hoặc thiếu điều kiện (nếu có) hoặc cân bằng sai,hoặc sai sót cả cân bằng và điều kiện trừ 1/2 số điểm của phương trình đó.- Bài tập giải theo cách khác bảo đảm đúng thì vẫn được điểm tối đa. Nếu viết phươngtrình sai hoặc không cân bằng hoặc cân bằng sai thì những phần tính toán liên quan đếnphương trình hóa học đó dù có đúng kết quả cũng không cho điểm. (Nếu bài tập HS không làmđược nhưng viết được PTHH thì vận dụng đáp án cho ½ số điểm của phần đó ).7 UBND TỈNH THÁI NGUYÊNĐỀ THI CHỌN HỌC SINH GIỎI TỈNHSỞ GIÁO DỤC VÀ ĐÀO TẠONĂM HỌC 2011-2012MÔN THI: HOÁ HỌC LỚP 11ĐỀ CHÍNH THỨC(Thời gian làm bài 150 phút không kể thời gian giao đề)Câu I. (5,0 điểm)1. X là nguyên tố thuộc nhóm A, hợp chất với hidro có dạng XH3. Electron cuối cùngtrên nguyên tử X có tổng 4 số lượng tử bằng 4,5. Ở điều kiện thường XH3 là mộtchất khí. Viết công thức cấu tạo, dự đoán trạng thái lai hoá của nguyên tử trung tâmtrong phân tử XH3, trong oxit và hiđroxit ứng với hóa trị cao nhất của X.2. X, Y, R, A, B theo thứ tự là 5 nguyên tố liên tiếp trong Hệ thống tuần hoàn (HTTH)có tổng số điện tích là 90 (X có số điện tích hạt nhân nhỏ nhất).a) Xác định điện tích hạt nhân của X, Y, R, A, B. Gọi tên các nguyên tố đó.b) Viết cấu hình electron của X2−, Y−, R, A+, B2+. So sánh bán kính của chúng vàgiải thích.c) Trong phản ứng oxi hoá-khử, X2−, Y− thể hiện tính chất cơ bản gì? Vì sao?d) Cho dung dịch A2X vào dung dịch phèn chua thấy có kết tủa xuất hiện và có khíthoát ra. Giải thích và viết phương trình phản ứng.3.a) Giải thích vì sao cho dư NH4Cl vào dung dịch NaAlO2 rồi đun nóng thì thấy kếttủa Al(OH)3 xuất hiệnb) Hoàn thành phương trình hóa học (PTHH) của phản ứng oxi hoá-khử sau và cânbằng theo phương pháp cân bằng electron:NaNO2 + KMnO4 + ?? + MnSO4 + ? + ?Câu II. (5,0 điểm)1. Viết các PTHH của các phản ứng để thực hiện sơ đồ biến hoá hóa học sau:B1+H2OCH3-CHOB2+H2OCH3-CHOhiđrocacbon X+H2OCH3-CHOA1+H2OCH3-CHOA2+H2OCH3-CHO2. Khi cho 13,8 gam glixerin (A) tác dụng với một axit hữu cơ đơn chức (B) thu đượcchất hữu cơ E có khối lượng bằng 1,18 lần khối lượng chất A ban đầu. Biết rằng hiệusuất phản ứng đạt 73,75%. Tìm công thức cấu tạo của B và E.Câu III. (5,0 điểm)Hoà tan 2,16 gam hỗn hợp (Na, Al, Fe) vào nước dư thu được 0,448 lít khí (ởđktc) và một lượng chất rắn. Tách lượng chất rắn này cho tác dụng hết với 60 ml dungdịch CuSO4 1M thì thu được 3,2 gam Cu và dung dịch A. Cho dung dịch A tác dụngvừa đủ với dung dịch NaOH để thu được lượng kết tủa lớn nhất. Nung kết tủa trongkhông khí đến khối lượng không đổi thu được chất rắn B.a) Xác định khối lượng từng kim loại trong hỗn hợp.b) Tính khối lượng chất rắn B. Câu IV. (2,5 điểm)Sau khi đun nóng 23,7gam KMnO4 thu được 22,74 gam hỗn hợp chất rắn. Cho hỗnhợp chất rắn trên tác dụng hoàn toàn với dung dịch axit HCl 36,5% (d = 1,18g/ml) đunnóng.1) Viết PTHH của các phản ứng xảy ra.2) Tính thể tích khí Cl2 thu được (ở đktc).3) Tính thể tích dung dịch axit HCl cần dùng.CâuV. (2,5 điểm)Hòa tan x gam hỗn hợp gồm CuCl2 và FeCl3 vào nước, thu được dung dịch A. Chiadung dịch A làm hai phần bằng nhau. Cho lượng dư khí hiđro sunfua vào phần một thuđược 1,28 gam kết tủa. Cho lượng dư dung dịch Na2S vào phần hai thu được 3,04 gamkết tủa. Viết PTHH của các phản ứng xảy ra và tính x.(Cho: H=1; C =12; N=14; O=16; Na=23; Be=9; Mg=24; Al=27; P=31; S=32;Cl=35,5; K=39; Fe=56; Cu=64; Br=80; Ag=108.)Hết( Gi¸m thÞ kh«ng gi¶i thÝch g× thªm)Hä vµ tªn thÝ sinh:............................................................................................Sè b¸o danh:..................................... UBND TỈNH THÁI NGUYÊNSỞ GIÁO DỤC VÀ ĐÀO TẠOĐỀ CHÍNH THỨCHD CHẤM ĐỀ THI CHỌN HSG TỈNHNĂM HỌC 2011-2012MÔN THI: HOÁ HỌC LỚP 11(Thời gian làm bài 150 phút không kể thời gian giao đề)CâuNội dungĐiểm1,51.Vì X thuộc nhóm A, hợp chất với hidro có dạng XH3 nên là nhóm VA(ns2np3). Vậy: ms = +1/2; l = 1 ; m = +1n = 4,5 – 2,5 = 2.Vậy X là Nitơ ( 1s22s22p3)ICông thức cấu tạo các hợp chất và dự đoán trạng thái lai hóa của(3,0)nguyên tử trung tâm:NH3 : N có trạng thái lai hoá sp3.NHHH2N2O5: N có trạng thái lai hoá sp .OONONOO2HNO3 : N có trạng thái lai hoá spOOHNO2.a) Gọi Z là số điện tích hạt nhân của X=> Số điện tích hạt nhân của Y, R, A, B lần lượt(Z + 1), (Z + 2), (Z + 3), (Z + 4) Theo giả thiếtZ + (Z + 1) + (Z + 2) + (Z + 3) + (Z + 4) = 90=> Z = 16→ 16X; 17Y; 18R; 19A; 20B(S) (Cl) (Ar) (K) (Ca)2b) S , Cl-, Ar, K+, Ca2+ đều có cấu hình e: 1s2 2s2 2p6 3s2 3p6Số lớp e giống nhau => r phụ thuộc điện tích hạt nhân. Điện tích hạt nhâncàng lớn thì bán kính r càng nhỏ.1,5rS 2- > rC l - > rA r > rK + > rC a 2+c) Trong phản ứng oxi hóa – khử, ion S2-, Cl- luôn luôn thể hiện tính khửvì các ion này có số oxi hóa thấp nhấtd) Dung dịch phèn chua: K+, Al3+, SO42- khi cho dung dịch K2S vào2Al3+ + 3S2- = Al2S3↓Al2S3 + 6H2O → 2Al(OH)3↓ + 3H2S↑3.a)2,0 NaAlO 2 → Na + + OH −+4NH 4 Cl → NH + Cl+4NH ⇔ NH 3 + H(1)−(2)+(3)AlO −2 + H + ⇔ HAlO 2 + H +(4)HAlO 2 + H 2 O ⇔ Al(OH ) 3(5)Khi đun nóng thì NH3 bay đi làm cho cân bằng (3) và do đó (4,5) chuyểndịch sang phải, nghĩa là kết tủa Al(OH)3 xuất hiệnb)5NaNO2+2KMnO4+ 3H2SO45NaNO3 + 2MnSO4 + K2SO4 + 3H2O3,01.X: C2H2A1:CH2=CHClA2:CH3 -CH2ClB1: CH2=CH-OCOCH3B2: CH3 -CHCl-OCOCH3Các PTHH của các phản ứng (9 PTHH).B1II(5,0)B2+H2Ohiđrocacbon X+H2OCH3-CHO+H2OCH3-CHO2.A1A2+H2OCH3-CHO+H2OCH3-CHOCH3-CHOnA= 13,8: 92 = 0,15molPhương trình phản ứng:C3H5(OH)3 +xRCOOHC3H5(OH)3-x(OCOR)x + xH2OmE = 13,8 x 1,18 = 16,284gamME=2,0(1 ≤ x ≤ 3 )16, 284 100x= 1480,15 73,35ME= 41+ 17(3-x) + (44+R)x⇒ R=56 − 27xxNếu x = 1 ⇒ R = 29 ⇒ B: C2H5COOH;E có 2 đồng phânNếu x = 2 ⇒ R = 1 ⇒ B: HCOOH;E có 2 đồng phânNếu x = 2 ⇒ R < 0 : không phù hợp1,0nH2 = 0,448:22,4 = 0,02nCu 2+ = 0,06.1= 0,06; nCu 2+ pu = 3,2:64 = 0,05III(5,0)⇒ nCu 2+ du = 0,06 -0,05 = 0,01Các phản ứng: Na + H2Ox→( Na+ + OH-)x+1H2 (1)2x/2 (mol) Al + H2O + OH- → AlO2- +3H22(2)xxx3/2x (mol)2+3+2Al + 3Cu → 2Al + 3Cu(3)(y-x)3/2(y-x(y-x)3/2(y-x)Fe+ Cu2+ → Fe2+ + Cu(4)a) Giả sử không có (3) xảy ra ⇒ chất rắn chỉ là FeTheo (4) noFe= nCu = 0,05 ⇒ moFe= 0,05.56 = 2,8>2,16(không phù hợp đề bài)2+Vậy có (3) và vì Cu còn dư nên Al và Fe đã phản ứng hết theo (3) và (4)Theo (1) và (2): nH2 = x+Theo (3): nAl(3) = y - 0,01nCu2+=2,03x = 0,02 ⇒ x = 0,0123(y - 0,01)2Theo (4): nFe = nCu2+(4)= 0,05-3(y - 0,01)2Ta có : mNa + mAl + mFe = 23.0,01 + 27y + 56[0,05⇒ y = 0,03Vậy trong hỗn hợp ban đầu:mNa = 23.0,01 = 0,23 gamm Al = 27.0,03 = 0,81 gammFe = 2,16 - 0,23 -0,81 = 1,12 gam3(y - 0,01)] =2,162b) Trong dung dịch A có:2,0nAl3+ = 0,03 − 0, 01 = 0, 02nCu 2+ du = 0, 01nFe2+ = nFe = 1,12 : 56 = 0, 02Ta có sơ đồCu2+ → Cu(OH)2 → CuO⇒ mCuO = 0,01.80= 0,8 gam2+Fe → Fe(OH)2 → Fe(OH)3 → Fe2O3 ⇒ mFe2O3 = 0,02/2.160 = 1,6 gamAl3+ → Al(O )3 → Al2O3⇒ m Al2O3 = 0,02/2.102 = 1,02gamVậy mB = 0,8 + 1,6 + 1,02 = 3,24 gam1. Các phương trình phản ứng xảy rat2KMnO4 → K2MnO4 + MnO2 + O2↑Chất rắn sau phản ứng gồm: K2MnO4 , MnO2 và KMnO4 chưa phản ứng :Cho sản phẩm tác dụng với dung dịch HCl có các phản ứng2KMnO4 + 16HCl → 2KCl + 2MnCl2 + 5Cl2 + 8H2OK2MnO4 + 8HCl → 2KCl + MnCl2 + 2Cl2 + 4H2OtMnO2 + 4HCl → MnCl2 + Cl2 + 2H2O0IV(2,5)00,5 2. Ta có các quá trình:Mn+70,15mol2O-2 →1,0+5e5.0,15→ Mn+2O2+4e(23,7 – 22,74)/320,03.42Cl → Cl2+ 2ex2.xÁp dụng định luật bảo toàn e ta có:5.0,15 = 0,03.4 + 2x → x= 0,315 mol → V = 0,315.22,4 = 7,056 lít3. Áp dụng định luật bào toàn nguyên tốnHCl = nKCl + 2nMnCl + 2nCl = 0,15 + 2.0,15 + 2.0,315 = 1,08 mol21,021, 08.36,5.100Vậy Vdung dịch HCl == 91,53(ml )36,5.1,18V(2,5)Phần 1: CuCl2 + H2S → CuS↓ + 2HCl (1)2FeCl3 + H2S → 2FeCl2 + S↓ + 2HCl (2)Phần 2: CuCl2 + Na2S → CuS↓ + 2NaCl (3)2FeCl3 + 3Na2S → 2FeS↓ + S↓ + 6NaCl (4)Đặt số mol CuCl2 và FeCl3 trong mỗi phần là a và b mol.1,01,5Từ các phương trình (1), (2), (3), (4) ta có96a + 16b = 1,2896a + 104b = 3,04(I)(II)Giải hệ (I) và (II ) ta được a= 0,01 mol và b = 0,02 molTừ đó ta có x = 2(135.0,01 + 162,5.0,02) = 9,2 gam.Chú ý:ThÝ sinh cã thÓ gi¶i bµi to¸n theo c¸ch kh¸c nÕu lËp luËn ®óng vµ t×m ra kÕt qu¶ ®óng vÉn cho®iÓm tèi ®a. Họ và tên thí sinh:……………………..…………..Chữ ký giám thị 1:Số báo danh:……………………………..………...…………….………………..SỞ GDĐT BẠC LIÊUKỲ THI CHỌN HSG LỚP 10, 11 VÒNG TỈNHNĂM HỌC 2011 - 2012ĐỀ CHÍNH THỨC* Môn thi: HÓA HỌC* Bảng: A* Lớp: 11* Thời gian: 180 phút (Không kể thời gian giao đề)(Gồm 02 trang)ĐỀCâu 1: (4 điểm)1. (1.0đ)Tính Δ S của phản ứng sau:SO2(k) +Cho biết:Chất0S 298 (J.K-1.mol-1)1O2(k) J SO3(k)2SO2(k)248,52O2(k)205,03SO3(k)256,222. (1.0đ)Tính Δ H của các phản ứng và cho biết chúng tỏa nhiệt hay thu nhiệt:a. H2 (k) + Cl2 (k) J 2HCl (k) ; Δ Ha = ?t2Hg (l) + O2 (k) ; Δ Hb = ?b. 2HgO (r) ⎯⎯→Biết năng lượng liên kết các chất như sau:Cl2HClHgO2ChấtH2-1Elk(k.J.mol )435,9242,4431,061,2498,703. (1.0đ)Xác định Δ H 0pu của phản ứng sau:4FeCO3 (tt) + O2 (k) J 2Fe2O3 (tt) + 4CO2 (k)Biết Δ H 0298 của các chất:O2Fe2O3ChấtFeCO3–747,680,0–821,32Δ H 0298 (kJ.mol-1)HgO355,7CO2–393,514. (1.0đ)Tính nhiệt tạo thành (entanpi sinh chuẩn) Δ H 0298 của CaCO3 biết các dữ kiện:CaCO3 (r) J CaO (r) + CO2 (k); Δ H1 = 200,8kJ1O2 (k) J CaO (r) ; Δ H2 = – 636,4kJ2C(grafit) + O2 (k) J CO2 (k); Δ H3 = –393 kJCa (r) +1 Câu 2: (4 điểm)Cho m1 (g) gồm Mg và Al vào m2 (g) dung dịch HNO3 24%. Sau khi các kimloại tan hết có 8,96(l) hỗn hợp khí A gồm NO; N2O; N2 bay ra (đktc) và dung dịch X.Thêm một lượng O2 vừa đủ vào A, sau phản ứng thu được hỗn hợp khí B. Dẫn B từ từqua dung dịch NaOH dư, có 4,48 (l) hỗn hợp khí C đi ra (đktc). Tỉ khối hơi của C đốivới H2 bằng 20. Nếu cho dung dịch NaOH vào dung dịch X để lượng kết tủa lớn nhấtthì thu được 62,2 (g) kết tủa.a. Tính m1 và m2. Biết lượng HNO3 đã lấy dư 20% so với lượng cần thiết.b. Tính nồng độ % các chất trong dung dịch X.Câu 3: (4 điểm)1. Viết tất cả các đồng phân lập thể của 3-clo-pentan-2-ol và chỉ rõ cấu hìnhtuyệt đối của các đồng phân đó.2. Hãy gọi tên các chất sau:(b)(a)CH3(c)CH3(d)3. Đốt cháy hoàn toàn hợp chất hữu cơ A thu được hỗn hợp khí gồm CO2, hơinước và N2 có tỷ khối hơi so với H2 là 13,75. Cho hỗn hợp khí đó lần lượt đi qua ống 1đựng P2O5 và ống 2 đựng KOH rắn thấy tỷ lệ tăng khối lượng của ống 2 so với ống 1là 1,3968. Số mol O2 cần để đốt cháy hoàn toàn A bằng một nửa số mol CO2 và H2Otạo thành. Khối lượng phân tử của A nhỏ hơn khối lượng phân tử của anilin. Xác địnhcông thức phân tử và viết công thức cấu tạo của A.Câu 4: (4 điểm)1. Hỗn hợp X gồm 1 hidrocacbon A và khí hidro. Đun X có xúc tác Ni thu đượckhí Y duy nhất. Tỉ khối hơi của Y so với khí hidro gấp ba lần tỉ khối hơi của X so vớikhí hidro. Đốt cháy hoàn toàn một lượng khác của Y thu được 22g khí cacbonic và13,5g nước. Xác định A.2. Limonen C10H16 có trong tinh dầu chanh. Biết limonen có cấu tạo tương tựsản phẩm nhị hợp 2 phân tử isopren, trong đó một phân tử kết hợp kiểu 1,4 và mộtphân tử isopren còn lại kết hợp kiểu 3,4. Hidro hóa hoàn toàn limonen thu đượcmentan.Hãy viết công thức cấu tạo của limonen, mentan và viết phương trình phản ứngđiều chế limonen từ isopren và mentan từ limonen.Câu 5: (4 điểm)1. Một hidrocacbon X có chứa 10% hidro về khối lượng. X không làm mất màudung dịch brom (trong CCl4), Mx < 150. Viết các công thức cấu tạo và gọi tên cácđồng phân của X.2. Khi cho X tác dụng với dung dịch KMnO4 (đặc, đun nóng) thu được 2 muốihữu cơ. Xác định công thức cấu tạo đúng của X và viết phương trình hóa học xảy ra.--- HẾT --2 SỞ GDĐT BẠC LIÊUKỲ THI CHỌN HSG LỚP 10, 11 VÒNG TỈNHNĂM HỌC 2011 - 2012ĐỀ CHÍNH THỨC* Môn thi: HÓA HỌC* Bảng: A* Lớp: 11* Thời gian: 180 phút (Không kể thời gian giao đề)(Gồm 05 trang)HƯỚNG DẪN CHẤMCâu 1: (4 điểm)1. (1.0đ)Tính Δ S của phản ứng :1O2(k) J SO3 (k)2⎡⎤1D Δ S 0298 = S 0298 (SO3, k) – ⎢ S 0298 (SO2, k) + S 0298 (O2, k) ⎥2⎣⎦205, 03 ⎞⎛−1= 256, 22 − ⎜ 248,52 +⎟ = − 94,82 JK2⎝⎠SO2(k) +(1.0đ)2. (1.0đ)a. Δ Ha = (435,9 + 242,4) – (2 x 431) = – 183,7kJ < 0J phản ứng tỏa nhiệtb. Δ Hb = (2 x 355,7) – (2 x 61,2 + 498,7) = 90,3kJ > 0J phản ứng thu nhiệt(0.25đ)(0.25đ )(0.25đ )(0.25đ)3. (1.0đ)Xác định Δ H 0pu của phản ứng :4FeCO3 (tt) + O2 (k) J 2Fe2O3 (tt) + 4CO2 (k)Áp dụng công thức ta có:0Δ H pu =[2(–821,32) + 4(–393,51)] – [ 4(–747,68)] = – 225,96Kj < 0J phản ứng tỏa nhiệt(0.5đ)(0.5đ)4. (1.0đ)Tính nhiệt tạo thành (entanpi sinh chuẩn) Δ H 0298 của CaCO3Theo định luật Hess ta có: Δ H1 = Δ H2 + Δ H3 – Δ H 0298 (CaCO3)J Δ H 0298 (CaCO3) = – 636,4 –393 – 200,8 = – 1230,2kJ(0.5đ)(0.5đ)Câu 2: (4 điểm)a. Gọi x = nNO, y = n N O , z = n N , nMg = a, nAl = b.2Mg→a(mol)Al→b(mol)2Mg2+ + 2ea2aAl3+ + 3eb3b(1)(2)(0.25đ)1 NO3− +4H ++3e →0,8(mol)2 NO−32 NO−3+10 H+2 H 2O(3)(0.25đ)(4)(0.25đ)(5)(0.25đ)(6)(0.25đ)(7)(0.25đ)0,6(mol) 0,2(mol)++1,5(mol)+NO12 H8e→1,2(mol)++0,6(mol)+N 2O5H 2 O0,15(mol)10e →+N26H 2O0,5(mol) 0,05(mol)8,96nA = x + y + z == 0,4(mol )22,4Thêm O2 vào A, chỉ có NO phản ứng:2NO + O2 → 2 NO2x(mol)x(mol)Dẫn khí B qua dung dịch NaOH:2NaOH + 2NO2 → NaNO2 + NaNO3 + H2OHỗn hợp C gồm N2 và N2O4, 48= 0, 2(mol )22, 444 y + 28 z= 2.20 = 40M=y+znC = y + z =(0.25đ)Suy rax = 0,2 (mol)z = 0,05 (mol)y = 0,15 (mol)dd X + NaOH → ↓ maxMg2+ + 2OH- → Mg(OH)2↓a(mol)a+ 3OH- →Al(OH)3 ↓Al3+b(mol)b⇒ m↓ max = 58a + 78 b = 62,2Ta có : 2a + 3b = 0,6 + 1,2 + 0,5 = 2,3⇒a = 0,4; b = 0,5mMg + mAl = (24 . 0,4) + (27 . 0,5) = 23,1 (g) = m1(3); (4); (5) ⇒ ∑ n HNO = n H = 0,8 + 1,5 + 0,6 = 2,9(mol )3(0.25đ)(8)(9)(0.25đ)(0.25đ)(0.25đ)+2,9.20= 0,58( mol )100(2,9 + 0,58).63.100 = 913,5( g )m ddHNO3 24% = m 2 =24n HNO3 dư =(0.5đ)b. Khối lượng dung dịch X:m X = 23,1 + 913,5 − [(30.0,2) + (44.0,15) + (28.0,05)] = 922,6( g )nMg ( NO3 ) = nMg = 0, 4( mol )2nAl ( NO3 ) = nAl = 0,5( mol )3Nồng độ các chất trong dung dịch X:2(0.25đ) 0, 4.148.100%= 6, 417%922, 60,5.213.100%C % Al ( NO3 )3 == 11,543%922, 60,58.63.100%C% HNO3 dư == 3,961%922, 6C % Mg ( NO3 )2 =(0.5đ)Câu 3: (4 điểm)1. Có 4 đồng phân lập thểCH3CH3HOHHClCH3CH3HOHHOHClHClHC2H5C2H5HOHHClC2H52S,3R2R,3S2S,3S(viết đúng mỗi đồng phân và chỉ rõ cấu hình 0,25đ/đp)C2H52R,3R(1.0đ)2.(b)(a)xiclobutylxiclobutanxiclopropylxiclopentanCH3(c)CH3(d)1-xiclopentyl-4-metylcyclohexan(3-metylcyclopentyl)xiclohexan(1.0đ)(gọi tên đúng mỗi chất 0,25đ/chất)3. Gọi công thức của A là: CxHyOzNtPhản ứng đốt cháy:CxHyOzNt + ( x +y zyt- ) O2 → xCO2 + H2O + N24 222Ống 1 hấp thụ hơi nướcỐng 2 : CO2 + 2KOH → K2CO3 + H2OTheo đầu bài tăng khối lượng ở ống 1, 2 ta có tỷ lệ:x:y 1,3968.18x 2=→=244.1y 7(0.5đ)(0.25đ)Mặt khác theo lượng O2 ta có:x+1yzy- = (x+ ) → x=z4 222(0.25đ)Như vậy: x : y : z = 2 : 7 : 2 và CTĐG của A là C2H7O2Nt (vì khối lượng nhóm(0.25đ)C2H7O2 là 63 mà khối lượng anilin là 93)Phản ứng đốt cháy được viết lại là:3 11O2 → 4CO2 + 7H2O + tN2244.4 + 18.7 + 28.t= 13,75.2 ⇒ t = 1 ⇒ CTPT A: C2H7O2N4+7+t2C2H7O2Nt +(0.5đ)CTCT A: CH3COONH4(0.25đ)Câu 4: (4 điểm)1.Số mol CO2 = 0,5 mol.Số mol H2O = 0,75 mol.Đốt Y sinh ra: nH2O > n CO2 ⇒ Y là ankan.CnH2n+2 → nCO2 + (n+1)H2O0,5mol 0,75molTa có: 0,75n = 0,5(n+1)⇒ n = 2 ⇒ Y là C2H6Vậy A có thể là C2H2 hoặc C2H4Với A là C2H2, ta có: C2H2 + 2H2 → C2H6dY / H 2dX / H2=30MY==3M X 26 + 2.233(0.25đ)(0.25đ)(0.25đ)(0.25đ)Phù hợp(0.5đ)Với A là C2H4, ta có: C2H4 + H2 → C2H6dY / H 2dX / H2=30MY==2≠3282MX+2 2Không phù hợp(0.5đ)2.CTCT Limonen.(0.5đ)CTCT mentan.(0.5đ)Phương trình phản ứng:C H 2= C HC=CHCHC H 2= C H2CH32C=CHH320t , xt⎯⎯⎯→(0.5đ)02t , xt⎯⎯⎯→(0.5đ)Câu 5: (4 điểm)1. Đặt CTPT hidrocacbon X là CxHy (x, y > 0)Ta có12x/y = 90/10⇒ x/y = 9/12⇒ CTĐN nhất của X là C9H124(0.25đ)(0.25đ)(0.25đ) Với MX < 150⇒ CTPT của X là C9H12Công thức cấu tạo thu gọn có thể có của X là:(0.25đ)CH2CH2CH3: n-proylbenzen(0.25đ): izopropylbenzen(0.25đ): 2 - etyltoluen(0.25đ): 3 - etyltoluen(0.25đ): 4 - etyltoluen(0.25đ): 1,2,3 - trimetylbenzen(0.25đ): 1,2,4 - trimetylbenzen(0.25đ)CH(CH3)2CH3C2H5CH3C2H5CH3C 2H 5CH3CH3CH3CH3CH3CH3CH3CH3CH3: 1,3,5 - trimetylbenzen2. X tác dụng với dd KMnO4 (đặc, nóng) tạo ra 2 muối hữu cơ(0.25đ)⇒ X là(0.5đ)CH2CH2CH3CH2CH2CH33+ 10KMnO4 → 3C6H5COOK + 3CH3COOK + 10MnO2 + 4KOH +(0.5đ)+ 4H2O--- HẾT--5 Họ và tên thí sinh:……………………..…………..Chữ ký giám thị 1:Số báo danh:……………………………..………...…………….………………..SỞ GDĐT BẠC LIÊUKỲ THI CHỌN HSG LỚP 10, 11 VÒNG TỈNHNĂM HỌC 2011 - 2012ĐỀ CHÍNH THỨC* Môn thi: HÓA HỌC* Bảng: B* Lớp: 11* Thời gian: 180 phút (Không kể thời gian giao đề)(Gồm 02 trang)ĐỀCâu 1: (4 điểm)1. (1.0đ)Tính Δ S của phản ứng sau:SO2(k) +Cho biết:Chất0S 298 (J.K-1.mol-1)1O2(k) J SO3(k)2SO2(k)248,52O2(k)205,032. (1.0đ)Tính Δ H của các phản ứng và cho biết chúng tỏa nhiệt hay thu nhiệt:a. H2 (k) + Cl2 (k) J 2HCl (k) ; Δ Ha = ?t2Hg (l) + O2 (k) ; Δ Hb = ?b. 2HgO (r) ⎯⎯→Biết năng lượng liên kết các chất như sau:Cl2HClHgO2ChấtH2Elk(k.J.mol-1)435,9242,4431,061,2498,73. (1.0đ)Xác định Δ H 0pu của phản ứng sau:4FeCO3 (tt) + O2 (k) J 2Fe2O3 (tt) + 4CO2 (k)Biết Δ H 0298 của các chất:O2Fe2O3ChấtFeCO3-10–747,680,0–821,32Δ H 298 (kJ.mol )SO3(k)256,220HgO355,7CO2–393,514. (1.0đ)Tính nhiệt tạo thành (entanpi sinh chuẩn) Δ H 0298 của CaCO3 biết các dữ kiện:CaCO3 (r) J CaO (r) + CO2 (k); Δ H1 = 200,8kJ1O2 (k) J CaO (r) ; Δ H2 = – 636,4kJ2C(grafit) + O2 (k) J CO2 (k); Δ H3 = –393 kJCa (r) +Câu 2: (4 điểm)1. Hãy tìm các chất thích hợp trong các sơ đồ sau và viết các phương trình phản ứng.Cho biết S là lưu huỳnh, mỗi chữ cái còn lại là một chất.S + A Æ X(1)S + B ÆY(2)Y + A Æ X + E(3)X + D Æ Z(4)1 X + D + E Æ U + V (5)Y + D + E Æ U + V (6)Z + E Æ U + V(7)2. Hòa tan hoàn toàn một lượng hỗn hợp A gồm Fe3O4 và FeS2 trong 25 gam dungdịch HNO3 tạo khí duy nhất màu nâu đỏ có thể tích 1,6128 lít (đktc). Dung dịch thuđược cho tác dụng vừa đủ với 200 ml dung dịch NaOH 1M, lọc kết tủa đem nung đếnkhối lượng không đổi, được 3,2 gam chất rắn. Tính khối lượng các chất trong A vànồng độ % của dung dịch HNO3 (giả thiết HNO3 không bị mất do bay hơi trong quátrình phản ứng).Câu 3: (4 điểm)1. Hãy biểu diễn các hợp chất sau bằng công thức chiếu Fisơ:a. Axit R - lacticb. S - alanin2. Gọi tên các hợp chất sau theo danh pháp thay thếa.CH2 – CH2 – CH2 – CH2 – CH3CH2 = C – CH2 –C C – CH – CH3CH3b.CH3c.3. Hợp chất hữu cơ A có 74,074% C; 8,642% H; còn lại là N. Dung dịch Atrong nước có nồng độ % khối lượng bằng 3,138%, sôi ở nhiệt độ 100,372oC; hằng sốnghiệm sôi của nước là 1,86. Xác định công thức phân tử của A.Câu 4: (4 điểm)1. Hỗn hợp X gồm 1 hidrocacbon A và khí hidro. Đun X có xúc tác Ni thu đượckhí Y duy nhất. Tỉ khối hơi của Y so với khí hidro gấp ba lần tỉ khối hơi của X so vớikhí hidro. Đốt cháy hoàn toàn một lượng khác của Y thu được 22g khí cacbonic và13,5g nước. Xác định A.2. Limonen C10H16 có trong tinh dầu chanh. Biết limonen có cấu tạo tương tựsản phẩm nhị hợp 2 phân tử isopren, trong đó một phân tử kết hợp kiểu 1,4 và mộtphân tử isopren còn lại kết hợp kiểu 3,4. Hidro hóa hoàn toàn limonen thu đượcmentan.Hãy viết công thức cấu tạo của limonen, mentan và viết phương trình phản ứngđiều chế limonen từ isopren và mentan từ limonen.Câu 5: (4 điểm)1. Một hidrocacbon X có chứa 10% hidro về khối lượng. X không làm mất màudung dịch brom (trong CCl4), Mx < 150. Viết các công thức cấu tạo và gọi tên cácđồng phân của X.2. Khi cho X tác dụng với dung dịch KMnO4 (đặc, đun nóng) thu được 2 muốihữu cơ. Xác định công thức cấu tạo đúng của X và viết phương trình hóa học xảy ra.--- HẾT --2 SỞ GDĐT BẠC LIÊUĐỀ CHÍNH THỨCKỲ THI CHỌN HSG LỚP 10, 11 VÒNG TỈNHNĂM HỌC 2011 - 2012* Môn thi: HÓA HỌC* Bảng: B* Lớp: 11* Thời gian: 180 phút (Không kể thời gian giao đề)(Gồm 05 trang)HƯỚNG DẪN CHẤMCâu 1: (4 điểm)1. (1.0đ)Tính Δ S của phản ứng :1O2(k) J SO3 (k)2⎡⎤1D Δ S 0298 = S 0298 (SO3, k) – ⎢ S 0298 (SO2, k) + S 0298 (O2, k) ⎥2⎣⎦205, 03 ⎞⎛−1= 256, 22 − ⎜ 248,52 +⎟ = − 94,82 JK2⎝⎠SO2(k) +(1.0đ)2. (1.0đ)a. Δ Ha = (435,9 + 242,4) – (2 x 431) = – 183,7kJ < 0J phản ứng tỏa nhiệtb. Δ Hb = (2 x 355,7) – (2 x 61,2 + 498,7) = 90,3kJ > 0J phản ứng thu nhiệt(0.25đ)(0.25đ )(0.25đ )(0.25đ)3. (1.0đ)Xác định Δ H 0pu của phản ứng :4FeCO3 (tt) + O2 (k) J 2Fe2O3 (tt) + 4CO2 (k)Áp dụng công thức ta có:0Δ H pu =[2(–821,32) + 4(–393,51)] – [ 4(–747,68)] = – 225,96Kj < 0J phản ứng tỏa nhiệt(0.5đ)(0.5đ)4. (1.0đ)Tính nhiệt tạo thành (entanpi sinh chuẩn) Δ H 0298 của CaCO3Theo định luật Hess ta có: Δ H1 = Δ H2 + Δ H3 – Δ H 0298 (CaCO3)J Δ H 0298 (CaCO3) = – 636,4 –393 – 200,8 = – 1230,2kJ(0.5đ)(0.5đ)Câu 2: (4 điểm)1. Mỗi phương trình 0.25 điểm x 7 = 1.75đX là SO2, Y là H2SotSO2S + O2 ⎯⎯→1 otH2SS + H2 ⎯⎯→H2S +3toO2dư ⎯⎯→SO2 + H2O2SO2 + Cl2 ⎯⎯→ SO2Cl2( hoặc Br2)SO2 + Cl2 + H2O ⎯⎯→ 2HCl + H2SO4H2S + 4Cl2 + 4H2O ⎯⎯→ H2SO4 +8HClSO2Cl2 + 2H2O ⎯⎯→ 2HCl +H2SO42. Các phương trình phản ứng:Fe3O4 + 10H+ + NO3- → 3Fe3+ + NO2 ↑ + 5H2O(1)(0.25đ)FeS2 + 14H+ + 15NO3- → Fe3+ + 2SO42- + 15NO2 ↑ + 7H2OH+ + OH- → H2O(2)(3)(0.25đ)(0.25đ)Fe3+ + 3OH- → Fe(OH)3 ↓t2Fe(OH)3 ⎯⎯→ Fe2O3 + 3H2O(4)(5)(0.25đ)0Gọi số mol Fe3O4 và FeS2 ban đầu lần lượt là x và y mol.Từ n NO =21,61283,2= 0,072mol và n Fe3+ = 2n Fe2O3 = 2 ×= 0,04mol22,4160(0.25đ)ta có:⎧ 3x + y = 0,04⎧x = 0,012mol, vậy⇒⎨⎨⎩x + 15 y = 0,072 ⎩ y = 0,004moln H + (1,2) = 10x + 14 y = 0,176mol⎧m Fe3O 4 = 0,012 × 232 = 2,784g⎨⎩ m FeS2 = 0,004 × 120 = 0,480g(0.5đ)n H + (3) = n OH − (3) = 0,2 − (3 × 0,04) = 0,08mol⇒ n HNO3 = n H + (1,2,3) = 0,256mol⇒ C% =(0.25đ)0, 256 × 63× 100% = 64,51%25(0.25đ)Câu 3: (4 điểm)1. a.COOHOHH(0.5đ)CH3b.(0.5đ)COOHOHH2NCH32 2. a. 6 - metyl - 2- n-pentylhept - 1 - en -4 - in.(0.25đ)b. 2 - metylnaphtalen(0.25đ)c. Bixiclo[1.1.0]butan hoặc bixiclobutan.(0.5đ)3. C : H : N =M=74,074 8,642 17,284::= 5 : 7 : 1 ⇒ (C5H7N)n12114(1.0đ)k .m3,1381= 1,86 ×× 1000 ×= 162 g / mol96,8620,372Δt(0.5đ)(0.5đ)⇒ 81n = 162 ⇒ n = 2; CTPT: C10H14N2Câu 4: (4 điểm)1.Số mol CO2 = 0,5 mol.Số mol H2O = 0,75 mol.Đốt Y sinh ra: nH2O > n CO2 ⇒ Y là ankan.CnH2n+2 → nCO2 + (n+1)H2O0,5mol 0,75molTa có: 0,75n = 0,5(n+1)⇒ n = 2 ⇒ Y là C2H6Vậy A có thể là C2H2 hoặc C2H4Với A là C2H2, ta có: C2H2 + 2H2 → C2H6dY / H 2dX / H2=MY30==3262.2MX+33(0.25đ)(0.25đ)(0.25đ)(0.25đ)Phù hợp(0.5đ)Với A là C2H4, ta có: C2H4 + H2 → C2H6dY / H 2dX / H2=MY30==2≠3M X 28 + 22 2Không phù hợp(0.5đ)2.CTCT Limonen.(0.5đ)CTCT mentan.(0.5đ)Phương trình phản ứng:C H 2= C HC=CHCHC H 2= C H2CH32C=CHH320t , xt⎯⎯⎯→(0.5đ)02t , xt⎯⎯⎯→(0.5đ)3 Câu 5: (4 điểm)1. Đặt CTPT hidrocacbon X là CxHy (x, y > 0)Ta có12x/y = 90/10⇒ x/y = 9/12⇒ CTĐN nhất của X là C9H12Với MX < 150⇒ CTPT của X là C9H12Công thức cấu tạo thu gọn có thể có của X là:(0.25đ)(0.25đ)(0.25đ)(0.25đ)CH2CH2CH3: n-proylbenzen(0.25đ): izopropylbenzen(0.25đ): 2 - etyltoluen(0.25đ): 3 - etyltoluen(0.25đ): 4 - etyltoluen(0.25đ): 1,2,3 - trimetylbenzen(0.25đ): 1,2,4 - trimetylbenzen(0.25đ)CH(CH3)2CH3C2H5CH3C2H5CH3C 2H 5CH3CH3CH3CH3CH3CH3CH3CH3CH3: 1,3,5 - trimetylbenzen4(0.25đ) 2. X tác dụng với dd KMnO4 (đặc, nóng) tạo ra 2 muối hữu cơCH2CH2CH3⇒ X là(0.5đ)CH2CH2CH33+ 10KMnO4 → 3C6H5COOK + 3CH3COOK + 10MnO2 + 4KOH +(0.5đ)+ 4H2O--- HẾT---5 SỞ GD-ĐT QUẢNG BÌNHĐỀ CHÍNH THỨCSố BD:……………..KÌ THI CHỌN HỌC SINH GIỎI LỚP 11 THPTNgày 27 – 3 – 2013Môn: HóaThời gian 180 phút (không kể thời gian giao đề)Bài 1 (2,25 điểm)1. Viết phương trình hoá học của các phản ứng xảy ra trong các thí nghiệm sau (nếu có):a) Sục khí Cl2 vào dung dịch FeSO4.b) Sục khí etilen vào dung dịch KMnO4.c) Sục khí H2S vào dung dịch nước brom.d) Sục khí O3 vào dung dịch KI.e) Sục khí SO2 vào dung dịch Fe2(SO4)3.f) Nung hỗn hợp quặng photphorit, cát và than cốc ở 1200oC trong lò điện.2. Hoàn thành phương trình hóa học của các phản ứng sau (nếu có):ota) Fe2O3 + HNO3 (đặc) →c) Na2S2O3 + H2SO4 (loãng) →CH3 COOHe) Naphtalen + Br2 →1:1b) Cl2O6 + NaOH (dư) →d) PCl3 + H2O →f) CH3-C≡CH + HBr (dư) →otg) C2H5ONa + H2O h) Etylbenzen + KMnO4 →→Bài 2 (1,75 điểm)1. Hòa tan hết 31,89 gam hỗn hợp A gồm 2 kim loại Al và Mg trong lượng dư dung dịch HNO3 loãng, thu được10,08 lít (đktc) hỗn hợp khí X (gồm NO và N2O) và dung dịch Y. Tỉ khối hơi của X so với khí hiđro là 59/3. Côcạn dung dịch Y thu được 220,11 gam muối khan. Tính phần trăm khối lượng mỗi kim loại trong hỗn hợp A.2. Trong tự nhiên Bo có 2 đồng vị: 10B và 11B. Biết thành phần % về khối lượng của đồng vị 11B trong H3BO3là 14,407%. Tính % số nguyên tử của mỗi đồng vị Bo trong tự nhiên.Bài 3 (1,5 điểm)1. Viết tất cả các đồng phân cấu tạo ứng với công thức phân tử C3H6O.2. Viết các phương trình hóa học thực hiện chuyển hóa sau (biết A, B, C, D là các sản phẩm chính):H SO ®ÆcH OH SO ®Æc, 170o CCl , H OKOH / ancol2422422C D2-brom-2-metylbutan → A → B →→ A →Bài 4 (2,0 điểm)1. Chất A có công thức phân tử là C7H8. Cho A tác dụng với AgNO3 trong dung dịch amoniac dư được chấtB kết tủa. Phân tử khối của B lớn hơn của A là 214. Viết các công thức cấu tạo có thể có của A.2. Hỗn hợp khí X gồm 2 anken kế tiếp nhau trong dãy đồng đẳng. Đốt cháy hoàn toàn 5 lít hỗn hợp X cầnvừa đủ 18 lít khí oxi (các thể tích khí đo ở cùng điều kiện nhiệt độ, áp suất).a) Xác định công thức phân tử của 2 anken.b) Hiđrat hóa hoàn toàn một thể tích X với điều kiện thích hợp thu được hỗn hợp ancol Y, trong đó tỉ lệ về khốilượng các ancol bậc một so với ancol bậc hai là 28:15. Xác định % khối lượng mỗi ancol trong hỗn hợp ancol Y.Bài 5 (2,5 điểm)(1)1. Cho phản ứng: C2H6 (k) + 3,5O2 (k) → 2CO2 (k) + 3H2O (l)Dựa vào 2 bảng số liệu sau:ChấtC2H6 (k)O2 (k)CO2 (k)H2O (l)-1084,70394- 285,8∆H (kJ.mol )sLiên kếtElk (kJ.mol-1)C-HC-CO=OC=OH-O413,82326,04493,24702,24459,80-1Nhiệt hóa hơi của nước là 44 kJ.molhãy tính hiệu ứng nhiệt của phản ứng (1) theo 2 cách.2. Haber là một trong số các nhà hoá học có đóng góp quan trọng vào phản ứng tổng hợp NH3 từ khí H2 và N2.Trong thí nghiệm 1 tại 472oC, Haber và cộng sự thu được [H2] = 0,1207M; [N2] = 0,0402M; [NH3] =0,00272M khi hệ phản ứng đạt đến cân bằng. Trong thí nghiệm 2 tại 500oC, người ta thu được hỗn hợp cânbằng có áp suất riêng phần của H2 là 0,733 atm; của N2 là 0,527 atm và của NH3 là 1,73.10-3 atm.Phản ứng thuận: 3H2(k) + N2(k)2NH3 (k) là phản ứng tỏa nhiệt hay thu nhiệt? Tại sao?3. Hãy tính pH của dung dịch A gồm KCN 0,120M; NH3 0,150M và KOH 0,005M. Cho biết pKa của HCN là9,35; của NH +4 là 9,24.--------------- Hết --------------- SỞ GD-ĐT QUẢNG BÌNHKÌ THI CHỌN HỌC SINH GIỎI LỚP 11 THPTNgày 27 - 3 – 2013Môn: HóaHƯỚNG DẪN CHẤMBài 1 (2,25 điểm)1. (1,0 điểm)a) 3Cl2 + 6FeSO4 → 2Fe2(SO4)3 + 2FeCl3b) 3C2H4 + 2KMnO4 + 4H2O → 3CH2OH-CH2OH + 2MnO2 + 2KOHc) H2S + Br2 → S↓ + 2HBrd) O3 + 2KI + H2O → O2 + I2 + 2KOHe) SO2 + Fe2(SO4)3 + 2H2O → 2FeSO4 + 2H2SO41200 Cf) Ca3(PO4)2 + 3SiO2 + 5C → 3CaSiO3 + 5CO + 2P2. (1,25 điểm)ta) Fe2O3 + 6HNO3 (đặc) → 2Fe(NO3)3 + 3H2Ob) Cl2O6 + 2NaOH NaClO→3 + NaClO4 + H2Oc) Na2S2O3 + H2SO4 (loãng) → Na2SO4 + S↓ + SO2 + H2Od) PCl3 + 3H2O → H3PO3 + 3HClBro(0,25 điểm)(0,25 điểm)(0,25 điểm)(0,25 điểm)oe)+ Br2CH3COOH(0,25 điểm)(0,25 điểm)+ HBr(0,25 điểm)f) CH3-C≡CH + 2HBr (dư) → CH3-CBr2-CH3g) C2H5ONa + H2O → C2H5OH + NaOHh)CH2CH3+ 4KMnO4to(0,25 điểm)COOK+ K2CO3 + 4MnO2 + KOH + 2H2O(0,25 điểm)Bài 2 (1,75 điểm)1. (1,25 điểm)Đặt số mol của NO và N2O lần lượt là a và b, ta có:10,08a+b== 0,45a = 0,1522,4⇔  b = 0,330a + 44b = 59 .2.0,45 = 17,73Đặt số mol của Al và Mg lần lượt là x và y, ta có: 27x + 24y = 31,89 (1)Khi cho hỗn hợp A tác dụng với dung dịch HNO3:Al → Al3+ + 3exx3xMg → Mg2+ + 2eyy2y+5N+ 3e → N+20,450,15+5N+ 4e → N+12,40,6Nếu sản phẩm khử chỉ có NO và N2O thì:mmuối = 31,89 + 62(0,45 + 2,4) = 208,59 gam < 220,11 gam: Vô lí(0,25 điểm)(0,25 điểm) ⇒ có muối NH4NO3 tạo thành trong dung dịch Y.(0,25 điểm)+5-3N + 8e → N8zzTa có: 3x +2y = 0,45 + 2,4 + 8z hay 3x + 2y - 8z = 2,85(2)Mặc khác: 213x + 148y + 80z = 220,11(3)Giải hệ (1), (2), (3) ta được: x = 0,47; y = 0,8; z = 0,02(0,25 điểm)Vậy:0, 47.27.100%%Al == 39,79%31,89%Mg = 100% - 39,79% = 60,21%.(0,25 điểm)2. (0,5 điểm)Gọi % số nguyên tử của đồng vị 11B là x ⇒ % số nguyên tử của đồng vị 10B là (1-x).Ta có: M B = 11x + 10(1-x) = x + 1011x14,407Theo bài ra ta có:(0,25 điểm)=3 + 16.3 + 10 + x100Giải phương trình trên được x = 0,81.Vậy, trong tự nhiên:%11B = 81%(0,25 điểm)%10B = 100% - 81% = 19%Bài 3 (1,5 điểm)1. (0,75 điểm)CH2=CH-CH2OHCH3-CH2-CHOOH(0,25 điểm)(0,25 điểm)CH2=CH-OCH3CH3COCH3OO(0,25 điểm)2. (0,75 điểm)Các chất: A: (CH3)2C=CH-CH3, B: (CH3)2C(OSO3H)-CH2-CH3C: (CH3)2C(OH)-CH2-CH3 và D: (CH3)2C(OH)-CHCl-CH3ancol(CH3)2C(Br)-CH2-CH3 + KOH → (CH3)2C=CH-CH3 + KBr + H2O(CH3)2C=CH-CH3 + HOSO3H (đặc) → (CH3)2C(OSO3H)-CH2-CH3(CH3)2C(OSO3H)-CH2-CH3 + H2O → (CH3)2C(OH)-CH2-CH3 + H2SO4H SO ®Æc, 170 C(CH3)2C(OH)-CH2-CH3 → (CH3)2C=CH-CH3 + H2O(CH3)2C=CH-CH3 + H2O + Cl2 → (CH3)2C(OH)-CHCl-CH3 + HClo24(1)(2)(3)(4)(5)(0,25 điểm)(0,25 điểm)(0,25 điểm)Bài 4 (2,0 điểm)1. (0,75 điểm)Hợp chất A (C7H8) tác dụng với AgNO3 trong dung dịch NH3, đó là hiđrocacbon có liên kếtba ở đầu mạch có dạng R(C≡CH)xR(C≡CH)x + xAgNO3 + xNH3 → R(C≡CAg)x + xNH4NO3R + 25xR + 132xMB – MA = (R + 132x) - (R + 25x) = 107x = 214 ⇒ x = 2Vậy A có dạng: HC≡C-C3H6-C≡CHCác công thức cấu tạo có thể có của A:CH C-CH2-CH2-CH2-CCHCHC-CH2-CH-C CHCH3(0,25 điểm)(0,25 điểm) CH3CH C-CH-CCHCH C-C-CCH2CH3CHCH3(0,25 điểm)2. (1,25 điểm)Đặt công thức chung của 2 anken là C n H 2n ( n là số cacbon trung bình của 2 anken)ot2 C n H 2n + 3n O 2 → 2n CO2 + 2n H 2 O(1)3n 18Ta có:=⇒ n = 2, 425Anken duy nhất có số nguyên tử cacbon < 2,4 là C2H4 và anken kế tiếp là C3H6.CH2 = CH2 + HOH → CH3–CH2OH(2)CH3CH = CH2 + HOH → CH3–CH(OH)–CH3(3)CH3CH = CH2 + HOH → CH3–CH2–CH2OH(4)15%i-C3H 7 OH == 34,88%28+15Gọi a, b lần lượt là số mol của C2H4 và C3H6.Ta có: 2a + 3b = 2,4(a+b) ⇒ a = 1,5bTheo các phản ứng (2), (3), (4): số mol H2O = số mol anken = 2,5bTheo định luật bảo toàn khối lượng ta có:Khối lượng hỗn hợp ancol Y = khối lượng hỗn hợp anken X + khối lượng nước= 28.1,5b + 42b + 18.2,5b = 129b gam1,5b.46%C2 H 5OH == 53,49%129b%n-C3H 7 OH = 100% - 34,88% - 53,49% = 11,63%(0,25 điểm)(0,25 điểm)(0,25 điểm)(0,25 điểm)(0,25 điểm)Bài 5 (2,5 điểm)1. (0,5 điểm)0000+ 3 ∆Hs(H– ∆Hs(C– 3,5 ∆Hs(O∆H0p− = 2 ∆Hs(CO2 ,k)2O,l)2 H 6 ,k)2 ,k)∆H0p− = 2(–394) + 3(–285,8) – (–84,7) – 3,5.0 = –1560,7 (kJ)(0,25 điểm)Mặt khác: ∆H0p− = 6EC-H + EC-C + 3,5EO=O – 4EC=O – 6 EO-H – 3 ∆H hh∆H 0p− = 6(413,82) + 326,04 + 3,5(493,24) – 4(702,24) – 6(459,8) – 3(44) = –1164,46 (kJ)(0,25 điểm)2. (1,0 điểm)Tại 472oC: K c =[NH3 ]2(0,00272)2== 0,105[H 2 ]3 .[N 2 ] (0,1207)3 .(0,0402)→ K p = K c (RT)∆n = 0,105[0,082.(472 + 273)]−2 = 2,81.10-5Tại 500oC: K p =p 2NH3p3H2 .p N2=(1,73.10-3 ) 2= 1,44.10-5 < 2,81.10-53(0,733) .(0,527)(0,25 điểm)(0,25 điểm)(0,25 điểm)Nhiệt độ tăng, K p giảm → phản ứng thuận là phản ứng tỏa nhiệt (theo nguyên lí của Lơ Satơlie).(0,25 điểm) 3. (1,0 điểm)→ HCN + OHCN- + H2O ←Kb1 = 10- 4,65→ NH +4 + OHKb2 = 10- 4,76NH3 + H2O ←→ H+ + OHH2OKW = 10-14←So sánh (1) → (3), tính pH theo ĐKP áp dụng cho (1) và (2):[OH-] = CKOH + [HCN] + [ NH +4 ]Đặt [OH-] = x → x = 5.10-3 +2-3(1)(2)(3)(0,25 điểm)K b1[CN - ]K [NH3 ]+ b2xx-→ x - 5.10 x - (Kb1[CN ] + Kb2[NH3]) = 0(0,25 điểm)Chấp nhận: [CN-] = CCN- = 0,12M ; [NH3] = C NH3 = 0,15M.→ Ta có: x2 - 5.10-3x - 5,29.10-6 = 0 → x = [OH-] = 5,9.10-3M = 10-2,23M+-11,77M(0,25 điểm)→ [H ] = 10−9,35−9,241010Kiểm tra: [CN-] = 0,12 −9,35≈ 0,12 M; [NH3] = 0,15 −9,24≈ 0,15 M−11,7710+ 1010+ 10−11,77Vậy cách giải gần đúng trên có thể chấp nhận được → pH = 11,77.(0,25 điểm)Lưu ý:- Thí sinh có thể giải nhiều cách, nếu đúng vẫn được điểm tối đa tùy theo điểm của từng câu.- Nếu thí sinh giải đúng trọn kết quả của một ý theo yêu cầu đề ra thì cho điểm trọn ý mà không cầntính điểm từng bước nhỏ, nếu từng ý giải không hoàn chỉnh, có thể cho một phần của tổng điểm tốiđa dành cho ý đó, điểm chiết phải được tổ thống nhất; Điểm toàn bài chính xác đến 0,25 điểm. SỞ GIÁO DỤC-ĐÀO TẠOHÀ TĨNHĐỀ CHÍNH THỨCKỲ THI CHỌN HỌC SINH GIỎI TỈNH CẤP THPTNĂM HỌC 2012-2013MÔN THI: HOÁ HỌC LỚP 11Thời gian làm bài: 180 phút(Đề thi có 02 trang, gồm 6 câu)Câu I:Nguyên tử của nguyên tố R ở trạng thái cơ bản có tổng số electron ở các phân lớp s là 7.a. Viết cấu hình electron nguyên tử của R ở trạng thái cơ bản, xác định tên nguyên tố R.b. Với R có phân lớp 3d đã bão hoà, hoà tan hoàn toàn m gam một oxit của R trong dung dịch H2SO4đặc, nóng, dư sinh ra 0,56 lít (điều kiện tiêu chuẩn) khí SO2 là sản phẩm khử duy nhất. Toàn bộ lượngkhí SO2 trên phản ứng vừa đủ với 2 lít dung dịch KMnO4 thu được dung dịch T (coi thể tích dungdịch không thay đổi).- Viết các phương trình hoá học, tính m và tính nồng độ mol/l của dung dịch KMnO4 đã dùng.- Tính pH của dung dịch T (bỏ qua sự thủy phân của các muối).Biết axit H2SO4 có Ka1 =+∞; Ka2 = 10-2.Câu II:1. Thêm 1ml dung dịch MgCl2 1M vào 100 ml dung dịch NH3 1M và NH4Cl 1M được 100 ml dungdịch A, hỏi có kết tủa Mg(OH)2 được tạo thành hay không?Biết: TMg(OH)2 =10-10,95 và K b(NH3 ) = 10-4,75.2. Tính pH của dung dịch thu được khi trộn lẫn các dung dịch sau:a. 10ml dung dịch CH3COOH 0,10M với 10ml dung dịch HCl có pH = 4,00b. 25ml dung dịch CH3COOH có pH = 3,00 với 15ml dung dịch KOH có pH = 11,00c. 10ml dung dịch CH3COOH có pH = 3,00 với 10ml dung dịch axit fomic (HCOOH) có pH=3,00.Biết Ka của CH3COOH và HCOOH lần lượt là 10-4,76 và 10-3,75 (Khi tính lấy tới chữ số thứ 2 sau dấuphẩy ở kết quả cuối cùng).Câu III:1. Cho 2,16 gam hỗn hợp gồm Al và Mg tan hết trong dung dịch axit HNO3 loãng, đun nóng nhẹ tạora dung dịch A và 448 ml (đo ở 354,9 K và 988 mmHg) hỗn hợp khí B gồm 2 khí không màu, khôngđổi màu trong không khí. Tỉ khối của B so với oxi bằng 0,716 lần tỉ khối của CO2 so với nitơ. Làmkhan A một cách cẩn thận thu được chất rắn D, nung D đến khối lượng không đổi thu được 3,84 gamchất rắn E. Tính khối lượng D và thành phần phần trăm khối lượng mỗi kim loại trong hỗn hợp banđầu.2. Cho 20 gam hỗn hợp A gồm FeCO3, Fe, Cu, Al phản ứng với 60 ml dung dịch NaOH 2M được2,688 lít hiđro. Thêm tiếp vào bình sau phản ứng 740 ml dung dịch HCl 1M và đun nóng đến khingừng thoát khí, được hỗn hợp khí B, lọc tách được cặn C (không chứa hợp chất của Al). Cho B hấpthụ từ từ vào dung dịch nước vôi trong dư được 10 gam kết tủa. Cho C phản ứng hết với HNO3 đặcnóng dư thu được dung dịch D và 1,12 lít một khí duy nhất. Cho D phản ứng với dung dịch NaOH dưđược kết tủa E. Nung E đến khối lượng không đổi được m gam chất rắn. Tính khối lượng mỗi chấttrong A, tính m, biết thể tích các khí đo ở điều kiện tiêu chuẩn.Câu IV:Đốt cháy hoàn toàn 0,047 mol hỗn hợp X gồm 3 hiđrocacbon mạch hở rồi cho toàn bộ sản phẩm cháyhấp thụ vào 2 lít dung dịch Ca(OH)2 0,0555M được kết tủa và dung dịch M. Lượng dung dịch Mnặng hơn dung dịch Ca(OH)2 ban đầu là 3,108 gam. Cho dung dịch Ba(OH)2 dư vào dung dịch Mthấy có kết tủa lần 2 xuất hiện. Tổng khối lượng kết tủa hai lần là 20,95 gam. Cùng lượng hỗn hợp Xtrên tác dụng vừa đủ với 1 lít dung dịch Br2 0,09M. Xác định công thức phân tử, công thức cấu tạocủa các hiđrocacbon biết có 2 chất có cùng số nguyên tử cacbon, phân tử khối các chất trong X đềubé hơn 100 và lượng hỗn hợp trên tác dụng vừa đủ với 100ml dung dịch AgNO3 0,2M trong NH3được 3,18 gam 1 kết tủa.1 Câu V:1. Hợp chất X có công thức phân tử C6H10 tác dụng với hiđro theo tỉ lệ mol 1: 1 khi có chất xúc tác.Cho X tác dụng với dung dịch KMnO4 trong H2SO4 loãng, đun nóng thu được HOOC(CH2)4COOH.a. Xác định công thức cấu tạo, gọi tên X và viết phương trình phản ứngb. Viết phương trình phản ứng oxi hoá X bằng dung dịch KMnO4 trong nước2. Đốt cháy hoàn toàn 0,02 mol hỗn hợp X gồm 3 hiđrocacbon đồng phân A, B, C. Hấp thụ toàn bộsản phẩm cháy vào 5,75 lít dung dịch Ca(OH)2 0,02M thu được kết tủa và khối lượng dung dịch tănglên 5,08 gam. Cho Ba(OH)2 dư vào dung dịch thu được, kết tủa lại tăng thêm, tổng khối lượng kết tủa2 lần là 24,305 gam.a. Xác định công thức phân tử của 3 hiđrocacbonb. Xác định công thức cấu tạo A, B, C biết:- Cả 3 chất đều không làm mất màu dung dịch brom.- Khi đun nóng với dung dịch KMnO4 loãng trong H2SO4 thì A và B đều cho cùng sản phẩm C9H6O6còn C cho sản phẩm C8H6O4.- Khi đun nóng với brom có mặt bột sắt A chỉ cho một sản phẩm monobrom. Còn chất B, C mỗi chấtcho 2 sản phẩm monobromViết phương trình hóa học của các phản ứng xảy raCâu VI:1. Khí N2O4 kém bền, bị phân ly một phần theo phương trình:N2O4 (khí)2NO2 (khí)(1)Thực nghiệm cho biết các số liệu sau khi (1) đạt tới trạng thái cân bằng ở áp suất chung 1 atm:Nhiệt độ(0oC)354572,45066,800M h (g)( M h là khối lượng mol trung bình của hỗn hợp khí ở trạng thái cân bằng)a. Tính độ phân ly α của N2O4 ở các nhiệt độ đã cho.b. Tính hằng số cân bằng Kp của (1) ở mỗi nhiệt độ trên.c. Cho biết (1) là phản ứng thu nhiệt hay tỏa nhiệt. Giải thích?(Khi tính lấy tới chữ số thứ 3 sau dấu phẩy).2. Có các phân tử XH3a. Hãy cho biết dạng hình học của các phân tử PH3 và AsH3.b. So sánh góc liên kết HXH giữa hai phân tử trên và giải thích.c. Những phân tử nào sau đây có phân tử phân cực ? Giải thích ngắn gọnBF3, NH3, SO3, PF3.Cho biết ZP = 15, ZAs = 33, ZO = 8, ZF = 9, ZB = 5, ZN = 7, ZS = 16.------------------ HẾT------------------ Thí sinh không được sử dụng tài liệu (kể cả bảng Hệ thống tuần hoàn các nguyên tố hoá học).- Cán bộ coi thi không phải giải thích gì thêm.- Họ và tên thí sinh: ..................................................................Số báo danh..............................2 HƯỚNG DẪN CHẤMCâu 0,75+1,75(1+0,75)a) Trong vỏ nguyên tử của nguyên tố R electron phân bố vào các phân lớp s theo thứ tự là: 1s2;I=> Các cấu hình electron thỏa mãn là2,5 2s2; 3s2; 4s12 2 6 2 6 11s 2s 2p 3s 3p 4s => Z = 19 R là Kali1s22s22p63s23p63d54s1 => Z = 24 R là Crom1s22s22p63s23p63d104s1 => Z = 29 R là đồngb) Vì oxit của Cu tác dụng với dung dịch axit sunfuric đặc nóng tạo ra khí SO2 do đó là đồng 0,750,5(I) oxit (Cu2O) nSO = 0,025(mol )2ot2CuSO4 + SO2 + 2H2OCu2O + 2H2SO4 →0,0250,025 (mol)=> m=144.0,025=3,6 (g)5SO2 + 2KMnO4 + 2H2O→ 2H2SO4 + K2SO4 + 2MnSO40,025 0,010,01 (mol)Nồng độ mol/l của dung dịch KMnO4 là 0,005 (M)Phương trình điện li của axit sunfuric: ([H2SO4]=0,005M)H2SO4 → H+ + HSO40,0050,0050,005(M)+HSO4H+SO42C :0,0050,0050 (M)[ ]: 0,005 - x0,005+xx (M) x = 2,81.10−3(0,005 + x).x−2= 10 => =>0,005 − x x = −0,01+=> [H ]=0,005+2,81.10-3=7,81.10-3(M) => pH= 2,107II1.0,50,751+3(1+1+1)Khi thêm 1ml dung dịch MgCl2 1M vào 100ml dung dịch đệm thìC Mg2 + ban đầu = 10-2 (M).Ta có: TMg(OH)2 = [Mg2+][OH−]2 = 10-10,95Để kết tủa Mg(OH)2 thì [Mg2+][OH−]2 ≥ 10-10,9510 −10,95 10 −10,95⇒ [OH−]2 ≥== 10-8,95. Hay [OH−] ≥ 10-4,4752+−210Mg* Dung dịch: NH4Cl 1M + NH3 1M.cân bằng chủ yếu là:NH3 + H2ONH +4 + OH−K NH3 = Kb = 10-4,75[]111-x1+xKb = (x + 1)x = 10-4,750,5x1− x2.⇒ x = 10-4,75Hay [OH−] = 10-4,75 < 10-4,475.Vậy khi thêm 1 ml dung dịch MgCl2 1M vào 100ml dung dịch NH3 1M và NH4Cl 1M thìkhông xuất hiện kết tủa Mg(OH)2.a. Dung dịch HCl có pH = 4,0 ⇒ [H+] = [HCl] = 10-4MSau khi trộn:10−4.10= 5.10−5 M200,1.10CCH3COOH == 0, 05M20C HCl =HCl → H+ + Cl5.10-5M 5.10-5M30,5 CH3COO- + H+05.10-5Mxxx5.10-5 + xCH3COOHC0,05M∆Cx[ ] 0,05-x(5.10−5)+x x0, 05 − x= 10−4,76x = 8,991.10-4M (nhận)x = -9,664.10-4M(loại)pH = -lg[H+] = -lg(5.10-5 + x) = 3,023=3,02b. Gọi CA là nồng độ M của dung dịch CH3COOHCH3 COOHCH 3 COO− + H +CCA00∆Cxxx[ ] CA – xxxVới pH = 3,0 ⇒ x = 10-3M(10 )−32C A − 10CA =1= 10−4,76−3−310−6+ 10−3 = 10−1,24+10 ≈ 0, 0585M−4,7610Dung dịch KOH có pH = 11,0 ⇒ [OH-] = [KOH] =10−14= 10−3 M10−11Sau khi trộn:0, 0585x25= 0, 03656M ≈ 3, 66.10 −2 M4010 −3 x15C KOH == 3, 75.10 −4 M40CH 3 COOH + KOH → CH 3 COOK +H2OC CH 3COOH =3,66.10-2 3,75.10-400Phản ứng-2-4-4Sau phản ứng (3,66.10 – 3,75.10 )03,75.103,75.10-4CH 3 COOHCH 3 COO − + H +C0,0362253,75.10-40∆Cxxx[ ]x0,036225– xx+3,75.10-4Nên Ka= x(x+3,75.10-4)/(0,036225-x)=10-4,76 → x = 6,211.10-4pH = 3,207=3,21c. Tương tự với câu trên:Dung dịch CH3COOH có pH = 3,0 ứng với CCH3COOH = 0, 0585MDung dịch HCOOH có pH = 3,0 ứng với nồng độ axit fomic(10 )=− pHCHCOOH2K HCOOHSau khi trộn lẫn:+ 10− pH10−6= −3,75 + 10−3 = 10−2,25 + 10−3 = 6, 62.10−3 M100, 0585.10= 0, 02925M206, 62.10−3.10== 3,31.10−3 M20CCH3COOH =CHCOOHBảo toàn điện tích : [H+]=[CH3COO-]+[HCOO-]Ta có: h= C1Ka1/(Ka1+h)+ C2Ka2/(Ka2+h)→ h3+h2(Ka1+Ka2)+h(Ka1Ka2 –C1Ka1-C2Ka2 )-( C1Ka1Ka2 +C2 Ka1Ka2)=0Ta có h= 9,997.10-4. Nên pH = 3,0041 1III1.1,5+2Theo giả thiết thì B chứa N2 và N2OnN O + nN2 = 0, 448.(988 / 760) / (0, 082.354,9) = 0, 02  nN2O = 0, 01Ta có  2→nN2O .44 + nN2 .28 = 0, 02.32.0, 716.44 / 28 nN2 = 0, 01số mol e nhận để tạo ra 2 khí này là : 0,01(10+8) = 0,18 mol (I)D có Al(NO3)3, Mg(NO3)2 có thể có NH4NO3.NH4NO3 → N2O↑ + 2H2O2 NH4NO3 → N2 ↑ + O2 ↑ + 4 H2O ↑4Al(NO3)3 → 2Al2O3 + 12 NO2 ↑ + 3O2 ↑2Mg(NO3)2 → 2MgO + 4 NO2 ↑ + O2 ↑E chỉ có Al2O3 và MgO.27 x + 24 y = 2,16x102. 2 + 40 y = 3,84+ Gọi x, y lần lượt là số mol của Al và Mg ta có hệ : 2.IVx = Al = 0,04 mol và Mg = 0,045 mol số mol e cho = 0,21 mol (II)+ Từ (I, II) suy ra phải có NH4NO3. Từ đó dễ dàng tính được kết quả sau:D gồm: Al(NO3)3 (8,52 gam) ; Mg(NO3)2 (6,66 gam) ; NH4NO3 (0,3 gam) = 15,48 gam. Hỗnhợp ban đầu có 50% lượng mỗi kim loại.+ Khi A pư với NaOH thì nNaOH = 0,12 mol;n H2 = 0,12 mol. Suy ra NaOH dưAl + NaOH + H2O → NaAlO2 + 3/2 H2.Mol: 0,08 0,080,080,12Sau pư trên thì hh có: FeCO3 + Fe + Cu + 0,04 mol NaOH dư + 0,08 mol NaAlO2.+ Khi thêm vào 0,74 mol HCl vào thì:NaOH + HCl → NaCl + H2OMol: 0,040,04NaAlO2 + 4HCl + H2O → NaCl + AlCl3 + 3H2OMol:0,080,32Số mol HCl còn lại sau 2 pư trên là 0,38 mol. B là hh khí nên B phải có CO2 + H2. C chắcchắn có Cu, có thể có FeCO3 + Fe. Mặt khác C + HNO3 → NO2 là khí duy nhất nên C khôngthể chứa FeCO3 C có Cu và có thể có Fe (FeCO3 đã bị HCl hòa tan hết).TH1: Fe dư. Gọi x là số mol FeCO3; y là số mol Fe bị hòa tan; z là số mol Fe dư, t là số molCu ta có: 116x + 56(y + z) + 64t = 20 – 0,08.27 = 17,84 (I)FeCO3 + 2HCl → FeCl2 + CO2↑ + H2OMol:x2xxxFe + 2HCl → FeCl2 + H2↑Mol: y2yyySố mol HCl = 2x + 2y = 0,38 (II)B có x mol CO2 + y mol hiđro. Dựa vào pư của B với nước vôi trong x = 0,1 mol (III)C có z mol Fe dư + t mol Cu3z + 2t = 1,12/22,4 (IV)x = 0,1 mol; y = 0,09 mol; z = 0,01 mol và t = 0,01 mol.Vậy A có: 0,1.116=11,6 gam FeCO3 + 0,1.56=5,6 gam Fe + 0,01.64=6,4 gam Cu +0,08.27=2,16gam Al+ Tính tiếp ta được giá trị của m=mCuO+mFe2O3=0,01.80+0,01.160/2 = 1,6 gam.TH2: Fe hết C chỉ có Cu số molCu = ½ NO2 = 0,025 mol.A có 0,1.1z16=11,6 gam FeCO3 + 0,025.64=1,6 gam Cu + 0,08.27=2,16gam Al+ (20-11,61,6-2,16=4,64)gam Fetính được m =mCuO =0,025.80= 2 gam.2,5CxHy + m AgNO3 + m NH3 → CxHy-mAgm + m NH4NO3 .0,02 mol0,02/m mol→ m↓ = 3,18 = (0,02/m)(12x+y+107m) → 12x+ y = 52m50,250,50,750,50,750,75 V1.Do MHDC < 100 nên m=1, x=4, y=4.Vậy 1 chất C4H4 : CH2=CH-C≡CH: 0,02 molTa có sơ đồCO2 + Ca(OH)2 (0,111mol) →CaCO3 (x)Ba(OH)2 → BaCO (0,111-x)+CaCO (0,111-x)Ca(HCO3 ) 2 (0,111-x) 33Nên 100x+(0,111-x)100+(0,111-x)197=20,95 → x= 0,061 → nCO2= 0,061+2(0,111-0,061)=0,161→ nH2O = (0,061.100+ 3,108-0,161.44)/18=0,118+ Hai HDC còn lại cháy cho: nCO2=0, 161-0,02.4=0,081; nH2O= 0,118-0,02.2=0,078Số Ctb = 0,081/0,027= 3Do trong X có 2 HDC có cùng số C nên có các TH sau+ TH1: 2 HDC còn lại có cùng 3CnBr2 = 0,09-0,02.3=0,03 > 0,027 nên có C3H4còn lại là C3H8 hoặc C3H6a + b = 0, 027  a = 0, 012- C3H8 : a ; C3H4 :b →TM2b = 0, 03b = 0, 015a + b = 0, 027  a = 0, 024- C3H6 : a ; C3H4 :b →TMa + 2b = 0, 03 b = 0, 003+ TH2: 1 HDC còn lại có cùng 4C, HDC còn lại là 1C hoặc 2C x + y = 0, 027 x = 0, 0135- C4Hc:x ; C2Hd: y→nên4 x + 2 y = 0,081  y = 0, 01350,0135c/2+0,0135d/2=0,078 →c+d=11,55 loại x + y = 0, 027 x = 0, 018- C4Hc:x ; CH4: y→nên 0,018c/2+0,009.4/2=0,0784 x + 1y = 0, 081  y = 0, 009→c=6,67 loạiKết luận : CH2=CH-C≡CH CH2=C=CH2 C3H6 hoặc C3H81,5+2,5a. C6H10 [π + v ] = 2X phản ứng với H2 theo tỉ lệ 1 : 1 nên X phải có 1 vòng 5,6 cạnh và 1 liên kết đôiKhi oxi hóa X thu được sản phẩm chứa 6 cacbon nên X có 1 vòng 6 cạnh không nhánh- Công thức cấu tạo của X là:5xclohexen+ 8KMnO4+ 12H2SO4 → 5 HOOC(CH2)4COOH +4K2SO4+8MnSO4+12H2O.0,50,50,750,750,50,5b. Phản ứng:OH2.OH + 2MnO2 + 2KOH.3+ 2KMnO4 + 4H2O → 3a. nCa(OH)2 = 0,115 molCO2 + Ca(OH)2 (0,151mol) →CaCO3 (x)Ba(OH)2 → BaCO (0,115-x)+CaCO (0,115-x)Ca(HCO3 ) 2 (0,115-x) 33Nên 100x+(0,115-x)100+(0,115-x)197=24,305 → x= 0,05 → nCO2= 0,05+2(0,115-0,05)= 0,18→ nH2O = (0,05.100+ 5,08-0,18.44)/18=0,12- Gọi công thức phân tử của A là CxHy:60,50,25 yH2O20,020,02x 0,01yTa có: 0,02x = 0,18 ⇔ x = 9 và 0,01y = 0,12 ⇔ y = 12Công thức phân tử của A, B, C là C9H12, [π + v ] = 4.0,5b. Theo giả thiết thì A, B, C phải là dẫn xuất của benzen vì chúng không làm mất màu dungdịch Br2.* A, B qua dung dịch KMnO4/H+ thu được C9H6O6 nên A, B phải có 3 nhánh CH3; C choC8H6O4 nên C có 2 nhánh trên vòng benzen (1 nhánh –CH3 và 1 nhánh –C2H5).- Khi đun nóng với Br2/Fe thì A cho 1 sản phẩm monobrom còn B, C cho 2 sản phẩmmonobrom nên công thức cấu tạo của A, B, C là:0,75CxHy + O2 → xCO2 +CH2CH3CH3CH3H3CH3CCH3CH3CH3(A)Các phản ứng xẩy ra(B)(C)COOHCH35H CCH33+ 18KMnO4 + 27H2SO4 → 5 HOOCCH3H3C+18KMnO4+27H2SO4 → 5+18KMnO4+27H2SO4 → 5CH3+ 9K2SO4+18KMnO4+42H2O.COOH+5CO2+18MnSO4 + 9K2SO4 + 42H2OCH3CH3H3C0,75COOHCH2CH35+9K2SO4+18KMnO4+42H2O.COOHCOOHHOOCCH35COOH0,25BrCH30Fe ,t+ Br2 →H3CCH3+ HBrCH3H3CCH3H3CCH3CH3H3CCH30Fe ,t+ Br2 →CH2CH3BrCH2CH3hoặcCH3Br+ HBrCH2CH3BrBrVI1.0Fe ,t+ Br2 → CH3 hoặc CH3 + HBr2(0,5+1+0,5)+1,5a) Đặt a là số mol N2O4 có ban đầu,α là độ phân li của N2O4 ở toCxét cân bằng:N2O42NO2số mol ban đầua0số mol chuyển hóaaα2aαsố mol lúc cân bằng a(1 - α)2aαTổng số mol khí tại thời điểm cân bằng là a(1 + α)Khối lượng mol trung bình của hỗn hợp khí:CH392a92=a(1 + α) 1 + α92- ở 35oC thì M h = 72,45 →= 72,45 →α = 0,2701+ αMh =70,5hay 27% - ở 45oC thì M h = 66,8α = 0,377hay 37,7%2 2aα  V 2NO = 4aαb) Ta có Kc = [ 2 ] = [ N 2O4 ] a(1 − α) (1 − α)VV2V là thể tích (lít) bình chứa khíVà PV = nS. RT → RT =PVPV=nSa(1 + α)Thay RT, Kc vào biểu thức KP = Kc. (RT)∆n ở đây∆n = 1 → KP =4aα2PVP.4.α 2.=(1 − α)V a(1 + α) 1 − α 2ở 35oC thì α = 0,27 → KP = 0,315,ở 45oC thì α = 0,377 → K p = 0,6632.c) Vì khi tăng nhiệt độ từ 35oC → 45oC thì độ điện li α của N2O4 tăng (hay KP tăng) → Chứngtỏ khi nhiệt độ tăng thì cân bằng chuyển sang chiều thuận (phản ứng tạo NO2) do đó theonguyên lí cân bằng Lơ Satơliê (Le Chatelier) thì phản ứng thuận thu nhiệt.a. P : 1s22s22p63s23p3 ; As : 1s22s22p63s23p63d104s24p3P và As đều có 5 electron hóa trị và đã có 3 electron độc thân trong XH3XX ôû traïng thaù i lai hoùa sp3.10,50,5H H HXH3 hình tháp tam giác,b. góc HPH > góc AsH, vì độ âm điện của nguyên tử trung tâm P lớn hơn so với As nên các0,5cặp e liên kết P-H gần nhau hơn so với As-H lực đẩy mạnh hơn.c. không phân cựcFOBSFFOO0,5Phân cựcNPHHHFFF2 chất đầu sau có cấu tạo bất đối xứng nên phân cực8 SỞ GD & ĐT VĨNH PHÚCĐỀ CHÍNH THỨCKỲ THI CHỌN HỌC SINH GIỎI LỚP 11 NĂM HỌC 2011-2012ĐỀ THI MÔN: HOÁ HỌC(Dành cho học sinh THPT)(Thời gian làm bài: 180 phút, không kể thời gian giao đề)Bài 1 (1,5 điểm ).Thổi 672 ml (đktc) hỗn hợp khí A gồm một ankan, một anken và một ankin (đều có số nguyên tử cacbontrong phân tử bằng nhau) qua lượng dư dung dịch AgNO3/NH3, thì thấy có 3,4 gam AgNO3 đã tham giaphản ứng. Cũng lượng hỗn hợp khí A như trên làm mất màu vừa hết 200 ml dung dịch Br2 0,15 M.1) Xác định công thức cấu tạo và tính khối lượng mỗi chất trong A.2) Đề nghị phương pháp tách riêng từng chất ra khỏi hỗn hợp A.Bài 2. (1,5 điểm).Hòa tan hoàn toàn 26,4 gam hỗn hợp A gồm Fe và Cu trong dung dịch HNO3, thu được 7,84 lít NO (đktc)và 800 ml dung dịch X. Cho từ từ dung dịch HCl vào X đến khi không còn khí thoát ra, thì thu được thêm1,12 lít NO (đktc).1) Xác định % khối lượng của mỗi kim loại trong A.2) Tính số mol HNO3 đã tham gia phản ứng.3) Tính CM của các chất trong X.Bài 3 (1,5 điểm).Thủy phân hoàn toàn 2,475 gam halogenua của photpho người ta thu được hỗn hợp 2 axit (axit củaphotpho với số oxi hóa tương ứng và axit không chứa oxi của halogen). Để trung hòa hoàn toàn hỗn hợpnày cần dùng 45 ml dung dịch NaOH 2M. Xác định công thức của halogenua đó.Bài 4 (2,0 điểm).1.Chỉ dùng chất chỉ thị phenolphtalein, hãy phân biệt các dung dịch riêng biệt NaHSO4, Na2CO3, AlCl3,Fe(NO3)3, NaCl, Ca(NO3)2. Viết các phản ứng minh họa dưới dạng ion thu gọn.2. Cho các sơ đồ phản ứng sau:→ … + H2Oa) X + O2b) X + CuO → N2 + … + …c) X + H2S → …d) X + CO2 → … + H2Oe) X + H2O + CO2 → …Tìm công thức của khí X và hoàn thành các phương trình hoá học trên.Bài 5 (1,5 điểm).Hòa tan 4,8 gam kim loại M hoặc hòa tan 2,4 gam muối sunfua của kim loại này, bằng dung dịch HNO3đặc nóng dư, thì đều thu được lượng khí NO2 (sản phẩm khử duy nhất) như nhau.1) Viết các phương trình phản ứng xẩy ra.2) Xác định kim loại M, công thức phân tử muối sunfua.3) Hấp thụ khí sinh ra ở cả hai phản ứng trên vào 300 ml dung dịch NaOH 1M, rồi thêm vào đó một ítphenolphtalein. Hỏi dung dịch thu được có màu gì? Tại sao?Bài 6. (1,0 điểm).Hỗn hợp A gồm 2 ankan là đồng đẳng kế tiếp và 1 anken, trong đó có 2 chất có cùng số nguyên tử cacbon.Đốt cháy một lượng A thu được 6,72 lít CO2 (đktc) và 8,1 gam H2O. Xác định công thức phân tử của 3hiđrocacbon trong A.Bài 7 (1,0 điểm). Tìm các chất thích hợp ứng với các ký hiệu A1, A2, A3, A4, A5 trong sơ đồ sau và hoànthành các phương trình phản ứng dưới dạng công thức cấu tạo?+Benzen/H+CrackinhCnH2n+2A1(khí)(1)A2A3(3)(2)(4)+H2O/H++O2,xtA4A5 (C3H6O)(5) +O2/xt-------Hết-----Họ và tên thí sinh .............................................................................Số báo danh ..........................................(Giám thị coi thi không giải thích gì thêm) SỞ GD & ĐT VĨNH PHÚCBài 1 (1)1,5 đKỲ THI CHỌN HỌC SINH GIỎI LỚP 11 NĂM HỌC 2011-2012HƯỚNG DẪN CHẤM MÔN: HOÁ HỌC(Dành cho học sinh THPT )Nếu ankin có dạng RC≡CH :RC≡CH + AgNO3 + NH3 → RC≡CAg + NH4NO3⇒ n (ankin ) =3,4gam= 0,02mol và n Br2 ≥ 2 × n (ankin ) = 0,04mol170gam / molĐiều này trái giả thiết, vì số mol Br2 chỉ bằng 0,2L × 0,15mol / L = 0,03molVậy ankin phải là C2H2 và như vậy ankan là C2H6, anken là C2H4.Từ phản ứng :C2H2 + 2AgNO3 + 2NH3 → C2Ag2 + 2NH4NO3⇒ n(C2H2) = 1/2n(AgNO3) = 0,01 molTừ các phản ứng :C2H2 + 2Br2 → C2H2Br4C2H4 + Br2 → C2H4Br2⇒ n(C2H4) = 0,01 mol⇒ n(C2H6) =Bài 2.1,5đ0,672L− 0,01mol − 0,01mol = 0,01 mol.22,4L / mol⇒ Khối lượng của: C2H2: 0,26gam; C2H4: 0,28 gam; C2H6: 0,3 gam.(2)Thổi hỗn hợp qua binh chứa dung dịch AgNO3/NH3 dư. Lọc tách kết tủa, hòa tan kết tủatrong dung dịch HCl dư thu được khí C2H2.C2H2 + 2AgNO3 + 2NH3 → C2Ag2 ↓ + 2NH4NO3C2Ag2 + 2HCl → C2H2 ↑ + 2AgCl ↓Khí ra khỏi bình chứa dung dịch AgNO3/NH3, thổi tiếp qua dung dịch nước brom dư.Chiết lấy sản phẩm và đun nóng với bột Zn (trong CH3COOH) thu được C2H4 :C2H4 + Br2 → C2H4Br2C2H4Br2 + Zn → C2H4 ↑ + ZnBr2Khí ra khỏi bình chứa dung dịch brom là khí C2H61)X + HCl → NO=> trong X còn muối Fe(NO3)27,841,12nNO (1) == 0,35(mol ) ;nNO (2) == 0, 05(mol )22, 422, 4Sau khi cho HCl vào X thì thu được dung dịch trong đó chứa: Cu2+ và Fe3+Gọi x, y lần lượt là số mol của Fe và CuTa có:56x+64y=26,4 x = 0,3=> 3x+2y= 3(0,35+0,05) y = 0,150,3.56=> % Fe=.100% = 63, 64% ; %Cu = 100% - %Fe = 36,36%26,42) Số mol HNO3 than gia phản ứng = 4nNO(1) = 0,35.4 = 1,4(mol)3) Gọi a , b lần lượt là số mol Fe(NO3)2 và Fe(NO3)3 trong X=> a + b = 0,32a + 3b + 2. 0,15 = 3.0,35=> a = 0,15 (mol); b = 0,15 (mol)=> trong X có : 0,15 mol Fe(NO3)2; 0,15 (mol) Fe(NO3)3 và 0,15 mol Cu(NO3)20,15=> CM các chất đều bằng nhau và bằng:= 0,1875M0,80,50,50,250,250,250,50,250,5 Bài 3 Halogenua của photpho có thể có công thức PX3 hoặc PX5.*Xét trường hợp PX3:1,5đPTHH PX3 + 3H2O → H3PO3 + 3HXH3PO3 + 2NaOH → Na2HPO3 + 2H2O ( axit H3PO3 là axit hai lần axit)HX + NaOH → NaX + H2Osố mol NaOH = 2. 0,045 = 0,09 molĐể trung hòa hoàn toàn sản phẩm thủy phân 1 mol PX3 cần 5 mol NaOH;số mol PX3 = 1/5 số mol NaOH = 0,09/5 = 0,018 molKhối lượng mol phân tử PX3 = 2,475/0,018 = 137,5Khối lượng mol cuả X = (137,5 – 31): 3 = 35,5 ⇒ X là Cl . Công thức PCl3*Xét trường hợp PX5:PX5 + 4H2O → H3PO4 + 5HXH3PO4 + 3NaOH → Na3PO4 + 3H2OHX + NaOH → NaX + H2Osố mol NaOH = 2. 0,045 = 0,09 molĐể trung hòa hoàn toàn sản phẩm thủy phân 1 mol PX5 cần 8 mol NaOH;số mol PX5 = 1/8 số mol NaOH = 0,09/8 = 0,01125 molKhối lượng mol phân tử PX5 = 2,475/0,01125 = 220Khối lượng mol cuả X = (220 – 31): 5 = 37,8 ⇒ không ứng với halogen nào.Bài 4 1. Trích mẫu thử cho mỗi lần thí nghiệm:Cho phenolphtalein vào mỗi mẫu thử. Mẫu thử có màu hồng là dung dịch Na2CO3,2,0đcác mẫu thử còn lại không màu.→ HCO3- + OHCO32- + H2O ←Dùng Na2CO3 làm thuốc thử để cho vào các mẫu thử còn lại.Mẫu thử có sủi bọt khí không màu là NaHSO4CO32- + 2H+ → H2O + CO2↑Mẫu thử tạo kết tủa trắng keo và sủi bọt khí không màu là AlCl32Al3+ + 3CO32- + 3H2O → 2Al(OH)3↓+ 3CO2↑Mẫu thử tạo kết tủa đỏ nâu và sủi bọt khí không màu là Fe(NO3)32Fe3+ + 3CO32- + 3H2O → 2Fe(OH)3↓+ 3CO2↑Mẫu thử tạo kết tủa trắng là Ca(NO3)2Ca2+ + CO32- → CaCO3↓Mẫu thử không tạo hiện tượng là NaCl.Bài 51,5đ2. Qua sơ đồ a), b) X có chứa N và H, có thể có O. Vì X là chất khí nên chỉ có thể là NH3.a) 4NH3 + 3O2 → 2N2 + 6H2Ohoặc 4NH3 + 5O2 → 4NO + 6H2O ( có xúc tác Pt)b) 2NH3 + 3CuO → N2 + 3Cu + 3H2Oc) 2NH3 + H2S → (NH4)2Shoặc NH3 + H2S → NH4HSd) 2NH3 + CO2 → (NH2)2CO + H2Oe) NH3 + H2O + CO2 → NH4HCO3(1) Phương trình phản ứng:M + 2mH+ + mNO3- → Mm+ + mNO2 + mH2O(1)M2Sn + 4(m+n)H+ + (2m+6n)NO3- → 2Mm+ + nSO42- + (2m+6n)NO2 + 2(m+n)H2O (2)(2) Vì số mol NO2 ở hai trường hợp là bằng nhau nên ta có:4,82,4m=(2m + 6n )M2M + 32n64mnM =⇒ 6n − 2m , nghiệm thích hợp là n = 1, m = 2 và M = 64. n , m = 1,2,3Vậy M là Cu và công thức muối là Cu2S.4,8(3)n Cu == 0,075mol640,50,50,250,250,250,250,250,250,250,250,250,250,50,5 Cu + 4HNO3 → Cu(NO3)2 + 2NO2 + 2H2O⇒ n NO2 = 2 × 2 × 0,075 = 0,3mol = n NaOH⇒ đã xảy ra vừa đủ phản ứng:2NO2 + 2NaOH → NaNO3 + NaNO2 + H2ODung dịch thu được có màu hồng do NO2- tạo môi trường bazơ:NO2- + H2O HNO2 + OHBài 6. Gọi công thức của ankan là CnH2n+2 x (mol) và anken CmH2m y (mol)1,0 đ Ta có :Số mol CO2 = 0,3 (mol)Số mol H2O = 0,45 (mol)số mol ankan = 0,45 – 0,3 = 0,15 (mol)0,15.n + ym = 0,3n anken C2H4Bài 7 * Các chất cần tìm:A1: CH3-CH2-CH2-CH31,0đA2: CH3- CH=CH2A3: C6H5-CH(CH3)2 (Cumen)A4: CH3-CH(OH)-CH3A5: CH3-CO-CH3* Các phản ứng:CrackinhCH3-CH=CH2 + CH41. CH3-CH2-CH2-CH3(A2) CH(CH3)2(A1)H2SO42. CH3-CH=CH2 +CH(CH3)23.(A3)0,250,250,50,250,250,25OH1.O22.H2SO4(l)4. CH3-CH=CH2 + H2O5.0,25+ CH3-CO-CH3(A5)0,25H+CH3-CH(OH)-CH3 + 1/2O2CH3-CH(OH)-CH3 (A4)Cu,t0CH3-CO-CH3(A5)+ H2OGhi chú:Khi chấm nếu học sinh giải theo các phương pháp khác, nếu đúng vẫn cho đủ số điểm.Trong một bài thí sinh làm đúng đến phần nào thì tính điểm đến phần đó theo thang điểm.0,25 TRƯỜNG THPT THUẬN THÀNH SỐ INgày 14/3/2013( Đề thi gồm có 01 trang)ĐỀ THI HSG CẤP TRƯỜNG NĂM HỌC 2012-2013MÔN HÓA HỌC LỚP 11Thời gian :120 phút(Không kể thời gian giao đề)Câu 1 (2 điểm)1. Dẫn hỗn hợp khí C gồm N 2 , O2 , NO2 vào dung dịch NaOH dư tạo dung dịch D và hỗn hợp khí khôngbị hấp thụ. Cho D vào dung dịch KMnO4 trong H 2 SO4 thì mầu tím bị mất, thu được dung dịch G.Cho vụn Cu, thêm H 2 SO4 vào dung dịch G rồi đun nóng được dung dịch X khí Y (Y hóa nâu trong khôngkhí). Viết các phương trình phản ứng, xác định vai trò của mỗi chất trong mỗi phản ứng?2. Cho sơ đồ pư sau:ooCl2 ,asdd NaOH , tH 2 SO4 , tC4 H10  A1 A2  A3  A4 (A3 khí, A4 lỏng, H 2 SO4 đặc nóng)A1 là hỗn hợp của 1-clobutan, 2-clobuatan. A2, A3, A4 đều là hỗn hợp của các sản phẩm hữu cơ.a. Viết CTCT của C4H10 và các chất có trong A2, A3, A4?b. So sánh nhiệt độ sôi, độ tan trong nước của các chất trong A2 với các chất trong A1. Giải thích?Câu 2. (2,5 điểm): Hỗn hợp khí A gồm H 2 và một olefin ở 81,9 o C , 1atm với tỷ lệ mol là 1:1. Đun nónghỗn hợp A với bột Ni (xt) được hỗn hợp khí B có tỉ khối so với H 2 bằng 23,2, hiêu suất phản ứng là h%.a. Lập biểu thức tính h theo a?b. Tìm công thức phân tử của olefin và tính h?c. Đốt cháy hoàn toàn V lít hỗn hợp B ở 81,9 o C , 1atm cho tất cả các sản phẩm cháy qua bình đựng 128gam dung dịch H 2 SO4 98%. Sau phản ứng nồng độ axit là 0,6267M. Tính V?Câu 3. (2 điểm) Khi hòa tan cùng một lượng kim loại M vào dung dịch HNO3 đặc nóng và dung dịchH 2 SO4 loãng thì thể tích khí NO2 thu được gấp 3 lần thể tích khí H 2 ở cùng điều kiện nhiệt độ và áp suất.Khối lượng muối sunfat thu được bằng 62,81% khối lượng muối nitrat tạo thành.1. Xác định kim loại M?22. Nếu nung nóng cùng một lượng kim loại M như trên cần thể tích oxi bằngthể tích NO2 nói trên9(cùng điều kiện) và thu được chất rắn X là một oxit của M. Hòa tan 10,44 gam X vào dung dịchHNO3 6,72 % thu được 0,336 lít (đktc) khí N x Oy . Tính khối lượng dung dịch HNO3 đã dùng?Câu 4 (2 điểm)1. pH của một dung dịch bazơ yếu B bằng 11,5. Hãy xác định công thức của bazơ, nếu thành phần khốilượng của nó trong dung dịch này bằng 0,17%, còn hằng số của bazơ K b  104 . Tỉ khối của dungdịch là 1g / cm3 .2. Dung dịch CH 3COOH 0,1M có pH = 2,88. Cần pha loãng dung dịch này bao nhiêu lần để cho độđiện li  tăng 5 lần ?Câu 5 (1,5 điểm) Một dung dịch chứa bốn ion của hai muối vô cơ; trong đó có ion SO42  , khi tác dụng vừađủ với dung dịch Ba (OH )2 , đun nóng cho một khí, một kết tủa X và một dung dịch Y. Dung dịch Y sau khiaxit hóa bằng dung dịch HNO3 , tạo với AgNO3 kết tủa trắng hóa đen ngoài ánh sáng.Kết tủa X đem nung nóng đến khối lượng không đổi được a gam chất rắn Z. Giá trị của a thay đổi tùytheo lượng Ba (OH ) 2 dùng. Nếu vừa đủ a đạt giá trị cực đại, còn lấy dư a giảm dần đến giá trị cực tiểu. Khilấy chất rắn Z với giá trị cực đại a = 8,51 gam, thấy Z chỉ phản ứng hết với 50 ml dung dịch HCl 1,2 M, cònlại bã rắn nặng 6,99 gam. Hãy biện luận xác định 2 muối trong dung dịch đầu?-------------------Hết------------------Họ tên thí sinh………………………………………….SBD……… SỞ GD & ĐT KON TUMTRƯỜNG THPT CHUYÊNNGUYỄN TẤT THÀNHĐỀ CHÍNH THỨC(Đề thi có 02 trang)KỲ THI CHỌN HỌC SINH GIỎI CẤP TRƯỜNGNĂM HỌC 2012-2013Khóa ngày: 24/02/2013Môn thi: HÓA HỌC – Lớp 11Thời gian làm bài: 180 phút(Không kể thời gian phát đề)----------------------------------------ĐỀCâu 1: (2,0 điểm)A, B là hai nguyên tố thuộc cùng nhóm A và thuộc hai chu kỳ kế tiếp nhau trong bảngtuần hoàn. B, D là hai nguyên tố kế cận nhau trong cùng một chu kỳ.a) A có 6 electron ở lớp ngoài cùng. Hợp chất X của A với hiđro trong đó % H =11,1% (về khối lượng). Hãy xác định tên của A và B ?b) Hợp chất Y có công thức AD2 trong đó lớp electron ngoài cùng có cấu hình bền nhưkhí hiếm. Cho biết tên nguyên tố D và viết công thức electron và công thức cấu tạo của Y.c) Hợp chất Z gồm 3 nguyên tố: A, B, D có tỷ lệ khối lượng: mB : mA : mD = 1:1:2,22.Phân tử khối của Z bằng 135u.- Tìm công thức phân tử của Z.- Cho biết cấu tạo hình học của Z và trạng thái lai hóa của nguyên tử trung tâm.- Giải thích sự hình thành liên kết trong phân tử Z. Biết Z tác dụng với nước cho sản phẩmtrong đó có H2SO4.Câu 2: (2,0 điểm)Niken(II) oxít có cấu trúc mạng tinh thể giống mạng tinh thể NaCl. Các ion O2- tạo thànhmạng lập phương tâm mặt, các hốc bát diện có các ion Ni2+. Khối lượng riêng của niken(II) oxitlà 6,67g/cm3. Nếu cho NiO tác dụng với liti oxít và oxi thì thu được các tinh thể trắng có thànhphần LixNi1-xO.2x Li2O + 4(1-x)NiO + xO24LixNi1-xOCấu trúc mạng tinh thể của LixNi1-xO giống cấu trúc mạng tinh thể của NiO, nhưng mộtsố ion được thay thế bằng các ion Li+ và một số ion Ni2+ bị oxi hóa để đảm bảo tính trunghòa điện của phân tử. Khối lượng riêng của LixNi1-xO là 6,21 g/cm3.a) Vẽ một ô mạng cơ sở của niken(II) oxit.b) Tính x (chấp nhận thể tích của ô mạng cơ sở không thay đổi khi chuyển từ NiOthành LixNi1-xO.Câu 3: (2,0 điểm)Sử dụng thuyết liên kết hóa trị (VB) và thuyết trường tinh thể (CF) để giải thích dạnghình học, từ tính của phức chất [Fe(CN)6]4-, Fe(CO)5 . Cho Fe(Z=26), C(Z=6), N(Z=7). O(Z=8 ).Câu 4: (2,0 điểm)HCrO4:3- 2+v = k [HCrO4 ] [ HSO3 ] [H ]: [HCrO4-] = 10-4 mol/l;[HSO3-] = 0,1 mol/l;nồng độ ion H+ cố định và bằng 10-5 mol/l. Nồng độ HCrO4- giảm xuống còn 5.10-5 mol/lsau 15 giây.-5a)4 sẽ bằng 1,25.10 mol/l.b)3HCrO4- 5.10-5 mol/lCâu 5: (2,0 điểm) Hỗn hợp A gồm silic (IV) oxit và magie được đun đến nhiệt độ cao. Phản ứng xảy rahoàn toàn thu được hỗn hợp X gồm 3 chất. Xử lý chất rắn X thu được cần dùng 365 gamHCl 20%. Kết quả:- Thu được một khí Y bốc cháy trong oxi và 401,4 gam dung dịch muối có nồng độ23,67%.- Chất rắn Z còn lại không tan trong axit, nhưng tan dễ dàng trong dung dịch kiềm tạora một khí cháy được.a) Tính phần trăm khối lượng mỗi chất trong hỗn hợp A.b) Tính thể tích khí Y (đktc) và khối lượng Z.Câu 6: (2,0 điểm)Khí A là hợp chất rất độc. Trong nước, A là một axit rất yếu, yếu hơn axit cacbonic. Khiđược đốt cháy trong không khí, A cháy cho ngọn lửa màu tím.Trong phòng thí nghiệm, A có thể được điều chế bằng cách nhỏ từ từ dung dịch muốicủa nó vào dung dịch H2SO4 đun nóng. Trong tổng hợp hữu cơ, điều chế A bằng cách đunnóng ở 500oC hỗn hợp CO và NH3 với chất xúc tác là ThO2.Muối của A để ngoài không khí có mùi khó chịu vì chúng bị phân hủy chậm bởi CO 2luôn có mặt trong không khí. Khi có mặt của oxi, muối của A có thể tác dụng với vàng nênnó được dùng để tách vàng ra khỏi tạp chất.a) Xác định công thức và gọi tên A.b) Viết các phương trình hóa học để minh họa các tính chất trên.Câu 7: (2,0 điểm)Hợp chất X có tên gọi (S)-3-Brombut-1-en.a)Viết công thức cấu tạo và công thức Fisơ của X.b) Cho Br2 (dung dịch), HBr lần lượt tác dụng với X. Viết công thức Fisơ và gọi têncác sản phẩm có hai nguyên tử cacbon bất đối.c) Những sản phẩm nào có tính quang hoạt?Câu 8: (2,0 điểm)Hiđrocacbon A chứa 85,7% khối lượng cacbon. Phản ứng của A với ozon và xử lý tiếptheo với bột Zn trong axit tạo sản phẩm hữu cơ duy nhất C. Oxi hóa C cho sản phẩm duynhất là axit cacboxylic D. Số liệu phổ cho thấy tất cả các nguyên tử hiđro (trong gốchiđrocacbon) trong D đều thuộc nhóm metyl. Khối lượng riêng của hơi D quy về đktc là 9,1gam/lít.a) Viết công thức cấu tạo của D trong dung dịch nước và ở pha hơi.b) Xác định công thức cấu tạo của A.c) A tác dụng với dung dịch KMnO4 tạo thành 1 sản phẩm F duy nhất. Viết công thứclập thể của A và F.Câu 9: (2,0 điểm)ooCho sơ đồ: C6H5CH(CH3 )2 (A) Br2 , Fe/tB Br2 , as C NaOH loãng, tDBiết: Các chất phản ứng theo tỉ lệ mol 1:1, các chất ghi trên sơ đồ là sản phẩm chính.a) Viết các phương trình hóa học theo sơ đồ trên, cho biết tên cơ chế các phản ứng.b) Gọi tên A, B, C, D theo danh pháp IUPAC.c) Khi cho A tác dụng dung dịch KMnO4 trong môi trường H2SO4 thu được axitbenzoic. Viết phương trình hóa học của phản ứng dưới dạng phân tử và dạng ion thu gọn.Câu 10: (2,0 điểm)Từ các hợp chất chứa tối đa 4 cacbon, phenyl bromua và các tác nhân vô cơ cần thiết hãylập sơ đồ tổng hợp các hợp chất sau đây (có sử dụng ít nhất một lần hợp chất cơ magie):a) C6H5CHO.b) C6H5CH2CHO.c) (CH3)2CHCOC6H5.d) 3-Phenyl-3-brompentan.(Cho nguyên tử khối: H=1; N=14; O=16; Mg=24; Si=28; Cl=35,5)------- HẾT ------- ĐỀ THAM KHẢO :Câu I (5 điểm):1. Dung dịch X chứa HCl 4M và HNO3 aM. Cho từ từ Mg vào 100 ml dung dịch X cho tới khi khí ngừngthoát ra thấy tốn hết b gam Mg, thu được dung dịch B chỉ chứa các muối của Mg và thoát ra 17,92 lít hỗn hợpkhí Y gồm 3 khí. Cho Y qua dung dịch NaOH dư thấy còn lại 5,6 lít hỗn hợp khí Z thoát ra có d Z / H =3,8. Cácphản ứng xảy ra hoàn toàn. Thể tích các khí đều đo ở đktc. Tính a, b?2. Cho 5,8 gam FeCO3 tác dụng với dung dịch HNO3 vừa đủ thu được dung dịch X và hỗn hợp Ygồm CO2, NO. Cho dung dịch HCl dư vào dung dịch X được dung dịch Y. Dung dịch Y hoà tan tối đa mgam Cu tạo ra sản phẩm khử NO duy nhất. Tính m?Câu II : ( 4 điểm )Độ tan của H2S trong dung dịch HClO4 0,003M là 0,1 mol / lit . Nếu thêm vào dung dịch này các ionMn2+ và Cu2+ sao cho nồng độ của chúng bằng 2.10-4 M thì ion nào sẽ kết tủa dưới dạng sunfat ?Biết TMnS = 3.10-14, TCuS = 8.10-37; K H 2 S = 1,3.10−212Câu III : ( 2 điểm ) ( LỚP 11)Cho dung dịch CH3COOH 0,1M. Biết K CH 3COOH =1, 75.10−5 .a/ Tính nồng độ của các ion trong dung dịch và tính pH.b/ Tính độ điện li α của axit trên.Câu IV : (4 điểm )Cho các đơn chất A, B, C . Thực hiện phản ứng :A + BXX + H2OB + CY + NaOHNaOH + BYZ + H2O1:1→Cho 2,688 lit khí X ( đkc ) qua dung dịch NaOH thì khối lượng chất tan bằng 2,22 gam .Lập luận xác định A, B, C và hoàn thành phản ứng .Câu V (5 điểm):1. Cho 5,15 gam hỗn hợp A gồm Zn và Cu vào 140 ml dung dịch AgNO3 1M. Sau khi phản ứng xong thuđược 15,76 gam hỗn hợp kim loại và dung dịch B. Chia B thành hai phần bằng nhau, thêm KOH dư vào phần1, thu được kết tủa. Lọc kết tủa, đem nung đến khối lượng không đổi, được m gam chất rắn.a. Tính m?b. Cho bột Zn tới dư vào phần 2, thu được dung dịch D. Cho từ từ V lít dung dịch NaOH 2M vào dung dịchD thu được 2,97 gam kết tủa. Tính V, các phản ứng xảy ra hoàn toàn.2. Cho các nhóm phân tử và ion sau:+. NO2; NO2+; NO2-.+. NH3; NF3.Hãy cho biết dạng hình học của phân tử và ion đã cho, đồng thời sắp xếp chúng theo chiều góc liênkết chiều giảm dần. Giải thích. ĐÁP ÁN ĐỀ THICâu I : (5 điểm)1. nY = 0,8 mol; nZ = 0,25 mol → n NO = 0, 55mol(0,5 đ)2Vì khi qua dung dịch NaOH chỉ có khí NO2 hấp thụ nên Z phải chứa khí H2 và khí A (M Z = 7, 6) .120, 2.2 + 0, 05.M AMZ == 7, 6 → MA = 30 → A là NO.0, 25Ta có n H = n HCl = 0, 2 mol → nA = 0,05 mol.2(0,5 đ)Gọi nMg phản ứng là x mol.Quá trình oxi hóa:Mg → Mg+2 + 2ex2xQuá trình khử:2H+ +2e→0,4 mol→N+5+1e0,55 molN+5+3e→0,15 molÁp dụng bảo toàn electron ta có: 2x = 0,4 + 0,55 + 0,15 → x = 0,55 mol.→ b = 0,55.24 = 13,2 gam.n HNO ( pu ) = n NO ( pu) + n NO (muoi) = 0,55 + 0,05 + 2 (0,55 – 0,2) = 1,3 mol.−33H20,2 molN+40,55 molN+20,05 mol−31, 3= 13M → a = 13M.0,12. (2 điểm): n Fe3+ = n FeCO3 = 0, 05mol; n NO− = 3n Fe3+ = 0,15mol→ [ HNO3 ] =8H++0,15.3mol2(0,5đ)3Cu2+ + 2NO + 4H2O2Fe3+ →0,05 mol+Cu2++2Fe2+(0,5đ)0,15.3+0,025) = 16 gam.2Câu II : ( 4 điểm )Trong dung dịch HClO4 0,003 MH2S(0,5đ)[H+]=0,003 M2H+ + S2-0,5 điểm0,5 điểm2K H2S H +   S 2− 1,3.10− 21 .0,1=     →  S 2−  == 1, 4.10−172[ H2S ]( 0, 003)1 điểm Mn 2+   S 2−  = 2.10−4.1, 4.10−17 = 2,8.10−21 < TMnS=> MnS không kết tủa.Cu   S  = 2.10 .1, 4.102+2−−4−17= 2,8.10−21> TCuS=> CuS kết tủa.0,5 điểm0,5 điểm0,5 điểm0,5 điểmCâu III : ( 2 điểm )CH 3COOHCH 3COO − + H + H +  = CH 3COO −  = K A . C = 1, 75.10−5.0,1 = 0, 0013pH = − lg  H +  = − lg13.10−4α=(0,5đ)0,15 molCu0,025 molVậy m = 64 (2NO3- →+(0,5đ)(0,5)(0,5đ)33Cu(0,5đ)K1, 75.10−5== 0, 0132C0,10,5 điểm1 điểm0,5 điểm Câu IV : ( 4 điểm )A : Na ; B : H2 ; X : NaHB + CY ⇒ C là phi kim, Y là axít1:1Y + NaOH → Z + H 2O1mol Y phản ứng0,5 điểm0,5 điểm0,5 điểmkhối lượng chất tan tăng ( Y - 18 )g2, 688= 0,12mol22, 41Y − 18=⇒ Y = 36,52, 22 0,122, 22 g0,5 điểm1 điểm⇒ ( C ) : CloViết phương trình phản ứng1 điểmCâu V (5 điểm):1. (3 điểm)a. Vì sau phản ứng thu được hỗn hợp kim loại nên có thể gồm 2 trường hợp sau:+ Trường hợp 1: AgNO3 hết, Zn còn dư, Cu chưa phản ứng ( hỗn hợp KL gồm: Zn dư, Cu, Ag ).Gọi nZn, n Cu (hhA) là x và y, nZn phản ứng là a ( mol ).Zn + 2AgNO3 → Zn(NO3)2 + 2Ag(1)a2aa2amA = 65x + 64y = 5,15 (I); mKL = 65(x-a) + 64y + 108. 2a = 15,76 (II)nAgNO3 = 2a = 0,14 (III). Hệ phương trình I, II, III vô nghiệm (loại).+ Trường hợp 2: Zn hết, Cu phản ứng một phần, AgNO3 hết. gọi n Cu phản ứng là b (mol).Zn + 2AgNO3 → Zn(NO3)2 + 2Ag(1)x2xx2xCu + 2AgNO3 → Cu(NO3)2 + 2Ag(2)b2bb2bmA = 65x + 64y = 5,15 (I); mKL = 64(y-b) + 108( 2x + 2b ) = 15,76 (II)nAgNO3 = ( 2x + 2b ) = 0,14 (III). Giải hệ phương trình I, II, III ta được: x = 0,03, y = 0,05, b = 0,04.+ Trong mỗi phần có: 0,015 mol Zn(NO3)2 và 0,02 mol Cu(NO3)2 .Zn(NO3)2 → Zn(OH)2 → K2ZnO2.Cu(NO3)2 → Cu(OH)2 → CuO.0,020,02→ m = 0,02.80 = 1,6 gam.b.Zn + Cu(NO3)2 → Zn(NO3)2 + Cu(1)0,020,02+ nZn(NO3)2 (dd D) = 0,015 + 0,02 = 0,035. Có thể gồm 2 trường hợp sau:+ Trường hợp 1: Zn(NO3)2 dư.Zn(NO3)2 + 2NaOH → Zn(OH)2 + 2Na(NO3)(2)0,060,03V = 0,06/2 = 0,03 lít.+ Trường hợp 2: Zn(NO3)2 hết.Zn(NO3)2 + 2NaOH → Zn(OH)2 + 2Na(NO3)(2)0,0350,070,035Zn(OH)2 + 2NaOH → Na2ZnO2 + 2H2O(3)0,0050,01+ nNaOH = 0,07 + 0,01 = 0,08 V = 0,08/2 = 0,04 lít.2. (2 điểm):Để giải thích câu này ta có thể dùng thuyết VSEPR hoặc thuyết lai hóa (hoặc kết hợp cả hai).a. NO2NOONOO2Ospspsp(1)và (3): hình gấp khúc.(2): thẳngGóc liên kết giảm theo thứ tự sau: (2) – (1) – (3) do ở (2) không có lực đẩy electron hóa trị của N không thamgia liên kết, ở (1) có một electron hóa trị của N không liên kết dẩy làm góc ONO hẹp lại đôi chút. Ở (3) gócliên kết giảm nhiều hơn do có 2 electron không liên kết của N đẩy.NNHH3HFF3FspGóc liên kết giảm theo chiều HNH - FNF vì độ âm điện của F lớn hơn của H là điện tích lệch về phíaF nhiều hơn ⇒ lực đẩy kém hơn.sp Së GD-§T Hµ NéiTr−êng THPT øng Hßa A§Ò thi chän häc sinh giái líp 11 n¨m 2010M«n: Hãa häc(Thêi gian lµm bµi: 120 phót)C©u 1: (5 ®iÓm).1. Cho c¸c dung dÞch sau cã cïng nång ®é mol/lit: NH4Cl, CH3COONH4, H2SO4, CH3COONa, HCl.a Em h y viÕt c¸c qu¸ tr×nh ®iÖn li khi hßa tan c¸c chÊt trªn vµo n−íc.b. S¾p xÕp gi¸ trÞ pH cña c¸c dung dÞch trªn theo thø tù t¨ng dÇn. Gi¶i thÝch ng¾n gän.c. Dïng quú tÝm vµ mét hãa chÊt kh¸c, em h y ph©n biÖt n¨m dung dÞch trªn.2. Axit A lµ mét chÊt r¾n mÇu tr¾ng, nãng ch¶y ë 42,5oC, dÔ tan trong n−íc. Hßa tan A vµo n−íc thu®−îc dung dÞch A. Cho A t¸c dông víi chÊt B thu ®−îc kÕt tña D. Nung D víi c¸t tr¾ng, than ënhiÖt ®é cao thu ®−îc phot pho tr¾ng. Hái A, B, D lµ nh÷ng chÊt g×? ViÕt ph−¬ng tr×nh ph¶n øng.C©u 2: (5 ®iÓm).1. Tõ Metan vµ c¸c hãa chÊt v« c¬ cÇn thiÕt kh¸c. Em h y viÕt c¸c ph¶n øng ®Ó ®iÒu chÕ cao su Buna,polipropilen, polistiren. Ghi râ ®iÒu kiÖn ph¶n øng (nÕu cã).2. Crackinh hoµn toµn 1 ankan X m¹ch th¼ng thu ®−îc hçn hîp khÝ Y cã tû khèi h¬i so víi kh«ng khÝ®óng b»ng 1. T×m c«ng thøc cÊu t¹o, gäi tªn X.C©u 3: (5 ®iÓm). Cho m1 (g) hçn hîp Al vµ Mg vµo m2 (g) dung dÞch HNO3 24%. Ph¶n øng xong thu®−îc dung dÞch A (chØ chøa muèi nitrat cña c¸c kim lo¹i) vµ tho¸t ra 8,96 lÝt hçn hîp khÝ X gåmNO, N2O, N2. Thªm 1 l−îng O2 võa ®ñ vµo X, sau ph¶n øng thu ®−îc hçn hîp khÝ Y. DÉn Y tõ tõqua dung dÞch NaOH 2M d− thÊy cã 4,48 lÝt hçn hîp khÝ Z tho¸t ra. Tû khèi cña Z so víi H2 lµ 20.NÕu cho NaOH 2M vµo A th× kÕt tña lín nhÊt thu ®−îc lµ 62,2g. Cho c¸c thÓ tÝch khÝ ®o ë ®ktc.1. T×m m1, m2.2. T×m nång ®é phÇn tr¨m c¸c chÊt trong dung dÞch A.3. T×m thÓ tÝch dung dÞch NaOH ® thªm vµo A ®Ó ®−îc kÕt tña lµ lín nhÊt.C©u 4: (5 ®iÓm). Cho hçn hîp khÝ X gåm ba hidrocacbon A, B, C (víi B, C lµ 2 chÊt kÕ tiÕp nhau trongcïng 1 d y ®ång ®¼ng). §èt ch¸y hoµn toµn 672ml X råi dÉn s¶n phÈm ch¸y lÇn l−ît qua b×nh 1chøa dung dÞch H2SO4 98%. KhÝ tho¸t ra tiÕp tôc dÉn vµo b×nh 2 chøa 437,5ml dung dÞch Ba(OH)20,08M. KÕt thóc thÝ nghiÖm, khèi l−îng b×nh 1 t¨ng 0,99g vµ b×nh 2 xuÊt hiÖn m gam kÕt tña.MÆt kh¸c nÕu dÉn 1209,6ml X (víi thµnh phÇn c¸c chÊt nh− trªn) qua b×nh dung dÞch chøan−íc Brom d−. Sau ph¶n øng, thÊy khèi l−îng b×nh Brom t¨ng 0,468g vµ cã 806,4ml hçn hîp khÝtho¸t ra. BiÕt c¸c thÓ tÝch khÝ ®o ë ®iÒu kiÖn tiªu chuÈn, c¸c ph¶n øng x¶y ra hoµn toµn.1. T×m c«ng thøc ph©n tö cña A, B, C. BiÕt chóng thuéc trong c¸c d y ®ång ®¼ng ankan, anken, ankin.2. T×m phÇn tr¨m thÓ tÝch c¸c chÊt khÝ trong X.3. T×m m.(Häc sinh ®−îc phÐp sö dông b¶ng tuÇn hoµn c¸c nguyªn tè hãa häc.)-----HÕt----- §¸p ¸n – thang ®iÓmNéi dungC©u 1: (5 ®iÓm)1a. C¸c qu¸ tr×nh ®iÖn ly (1 ®iÓm)+) NH4Cl → NH4+ + Cl-NH4+ + H2O§iÓmNH3 + H3O+0,2 ®+) CH3COONH4 → CH3COO- + NH4+CH3COO- + H2OCH3COOH + OH- (1)NH4+ + H2ONH3 + H3O+(2)0,2 ®+) CH3COONa → CH3COO- + Na+CH3COO- + H2O0,2 ®CH3COOH + OH-+) H2SO4 → H+ + HSO4HSO4- + H2OSO42- + H3O++) HCl → H+ + Cl1b. S¾p xÕp c¸c gi¸ trÞ pH theo thø tù t¨ng dÇn (1 ®iÓm)+) H2SO4 < HCl < NH4Cl < CH3COONH4 < CH3COONa+) Gi¶i thÝch: víi cïng nång ®é th× [H+] cña H2SO4 > cña HCl v× H2SO4 ph©n ly theo 2 nÊc cßnHCl chØ ph©n ly theo 1 nÊc.[H+] cña HCl > trong NH4Cl v× HCl ph©n ly hoµn toµn, cßn NH4+ ph©n ly kh«ng hoµn toµnQu¸ tr×nh ë (1) vµ (2) lµ t−¬ng ®−¬ng nhau nªn m«i tr−êng CH3COONH4 lµ trung tÝnh, pH≈7CH3COONa cã CH3COO- thñy ph©n cho OH- nªn [H+] cña dung dÞch lµ nhá nhÊtMµ [H+] cµng nhá th× pH cµng cao ⇒ thø tù ®óng H2SO4 < HCl < NH4Cl < CH3COONH4 0)→ sè mol CO2: y; sè mol NO2: 9x + y46(9 x + y ) + 44 y→ M A = 45,818 =→x=y4x + 2 yDo ®ã: %FeS = 43,14%; %FeCO3 = 56,86%2. Sè mol cña mçi chÊt trong A lµ: nCO 2 = x; nNO 2 = 10 xGäi a lµ sè mol NO2 chuyÓn ho¸ thµnh N2O4 : 2 NO2N2O444 x + 46(10 x − a) + 92.(a / 2)→ MB == 31,5.2 = 63 → a = 0,6xa11x −2→ %NO2 chuyÓn ho¸: 60%3. Khi thªm khÝ CO2 vµo kh«ng x¶y ra ph¶n øng víi N2O4 hay NO2 nh−ng lµm cho ¸p suÊtcña b×nh t¨ng → c©n b»ng cña ph¶n øng chuyÓn dÞch theo chiÒu lµm gi¶m sè ph©n tö khÝ→ c©n b»ng chuyÓn dÞch theo chiÒu thuËn → mµu cña B nh¹t dÇna) Phân tử nitơ có liên kết 3 bền nên ở nhiệt độ thường nitơ tương đối trơ về năth hóa học.Ở nhiệt độ cao phân tử nitơ bị phân tích thành hai nguyên tử nên trở nên hoạt động hóahọc hơnb)1. Ban đầu có kết tủa xanh, sau đó kết tua tan dần trong dung dịch NH3 dư tạo thành dungdịch màu xanh thẫm:Cu2+ + 2OH- Cu(OH)2Cu(OH)2 + 4NH3 [Cu(NH3)4](OH)2Phức màu xanh thẫm2.- Na2CO3 và FeCl3Xuất hiện kết tủa đỏ nâu, sủi bọt khí không màu:2Fe3+ + 3CO 32− + 3H2O 2Fe(OH)3 + 3CO2- Na2CO3 và BaCl2Xuất hiện kết tủa màu trắngBaCO3Ba2+ + CO 32−- Na2CO3 và ZnSO4Không có hiện tượng gì xảy ra3. Cho từ từ dung dịch NaOH vào dung dịch AlCl3 đến dư thấy xuất hiện kết tủa trắngkeo, sau đó kết tủa tan dần:Al3+ + 3OH- Al(OH)3Al(OH)3 + OH- [Al(OH)4]a)ot1. 2 KNO3 + S + 3C → K2S + N2 + 3CO22. CH3-CH=CH2 + dung dịch KMnO4b)1. Các phân tử này đều cặp electron tự do, tương tác đẩy giữa electron tự do với electronliên kết làm góc liên kết trong phân tử này đều nhỏ hơn so với góc lai hóa. Do trong phântử H2S và H2O còn hai cặp electron tự do nên góc liên kết nhỏ hơn góc liên kết của phân§iÓm0,250,750,250,50,750,50,50,50,50,50,50,51,01,00,5 Câu3Câu4tử NH3 (chỉ có một cặp electron tự do). Góc liên kết trong phân tử H2O lại lớn hơn trongphân tử H2S do liên kết O-H phân cực (về phía nguyên tử oxi) mạnh hơn S-H, khoảngcách giữa các electron liên kết gần hơn, tương tác đẩy mạnh hơn.2. Khác với phân tử OF2 electron phân cực về phía flo, trong phân tử Cl2O electron phâncực về phía nguyên tử oxi trung tâm nên khoảng cách giữa các electron. Tương tác đẩygiữa các electron liên kết làm góc liên kết lớn hơn. Ở phân tử SCl2 và OF2 đều có sự phâncực về phía xa so với nguyên tử trung tâm. Tuy nhiên do các nguyên tử chu kì 2 (O và F)có bán kinh nguyên tử nhỏ hơn các nguyên tử ở chu kì 3 (S và Cl), nên ở phân tử OF2khoảng cách giữa các electron liên kết nhỏ hơn, tương tác đẩy giữa các electron này mạnhhơn làm góc liên kết lớn hơn.1. Oxi hóa A tạo sản phẩm là CO2 và H2O nên A chứa C, H và có thể có O. Mg(ClO4)2hấp thụ H2OmH2O = 0,9 gam nH2O = 0,05 mol; nH = 0,1 molDung dịch Ca(OH)2 hấp thụ CO2(1)CO2 + Ca(OH)2 CaCO3 + H2OCO2 + Ca(OH)2 Ca(HCO3)2(2)nCa(OH)2 = 0,15x0,2 = 0,03 molnCaCO3 = 0,02 molTrường hợp 1: Nếu chỉ xảy ra (1) và Ca(OH)2 dưnCO2 = nCaCO3 = 0,02 molTrường hợp 2: nếu xảy ra cả (1) và (2)(1) và (2) nCO2 = 0,04 molĐộ giảm khổi lượng CuO bằng khối lượng của O trong CuO đã phản ứngnO/CuO = 0,12molVậy trong A có:nH = 0,1 mol; nC = 0,02 hay 0,04 molnO = 0,04 + 0,05 – 0,12 = - 0,03 mol (loại)nO = 0,08 + 0,05 – 0,12 = 0,01 molnC : nH : nO = 0,04 : 0,1 : 0,04 = 4:10:1Công thức nguyên (C4H10O)nTheo giả thuyết: M = 74n < MC6H6 = 78 n=1Vậy công thức phân tử là: C6H10O2.1. Phản ứng và cơ chế phản ứng:(a) Phản ứng :0,50,50,50,50,50,5CH 3 CH CH 3 (s¶n phÈm chÝnh)ClCH 3 CH 2 CH 2 ClCH 3 CH CH 2 + HClCơ chế (cộng AE) :CH 3δ−CH CH 2H+CH 3 CH CH 3CH 3 CH 2(X)CH 2 (Y)Cl -CH 3 CH CH 3Cl0,5Sản phẩm chính hình thành theo hướng tạo cacbocation trung gian bền vững hơn.Dễ thấy rằng cacbocation (X) bền hơn (Y) (do điện tích được giải tỏa nhiều hơn,với 6Hα), nên sản phẩm chính là isopropyl clorua.(b) Phản ứng :CH 3 CH 2 CH CH 3OHH 2SO 4CH 3 CH CH CH 3 + H 2O (s¶n phÈm chÝnh)CH 2 CH CH 2 CH 3 + H 2OCơ chế (tách E1) :0,5 CH 3 CH 2 CH CH 3OHH+CH 3 CH CH CH 3 (X)CH 3 CH 2 CH CH 3-H 2O+OH 2CH 2 CH CH 2 CH 3 (Y)Sản phẩm chính được hình thành theo hướng tạo sản phẩm bền hơn. Ở đây, (X)bền hơn (Y) do có số nguyên tử Hα tham gia liên hợp, làm bền hóa liên kết π nhiềuhơn.(c) Phản ứng :CH3NO2+ H2OCH3+ HONO2H2SO4CH3+ H2ONO2Cơ chế (thế SE2Ar) : HONO2 + H2SO4 → HSO4- + H2O + +NO2CH3CH3CH3HNO2CH30,5NO2+-H+NO2+NO2-H+HCâu5CH3CH3NO2NO2Phản ứng dịnh hướng thế vào vị trí meta-, do mật độ electron ở vị trí này trong phân tửtoluen giàu hơn các vị trí ortho-, para-. Đồng thời phản ứng thế vào vị trí này tạo sự giảitỏa điện tích tốt nhất ở phức π.1. a)(1) CCl2=CH-CH3(2) CHCl=CCl-CH3(3) CHCl=CH-CH2Cl(4) CH2=CCl-CH2Cl(5) CH2=CH-CHCl2(6) Cl- ∆ -Cl(7) ∆ -Cl2b)Các cấu tạo (2), (3) và (6) có đồng phân hình học2. (a) Nếu ankin có dạng RC≡CH :RC≡CH + AgNO3 + NH3 → RC≡CAg + NH4NO3⇒ n (ankin ) =3,4gam= 0,02mol và n Br2 ≥ 2 × n (ankin ) = 0,04mol170gam / mol1,01,01,0Điều này trái giả thiết, vì số mol Br2 chỉ bằng 0,2L × 0,15mol / L = 0,03molVậy ankin phải là C2H2 và như vậy ankan là C2H6, anken là C2H4.Từ phản ứng :C2H2 + 2AgNO3 + 2NH3 → C2Ag2 + 2NH4NO3⇒ n(C2H2) = 1/2n(AgNO3) = 0,01 molTừ các phản ứng :C2H2 + 2Br2 → C2H2Br4C2H4 + Br2 → C2H4Br2⇒ n(C2H4) = 0,01 mol⇒n(C2H6) =0,672L− 0,01mol − 0,01mol = 0,01 mol22,4L / mol(b) Thổi hỗn hợp qua binh chứa dung dịch AgNO3/NH3 dư. Lọc tách kết tủa, hòa tan1,0 kết tủa trong dung dịch HCl dư thu được khí C2H2.C2H2 + 2AgNO3 + 2NH3 → C2Ag2 + 2NH4NO3C2Ag2 + 2HCl → C2H2 + 2AgClKhí ra khỏi bình chứa dung dịch AgNO3/NH3, thổi tiếp qua dung dịch nước brom dư.Chiết lấy sản phẩm và đun nóng với bột Zn (trong CH3COOH) thu được C2H4 :C2H4 + Br2 → C2H4Br2C2H4Br2 + Zn → C2H4 + ZnBr2Khí ra khỏi bình chứa dung dịch brom là khí C2H6Câu6:1. C oNH 4Cl =0,050L × 0,200mol.L−10,075L × 0,100mol.L−1= 0,08M ; C oNaOH == 0,06M0,125L0,125LNH4Cl + NaOH → NaCl + NH3 + H2O0,080,060,060,060,060,0200,06Xét cân bằng :0,50NH3 + H2O NH4+ + OH0,060,02xxx0,06–x0,02+xxKb =[ NH +4 ][OH − ] (0,02 + x ) x0,06= 5,4.10 −5 M== 1,8.10 −5 , gần đúng x = 1,8.10 −5 ×0,02[ NH 3 ]0,06 − x⇒ pH = 14 − [− lg(5,4.10 −5 )] = 9,732. Gi¶i:CaF2Ca2+ + 2F2+Ca kh«ng tham gia ph¶n øng phô, nªn nÕu gäi ®é tan cña CaF2 trong HCl lµ 10-2M lµ S th× :[Ca2+] = SCßn F- tham gia ph¶n øng phô:H+ + FHF ; KHF = [H+].[F-]/[HF]Do ®ã : [F'] = [F ] + [HF] = [F-]. ( 1 + [H+]/KHF)T' = 4S3 = [Ca2+]. [F-]2. ( 1 + [H+]/KHF)2 = T. ( 1 + [H+]/KHF)2S = 5,5.10-3 ( mol/l)1,002,0 UBND TỈNH QUẢNG TRỊKỲ THI CHỌN HỌC SINH GIỎI VĂN HÓA LỚP 11 THPTSỞ GIÁO DỤC VÀ ĐÀO TẠONăm học: 2013 - 2014Khóa thi ngày: 19/3/2014Môn thi: HÓA HỌCĐỀ CHÍNH THỨCThời gian làm bài: 180 phút (không kể thời gian giao đề)(Đề thi gồm 2 trang)Câu 1. (4,0 điểm)1. Chỉ dùng một dung dịch làm thuốc thử, hãy lập sơ đồ để nhận biết 4 dung dịch riêng biệtchứa các chất sau: K3PO4, KCl, KNO3, K2S (không cần ghi phản ứng).2. Có các dung dịch cùng nồng độ chứa các chất sau: Al2(SO4)3, HNO3, KNO3, Na2CO3.Hãy cho biết dung dịch có pH nhỏ nhất và giải thích?3.a) Viết các phương trình phản ứng điều chế trực tiếp các chất: N2, HNO3, H3PO4 trongphòng thí nghiệm và phân ure trong công nghiệp.b) Hoàn thành các phương trình phản ứng sau:K2SO3 + KMnO4 + KHSO4 →KMnO4 + FeCl2 + H2SO4 → Dung dịch chỉ chứa muối sunfat4. Cho 2 muối Ag2SO4 và SrSO4 vào nước cất và khuấy đều cho đến khi đạt được dungdịch bão hòa ở nhiệt độ phòng. Xác định nồng độ ion Ag+ và Sr2+. Biết rằng ở nhiệt độ nghiên cứuTAg SO = 1,5.10−5 , TSrSO = 2,8.10−7 .244Câu 2. (4,0 điểm)1. Từ quặng photphorit, có thể điều chế được axit photphoric theo sơ đồ sau:Quặng photphorit → P → P2O5 → H3PO4.Viết các phương trình phản ứng xảy ra và tính khối lượng quặng photphorit chứa 73% Ca3(PO4)2cần để điều chế 1 tấn dung dịch H3PO4 50%. Giả sử hiệu suất của mỗi giai đoạn đều đạt 90%.2. Cho hỗn hợp A gồm FeS và FeCO3 tác dụng với dung dịch HNO3 đặc nóng dư, phảnứng hoàn toàn, thu được dung dịch A1 chỉ chứa Fe(NO3)3, H2SO4 và HNO3 dư; hỗn hợp B gồm 2khí là X và Y có tỉ khối so với H2 bằng 22,8.Viết các phương trình phản ứng và tính phần trăm theo khối lượng mỗi muối trong A.3. Khi cho cùng một lượng kim loại M vào dung dịch HNO3 đặc nóng dư và dung dịchH2SO4 loãng dư, phản ứng hoàn toàn thì thể tích khí NO2 (sản phẩm khử duy nhất) thu được gấp 3lần thể tích khí H2 ở cùng điều kiện nhiệt độ và áp suất. Khối lượng muối sunfat thu được bằng62,81% khối lượng muối nitrat tạo thành. Xác định kim loại M.4. Photgen là một chất khí độc được điều chế theo phản ứng: CO(k) + Cl2(k) → COCl2(k)Số liệu thực nghiệm tại 20oC về động học phản ứng này như sau:Thí nghiệm [CO]ban đầu (mol/lít) [Cl2]ban đầu(mol/lít) Tốc độ ban đầu(mol/lít.s)11,000,101,29.10-2920,100,101,33.10-3030,101,001,30.10-2940,100,011,32.10-31a) Hãy viết biểu thức tốc độ phản ứng.b) Nếu [CO] ban đầu là 1,00 mol/lít và [Cl2] ban đầu 0,10 mol/lít, thì sau thời gian bao lâu[Cl2] còn lại 0,08 mol/lít.Câu 3. (4,0 điểm)1. Cho hỗn hợp gồm CaCO3, Fe3O4 và Al chia làm 2 phần. Phần 1 tác dụng với dung dịchHNO3 loãng dư, tạo sản phẩm khử là NO duy nhất. Phần 2 tác dụng dung dịch NaOH dư thu đượcchất rắn. Chia đôi chất rắn, rồi cho tác dụng lần lượt với dung dịch H2SO4 loãng dư và CO dư,nung nóng. Viết các phương trình phản ứng xảy ra, biết các phản ứng xảy ra hoàn toàn.2. Nêu hiện tượng và viết phương trình phản ứng xảy ra trong các trường hợp sau:a) Cho đồng kim loại vào dung dịch hỗn hợp NH4NO3 và H2SO4 loãng.b) Sục khí NH3 từ từ đến dư vào dung dịch ZnCl2.c) Cho dung dịch KHSO4 đến dư vào dung dịch Ba(HCO3)2.1 3. Hỗn hợp gồm 1,92 gam Mg và 4,48 gam Fe phản ứng vừa hết với hỗn hợp khí X gồm clovà oxi thu được hỗn hợp Y chỉ gồm các oxit và muối clorua. Hòa tan Y cần dùng một lượng vừa đủlà 120 ml dung dịch HCl 2M, thu được dung dịch Z. Cho AgNO3 dư vào dung dịch Z, phản ứnghoàn toàn, thu được 56,69 gam kết tủa. Tính phần trăm theo thể tích của khí clo trong hỗn hợp X.Câu 4. (4,0 điểm)1. Đốt cháy hoàn toàn hiđrocacbon R, thu được tỉ lệ số mol H2O và CO2 tương ứng bằng 1,125.a) Xác định công thức phân tử của R.b) R1 là đồng phân của R, khi tác dụng với Cl2, điều kiện thích hợp, tỉ lệ mol 1:1 thì thu đượcmột dẫn xuất mono clo duy nhất (R2). Gọi tên R1, R2 và viết phương trình phản ứng xảy ra.2. Trình bày phương pháp hóa học đơn giản nhất để phân biệt mỗi cặp chất dưới đây chứatrong các bình riêng biệt mất nhãn và viết các phương trình phản ứng xảy ra:a) m-bromtoluen và benzyl bromua.b) phenylaxetilen và stiren.c) axetilen và propin.d) CH2=C(CH3)–COOH và axit fomic.3. Từ anđehit no đơn chức, mạch hở A có thể chuyển trực tiếp thành ancol B và axit Dtương ứng, từ B và D điều chế este E.a) Viết các phương trình phản ứng và tính tỉ số khối lượng mol phân tử của E và A.b) Nếu đun nóng m gam E với lượng dư dung dịch KOH thì thu được m1 gam muối kali,còn với lượng dư dung dịch Ca(OH)2 sẽ cho m2 gam muối canxi. Biết m2 [Ag+] = 0,031 (M)0,031222+[SO4 ] = 0,0155 (M) ⇒ [Sr ] == 1,8.10-5 (M)53,5714T22,8.10 −7Hoặc có thể tính: [Sr ] === 1,8.10-5 (M)2−0,0155SO42+[]31,0 CâuCâu 2Ý1Nội dungĐiểm01200 CCa 3 (PO 4 ) 2 + 5C + 3SiO 2 → 3CaSiO3 + 2P + 5CO4P + 5O 2 → 2P2O5P2O5 + 3H 2O → 2H3PO 4Sơ đồ:Ca 3 (PO 4 ) 2 → 2H3PO 42, 55kmol ←5,1kmolVậy: khối lượng quặng là: 2, 55.310.24100 100 100 100...= 1485 kg90 90 90. 73Hỗn hợp 2 khí này là NO2 và CO2FeS + 12HNO3 → Fe(NO3)3 + H2SO4 + 9NO2 + 5H2Oa (mol )→9aFeCO3 + 4HNO3 → Fe(NO3)3 + NO2 + CO2 + 2 H2Ob (mol )→bbTa có : (46·9a + 44·b + 46·b):(9a+b+b)=45,6 ⇒ 3a=bVậy: %(m)FeS=31,01,01.88.100%=20,18% và %(m)FeCO3=79,82%88 + 3.116Gọi n, m là hóa trị của R khi tác dụng HNO3 và H2SO4 loãng ( 1≤ m≤ n≤ 3)Chọn nR= 1 mol2R + mH2SO4 →R2(SO4)m + mH2↑1→ 0,5 0,5mR + 2nHNO3 →R(NO3)n + nNO2 + nH2O11nTa có: n=3.0,5m ⇒ n=1,5m ⇒ m=2, n=3 là phù hợp.Ta có: (R + 96)=(R + 186). 0,6281 ⇒ R=56 ⇒ R là Fe.a) Biểu thức tốc độ phản ứng v=k[CO]x[Cl2]yv1/v2 = (1x. 0,1y):(0,1x. 0,1y)=10 ⇒ x=1v3/v4 = (0,1x. 1y):(0,1x. 0,01y)=100 ⇒ y=1Vậy biểu thức tốc độ phản ứng v=k[CO][Cl2]1b( a − x)lnt (a − b) a (b − x)xyxTừ: v=k[CO] [Cl2] ⇒ k=v:([CO] [Cl2]y)k1=1,29.10-29: (1x0,1) =1,29.10-28 k2=1,33.10-30: (0,1x0,1) =1,33.10-28k3=1,30.10-29: (1x0,1) =1,30.10-28 k4=1,32.10-31: (0,1x0,01) =1,32.10-28Suy ra: k=1,31.10-28 l.mol-s0,1(1 − 0,02)11,31.10-28 t =ln⇒ t=0,172.1028 s0,9 1(0,1 − 0,02)b) Do phản ứng bậc 2 nên ta có: k=1,01,0Câu 31Các phương trình phản ứng:CaCO3 + 2HNO3 → Ca(NO3)2 + CO2 + H2O3Fe3O4 + 28HNO3 → 9Fe(NO3)3 + NO + 14H2OAl + 4HNO3 → Al(NO3)3 + NO + 2H2OAl + HOH + NaOH → NaAlO2 + 3/2H2CaCO3 + H2SO4 → CaSO4 + CO2 + H2OFe3O4 + 4H2SO4 → FeSO4 + Fe2(SO4)3 + 4H2Oo21,0ottCaCO3 → CaO + CO2Fe3O4 + 4CO → 3Fe + 4CO2a) Cu tan, dd xuất hiện màu xanh và khí không màu hóa nâu trong không khí3Cu 2+ + 8H + + 2NO3− → 3Cu + 2NO ↑ +4H 2O42NO + O 2 → 2NO 21,0 CâuÝNội dungĐiểmb) Có kết tủa trắng rồi kết tủa tan2NH 3 + 2H 2 O + ZnCl2 → Zn(OH)2 ↓ +2NH 4 ClZn(OH)2 + 4NH3 → [Zn(NH3)4](OH)2c) Có kết tủa trắng và có khí không màu thoát ra2KHSO4 + Ba(HCO3 )2 → BaSO4 ↓ +2CO 2 ↑ + K 2SO 4 + 2H 2O3Quá trình cho nhận e:⇒ 2a + 4b + x = 0,4 (1)2,0Câu 412a) Do nH2O: nCO2 > 1 ⇒ R là CnH2n+2 (n ≥ 1)Phản ứng: CnH2n+2 +(3n+1)/2O2 → nCO2 + (n+1) H2O (1)Từ (n+1): n =1,125 ⇒ n=8 ⇒ R: C8H18b) Do R1 tác dụng với Cl2 tạo 1 dẫn xuất monoclo duy nhất R2⇒ R1: (CH3)3C – C(CH3)3 : 2,2,3,3-tetrametylbutanR2: ClCH2(CH3)2C – C(CH3)3 : 1-clo-2,2,3,3-tetrametylbutan(CH3)3C – C(CH3)3 + Cl2 as→ ClCH2(CH3)2C – C(CH3)3 + HCla) Dùng AgNO3, đun nóng, benzyl bromua cho kết tủa vàng:C6H5CH2Br + AgNO3 + H2O → C6H5CH2OH + AgBr + HNO3b) Dùng dung dịch AgNO3/NH3, phenylaxetilen cho kết tủa vàng xám:C6H5C≡CH + AgNO3 + NH3 → C6H5C≡CAg + NH4NO3c) Cho tác dụng với H2O, xt. Lấy sản phẩm thực hiện phản ứng tráng gươngTạo kết tủa Ag là anđehit, không phản ứng là xeton ⇒ CH≡CH và CH3 - C≡CHHgSO 4 ,t oHgSO 4 ,t oH2O + C2H2 →CH3CHO CH3 - C≡CH H2O →CH3COCH31,01,0o3tCH3CHO + 2[Ag(NH3)2]OH → CH3COONH4 + 2Ag↓+ 3NH3 + H2Od) Cho tác dụng với Br2/CCl4Mất màu là CH2=C(CH3)COOH, không phản ứng là HCOOHCH2=C(CH3)COOH + Br2 → CH2Br – CBr(CH3) - COOHGọi công thức của A là RCHO (R = CnH2n+1)2+ oMn ,tRCHO + ½ O2 → RCOOH51,0 CâuÝNội dungNi,toĐiểmRCHO + H2 → RCH2OHH SO ñaëc,t 02 4→ RCOOCH2R + H2ORCOOH + RCH2OH ←ME:MA=(2R + 58):(R + 29)=2otRCOOCH2R + KOH → RCOOK + RCH2OHTa có: m6 ⇒ R là CH3 –Vậy : A là CH3CHO, B là C2H5OH, D là CH3COOH, E là CH3COOC2H5Do oxi hóa C được SP tráng gương, tách nước tạo olefin ⇒ C là ancol no, đơn chức mạchhở, bậc một. Vậy C: RCH2OH (R: CnH2n+1 – , n ≥ 1).oxt,t2 RCH2OH + O2 → 2RCHO + 2 H2O (1)oxt,t→ RCOOH + H2O (2)RCH2OH + O2 Hỗn hợp X gồm RCHO, RCOOH, H2O và RCH2OH dư.ot* Phần 1: RCHO + 2[Ag(NH3)2]OH → RCOONH4 + 2Ag↓+ 3NH3 + H2O(2)* Phần 2: RCOOH + NaHCO3 → RCOONa + H2O + CO2 ↑ (4)* Phần 2: 2 RCOOH + 2 Na → 2 RCOONa + H2 ↑ (5)2 RCH2OH + 2 Na → 2 RCH2ONa + H2 ↑ (6)2 H2O + 2 Na → 2 NaOH + H2↑ (7)Gọi số mol RCH2OH, RCHO, RCOOH trong 1/3 hỗn hợp X lần lượt là x, y, z mol.Theo (1 → 7) và bài ra ta có hệ:2y = 0, 2 x = 0,1⇒  y = 0,1z = 0,10,5z + 0,5x + 0,5(y + z)z = 0, 2 z = 0,1Chất rắn khan thu được sau phản ứng ở phần III gồm :0,1 (mol) RCOONa ; 0,1 (mol) RCH2ONa và 0,2 (mol) NaOH.Số gam chất rắn khan : (R+ 67). 0,1 + (R + 53). 0,1 + 40. 0,2 = 25,8 (gam)⇒ MR = 29 ⇒ R là C2H5 – Vậy ancol C: CH3– CH2 – CH2 - OH.1,0Câu 512A: CH3COCH3B: (CH3)2C(OH) – CNC : (CH3)2C(OH) – COOHD: CH2=C(CH3)–COOHa)A1: CH3-CH2-CH2-CH3A2: CH3- CH=CH2A3: C6H5-CH(CH3)2 (Cumen)A4: CH3-CH(OH)-CH3CH2 CH CH3+ 8 KMnO43to1,03 C6H5COOK + 3 CH3COCH3 + 5KOH + 8 MnO2 + 2 H2OCH3b) 2C3H5(OH)3 +Cu(OH)2 → [C3H5(OH)2O]2Cu + 2H2Oc)CO+ 9/2O2OV2O5, 350−450o C→+ 2CO2 + 2H2O1,0COd)NO 2NO2+ Cl2Fe, to , 1:1+ HCl→Cl3Vì 1 mol Y tác dụng được với NaHCO3 → 2 mol CO2 ⇒ Y là một axit 2 nấc ⇒ CTPT61,0 CâuÝNội dungĐiểmcủa Y phải là C4H4O4 hay C2H2(COOH)2. Ứng với mạch không phân nhánh có 2 đồngphân cis-trans là:HOOCHCHCHHCCOOHHOOCCCOOHaxit trans-butenđioicaxit cis-butenđioic(axit fumaric)(axit maleic) (Y)Chỉ có đồng phân cis mới có khả năng tách nước tạo anhiđrit (Z):OCOOHHCP2O5CO+H2 OCCHCHCOOHCHOOCHC+ 9/2O2V2O5, 350−450o C→OCH+CO2 + H2OCO4Chất X (C10H16) cộng 3H2; sản phẩm có công thức C10H22. Theo các sản phẩm ozon phânsuy ra X có mạch hở, có 3 liên kết đôi và tạo ra 2 mol HCHO nên có hai nhóm CH2 = C.Các chất X thỏa mãn:(CH3)2C=CH-C-CH2-CH2-CH=CH2CH2(CH3)2C=CH-CH2-CH2-C-CH=CH2CH2(CH3)2C=CH-CH2-CH2-CH=CH2CH=CH2(X3)(X2)(X1)Hyđrat hóa X tạo ra ancol có phản ứng iođofom.Ta có tỉ lê: nCHI3 : nX=0,04 : 0,02= 2. Vậy sản phẩm hyđrat hóa X phải có 2 nhómCH3-CHOH-. Suy ra chỉ có chất X3 ở trên thỏa mãn.Các phương trình phản ứng:Ghi chú: Thí sinh có thể làm cách khác, nếu đúng vẫn đạt điểm tối đa trong mỗi câu.Nếu thiếu điều kiện hoặc thiếu cân bằng hoặc thiếu cả hai thì trừ một nửa số điểm của PTHH đó.………………………HẾT…………………….71,0 UBND TỈNH QUẢNG TRỊKỲ THI CHỌN HỌC SINH GIỎI VĂN HÓA LỚP 11 THPTSỞ GIÁO DỤC VÀ ĐÀO TẠONăm học: 2013 - 2014Khóa thi ngày: 19/3/2014Môn thi: HÓA HỌCĐỀ CHÍNH THỨCThời gian làm bài: 180 phút (không kể thời gian giao đề)(Đề thi gồm 2 trang)Câu 1. (4,0 điểm)1. Chỉ dùng một dung dịch làm thuốc thử, hãy lập sơ đồ để nhận biết 4 dung dịch riêng biệtchứa các chất sau: K3PO4, KCl, KNO3, K2S (không cần ghi phản ứng).2. Có các dung dịch cùng nồng độ chứa các chất sau: Al2(SO4)3, HNO3, KNO3, Na2CO3.Hãy cho biết dung dịch có pH nhỏ nhất và giải thích?3.a) Viết các phương trình phản ứng điều chế trực tiếp các chất: N2, HNO3, H3PO4 trongphòng thí nghiệm và phân ure trong công nghiệp.b) Hoàn thành các phương trình phản ứng sau:K2SO3 + KMnO4 + KHSO4 →KMnO4 + FeCl2 + H2SO4 → Dung dịch chỉ chứa muối sunfat4. Cho 2 muối Ag2SO4 và SrSO4 vào nước cất và khuấy đều cho đến khi đạt được dungdịch bão hòa ở nhiệt độ phòng. Xác định nồng độ ion Ag+ và Sr2+. Biết rằng ở nhiệt độ nghiên cứuTAg SO = 1,5.10−5 , TSrSO = 2,8.10−7 .244Câu 2. (4,0 điểm)1. Từ quặng photphorit, có thể điều chế được axit photphoric theo sơ đồ sau:Quặng photphorit → P → P2O5 → H3PO4.Viết các phương trình phản ứng xảy ra và tính khối lượng quặng photphorit chứa 73% Ca3(PO4)2cần để điều chế 1 tấn dung dịch H3PO4 50%. Giả sử hiệu suất của mỗi giai đoạn đều đạt 90%.2. Cho hỗn hợp A gồm FeS và FeCO3 tác dụng với dung dịch HNO3 đặc nóng dư, phảnứng hoàn toàn, thu được dung dịch A1 chỉ chứa Fe(NO3)3, H2SO4 và HNO3 dư; hỗn hợp B gồm 2khí là X và Y có tỉ khối so với H2 bằng 22,8.Viết các phương trình phản ứng và tính phần trăm theo khối lượng mỗi muối trong A.3. Khi cho cùng một lượng kim loại M vào dung dịch HNO3 đặc nóng dư và dung dịchH2SO4 loãng dư, phản ứng hoàn toàn thì thể tích khí NO2 (sản phẩm khử duy nhất) thu được gấp 3lần thể tích khí H2 ở cùng điều kiện nhiệt độ và áp suất. Khối lượng muối sunfat thu được bằng62,81% khối lượng muối nitrat tạo thành. Xác định kim loại M.4. Photgen là một chất khí độc được điều chế theo phản ứng: CO(k) + Cl2(k) → COCl2(k)Số liệu thực nghiệm tại 20oC về động học phản ứng này như sau:Thí nghiệm [CO]ban đầu (mol/lít) [Cl2]ban đầu(mol/lít) Tốc độ ban đầu(mol/lít.s)11,000,101,29.10-2920,100,101,33.10-3030,101,001,30.10-2940,100,011,32.10-31a) Hãy viết biểu thức tốc độ phản ứng.b) Nếu [CO] ban đầu là 1,00 mol/lít và [Cl2] ban đầu 0,10 mol/lít, thì sau thời gian bao lâu[Cl2] còn lại 0,08 mol/lít.Câu 3. (4,0 điểm)1. Cho hỗn hợp gồm CaCO3, Fe3O4 và Al chia làm 2 phần. Phần 1 tác dụng với dung dịchHNO3 loãng dư, tạo sản phẩm khử là NO duy nhất. Phần 2 tác dụng dung dịch NaOH dư thu đượcchất rắn. Chia đôi chất rắn, rồi cho tác dụng lần lượt với dung dịch H2SO4 loãng dư và CO dư,nung nóng. Viết các phương trình phản ứng xảy ra, biết các phản ứng xảy ra hoàn toàn.2. Nêu hiện tượng và viết phương trình phản ứng xảy ra trong các trường hợp sau:a) Cho đồng kim loại vào dung dịch hỗn hợp NH4NO3 và H2SO4 loãng.b) Sục khí NH3 từ từ đến dư vào dung dịch ZnCl2.c) Cho dung dịch KHSO4 đến dư vào dung dịch Ba(HCO3)2.1 3. Hỗn hợp gồm 1,92 gam Mg và 4,48 gam Fe phản ứng vừa hết với hỗn hợp khí X gồm clovà oxi thu được hỗn hợp Y chỉ gồm các oxit và muối clorua. Hòa tan Y cần dùng một lượng vừa đủlà 120 ml dung dịch HCl 2M, thu được dung dịch Z. Cho AgNO3 dư vào dung dịch Z, phản ứnghoàn toàn, thu được 56,69 gam kết tủa. Tính phần trăm theo thể tích của khí clo trong hỗn hợp X.Câu 4. (4,0 điểm)1. Đốt cháy hoàn toàn hiđrocacbon R, thu được tỉ lệ số mol H2O và CO2 tương ứng bằng 1,125.a) Xác định công thức phân tử của R.b) R1 là đồng phân của R, khi tác dụng với Cl2, điều kiện thích hợp, tỉ lệ mol 1:1 thì thu đượcmột dẫn xuất mono clo duy nhất (R2). Gọi tên R1, R2 và viết phương trình phản ứng xảy ra.2. Trình bày phương pháp hóa học đơn giản nhất để phân biệt mỗi cặp chất dưới đây chứatrong các bình riêng biệt mất nhãn và viết các phương trình phản ứng xảy ra:a) m-bromtoluen và benzyl bromua.b) phenylaxetilen và stiren.c) axetilen và propin.d) CH2=C(CH3)–COOH và axit fomic.3. Từ anđehit no đơn chức, mạch hở A có thể chuyển trực tiếp thành ancol B và axit Dtương ứng, từ B và D điều chế este E.a) Viết các phương trình phản ứng và tính tỉ số khối lượng mol phân tử của E và A.b) Nếu đun nóng m gam E với lượng dư dung dịch KOH thì thu được m1 gam muối kali,còn với lượng dư dung dịch Ca(OH)2 sẽ cho m2 gam muối canxi. Biết m2> K2 >> K3, Kw và K4 >> Kw nên ta có thể bỏ qua cân bằng (2), (3)và (5).−K1H 2 PO410 −2,15Từ (1) suy ra:=== 10-0,68 = 0,21 (6)+−1, 47[H 3 PO4 ] H10[][CH COO ][ ]K410 −4, 76== 10-3,29+−1, 47[CH 3 COOH] H10[CH3COO ] Độ tan của CO2 là 0,03 MNhư vậy, có khí CO2 thoát ra.Số mol CO2 hoà tan là:0,2.0.03 = 0,006 (mol)Số mol CO2 bay ra là:0,0208 – 0,006 = 0,0148 (mol)Thể tích CO2 thoát ra là:22,4.0,0148 ≈ 0,33 (L)[[]][[0,25[ ]0,25[ ]]] [ ]II.2CuSO4Cu2+ + SO420,1M0,1MH2SO42H+ + SO420,05M0,1MH2OH+ + OHCác quá trình có thể xảy ra tại các điện cực:* Anot (cực dương):2H2O – 4eO2 + 4H+* Catot (cực âm):Cu2+ + 2eCu2H+ + 2eH260,250,250,250,251,50,5 Thành phố Đà NẵngTrường THPT chuyên Lê Quý ĐônMôn: Hoá học 11Giáo viên biên soạn: Lê Thanh HảiSố mật mã:* Tính E(O2, 4H+ / 2H2O)O2 + 4e + 4H+2H2OE(O2, 4H+ / 2H2O) = Eo(O2, 4H+ / 2H2O) +0,059lg[H+ ]44= 1,23 + 0,059.lg0,1= 1,171 (V)0,25* Ta có:0,059lg0,12= 0,311 (V)E(2H+/H2) = 0,0 + 0,059lg0,1 = - 0,059 (V)Vậy hiệu điện thế tối thiểu cần đặt vào 2 cực của bình điện phân để quátrình điện phân xảy ra là:Emin = 1,171 – 0,311 = 0,86 (V)E(Cu2+/Cu) = 0,34 +0,250,5Câu III(4 điểm)III.1. Viết các phương trình phản ứng sau và cho biết ứng dụng của từng phản ứng:• PdCl2 + H2O + CO →• Si + KOH + H2O →• N2H4 + O2 →• Zn3P2 + H2O →III.2. So sánh và giải thích:• Nhiệt độ sôi của photphin và amoniac.• Nhiệt độ sôi của silan và metan.• Nhiệt độ nóng chảy của silic đioxit và cacbon đioxit.III.3. Trình bày phương pháp hoá học nhận biết các anion có trong dung dịch hỗn hợpNaNO3, Na2SO4, Na2SO3, Na2CO3 và Na3PO4.ÝIII.1Đáp án• PdCl2 + H2O + CO → Pd + 2HCl + CO2Nhờ phản ứng này, người ta phát hiện lượng vết CO trong hỗn hợp khí:Những hạt rất nhỏ của Pd tách ra trong dung dịch làm cho màu đỏ củadung dịch PdCl2 trở nên đậm hơn.• Si + 2KOH + H2O → K2SiO3 + 2H2↑Lợi dụng phản ứng của silic với dung dịch kiềm, trước đây, người tadùng hợp kim ferosilic để điều chế nhanh khí hiđro ở mặt trận.• N2H4 + O2 → N2 + 2H2OPhản ứng toả nhiệt mạnh nên N2H4 được dùng làm nhiên liệu cho tênlửa.• Zn3P2 + 6H2O → 3Zn(OH)2 + 2PH3PH3 rất độc nên người ta dùng Zn3P2 để làm thuốc diệt chuột.III.2•Liên kết P-H là liên kết cộng hoá trị không phân cực, còn liên kết N-Hlà liên kết cộng hoá trị phân cực mạnh nên giữa các phân tử NH3 tạođược liên kết hiđro, ngoài ra, phân tử NH3 phân cực mạnh hơn phân tửPH3 nên lực hút Van der Waals giữa các phân tử NH3 cũng lớn hơn so7Điểm1,00,250,250,250,251,5 Thành phố Đà NẵngTrường THPT chuyên Lê Quý ĐônMôn: Hoá học 11Giáo viên biên soạn: Lê Thanh HảiSố mật mã:••với phân tử PH3. Do đó:NH3 có nhiệt độ sôi cao hơn PH3Liên kết C-H và liên kết Si-H đều là liên kết cộng hoá trị không phâncực nên tương tác giữa các phân tử CH4 hoặc SiH4 là lực hút Van derWaals. Mà SiH4 có khối lượng phân tử lớn hơn CH4 nên:SiH4 có nhiệt độ sôi cao hơn CH4.Silic đioxit tuy có công thức phân tử giống với cacbon đioxit nhưngthực ra, silic đioxit ở trạng thái rắn không tồn tại ở dạng từng phân tửriêng rẽ mà có cấu trúc polime. Tinh thể silic đioxit gồm những nhóm tứdiện SiO4 liên kết với nhau qua những nguyên tử O chung. Quá trìnhnóng chảy của silic đioxit liên quan đến việc cắt đứt các liên kết hoá họcnên nhiệt độ nóng chảy của silic đioxit rất cao. Còn cacbon đioxit ởtrạng thái rắn có cấu trúc tinh thể phân tử. Lực hút giữa các phân tử làlực Van der Waals yếu nên tinh thể cacbon đioxit dễ nóng chảy. Vậy:Silic đioxit có nhiệt độ nóng chảy cao hơn cacbon đioxit.III.3- Trích mẫu thử- Cho dung dịch HCl dư vào mẫu thử, thu được dung dịch A và dẫn khíthoát ra qua 3 ống nghiệm mắc nối tiếp: ống nghiệm 1 đựng một ít dungdịch brom, ống nghiệm 2 đựng lượng dư dung dịch brom, ống nghiệm 3đựng dung dịch nước vôi trong dư.Ở ống nghiệm 1, dung dịch brom bị mất màu, suy ra trong dung dịch banđầu có ion SO32-.Ở ống nghiệm 3, nước vôi trong vẩn đục, suy ra trong dung dịch ban đầucó ion CO32-.SO32- + 2H+ → SO2↑ + H2OCO32- + 2H+ → CO2↑ + H2OPO43- + 3H+ → H3PO4SO2 + Br2 + 2H2O → H2SO4 + 2HBrCO2 + Ca(OH)2 → CaCO3↓ + H2O- Chia dung dịch A thành 2 phần:• Phần 1: Cho dung dịch BaCl2 dư vào, xuất hiện kết tủa trắng, suy ratrong dung dịch ban đầu có ion SO42-.Ba2+ + SO42- → BaSO4↓Lọc bỏ kết tủa, nhỏ dung dịch NaOH vào dung dịch nước lọc đếnkhi xuất hiện kết tủa trắng, suy ra trong dung dịch ban đầu có ionPO43-.H+ + OH- → H2OH3PO4 + 3OH- → PO43- + 3H2O3Ba2+ + 2PO43- → Ba3(PO4)2↓• Phần 2: Cho lá đồng vào, có khí bay ra, hoá nâu trong không khí,suy ra trong dung dịch ban đầu có ion NO3-.3Cu + 2NO3- + 8H+ → 3Cu2+ + 2NO↑ + 4H2ONO + ½ O2 → NO280,50,50,51,50,50,250,250,250,25 Thành phố Đà NẵngTrường THPT chuyên Lê Quý ĐônMôn: Hoá học 11Giáo viên biên soạn: Lê Thanh HảiSố mật mã:Câu IV(4 điểm)IV.1. Khi cho isobutilen vào dung dịch H2SO4 60%, đun nóng tới 80oC, thu được hỗn hợp gọitắt là đi-isobutilen gồm hai chất đồng phân A và B. Hiđro hoá hỗn hợp này được hợpchất C quen gọi là isooctan. C là chất được dùng để đánh giá nhiên liệu lỏng.IV.1.1. Viết cơ chế phản ứng để giải thích sự tạo thành A, B và viết phương trình phản ứngtạo thành C từ A, B.IV.1.2. C cũng có thể được điều chế bằng phản ứng trực tiếp của isobutilen và isobutan khicó mặt axit vô cơ làm xúc tác. Viết cơ chế phản ứng.IV.2. Cho sơ đồ chuyển hoá:Br2NBSXiclohexen →A→B + C(Cấu hình R)KOH / AncolB → 1,3-đibromxiclohex-1-en (D).IV.2.1. Xác định cấu trúc (vòng phẳng) của các chất A, B, C, D.IV.2.2. Trình bày cơ chế A chuyển thành B và B chuyển thành D.ÝIV.1IV.1.1Đáp ánĐiểm2,0(1,0)H2SO4 → H+ + HSO4CH2C CH3CH3CH3+ HC CH3CH3CH3CH3C CH3 + CH2C CH3CH3CH3CH3C CH2C CH3CH3CH3CH3CH3CH3CH3C CH2C CH3CH3CH3-HC CH2C CH2 (A)CH3CH3CH3CH3C CH C CH3 (B)CH3C CH2C CH2 + H2CH3CH3CH3CH3C CH C CH3 + H2CH3C CH2CH CH3CH3CH3CH3CH3CH30,75CH3CH3CH3CH3CH39C CH2CH CH3CH3CH30,25 Thành phố Đà NẵngTrường THPT chuyên Lê Quý ĐônMôn: Hoá học 11Giáo viên biên soạn: Lê Thanh HảiSố mật mã:IV.1.2(1,0)CH2C CH3CH3+ HCH3C CH3CH3CH3CH3C CH3 + CH2C CH3CH3CH3CH3C CH2C CH3CH3CH3CH3CH3C CH2C CH3 + CH3CH CH3CH3CH3CH3CH3CH3C CH2CH CH3 + CH3C CH3CH3CH3CH31,0IV.2IV.2.12,0(1,0)Cấu trúc của A, B, C, D lần lượt là:BrBrBrBrBrBrBrBrBr1,0IV.2.2(1,0)* Cơ chế A chuyển thành B:Br δ+ δBr BrBrBr-BrBr- Br -0,5+BrBr* Cơ chế B chuyển thành D:BrBr + OHδ-BrHBrBrBrδ--H 2OBr0,5H OHBr10Br Thành phố Đà NẵngTrường THPT chuyên Lê Quý ĐônMôn: Hoá học 11Giáo viên biên soạn: Lê Thanh HảiSố mật mã:Câu V(4 điểm)V.1. Cho axetanđehit tác dụng với lượng dư fomanđehit có mặt NaOH, thu được chất A. ChoA tác dụng với lượng dư dung dịch NaBr bão hoà và H2SO4 đặc, thu được chất B. Đunnóng B với bột Zn, thu được chất C. C có công thức phân tử là C5H8. Viết các phươngtrình phản ứng xảy ra.V.2. Hợp chất A chứa 82,19% C; 6,85% H; còn lại là oxi. Phân tử A có một nguyên tử oxi.A không tạo màu với dung dịch FeCl3, A tạo sản phẩm cộng với NaHSO3. Cho A tácdụng với dung dịch iot trong NaOH thì không tạo kết tủa, axit hoá dung dịch sau phảnứng thì thu được chất B, chất B hơn A một nguyên tử oxi trong phân tử. B không làmmất màu dung dịch KMnO4 ở lạnh. Cho B tác dụng với lượng dư brom khi có mặt lượngdư HgO đỏ trong CCl4, thu được chất C là 1,2,3-tribrom-2-phenylpropan.Mặt khác, cho A tác dụng với NaBH4 và H2O thu được chất D. Đun nóng D với dungdịch H2SO4 đặc, thu được chất E có công thức phân tử C10H10.V.2.1. Xác định công thức cấu tạo của A và viết các phương trình phản ứng xảy ra.V.2.2. Viết cơ chế phản ứng chuyển hoá D thành E.(Cho : C = 12 ; H = 1 ; O = 16)ÝV.1Đáp ánĐiểm1,0C H 2O HHOC H 3C H O + 4 H C H O + N a O HCH2CCH2OHHCOONaC H 2O H(A)(Hoặc:CH 2 OHCH 3 CHO + 3 HCHOOHHOCH 2CCHOCH 2 OHCH 2 OHCH 2 OHHOCH 2CCHOHCHOHOCH 2NaOHCCH 2 OH(A))CH2BrCH2OHC CH2OH0,5CH 2 OHCH 2 OHHOCH2HCOONa4 KBrBrCH2CCH2Br4 H2SO44KHSO4 4 H2O0,25CH2BrCH2OH(B)C H 2B rB rC H 2 C C H 2B r2 Z n B r22 ZnC H 2B r0,25(C)V.2V.2.13,0(2,0)Hợp chất A có:82,19 6,85 10,96nC : nH : nO =::= 6,85 : 6,85 : 0,685 = 10 : 10 : 112116Phân tử A có một nguyên tử O nên công thức phân tử của A là C10H10O.110,25 Thành phố Đà NẵngTrường THPT chuyên Lê Quý ĐônMôn: Hoá học 11Giáo viên biên soạn: Lê Thanh HảiSố mật mã:A không tạo màu với dung dịch FeCl3 nên A không có chức phenol.A tạo sản phẩm cộng với NaHSO3 nên A là anđehit hoặc metylxeton.A tác dụng với dung dịch iot trong NaOH thì không tạo kết tủa nên A khôngphải là metylxeton, suy ra A là anđehit.Axit hoá dung dịch sau phản ứng thu được chất B, chất B hơn A một nguyêntử O trong phân tử nên B là axit cacboxylic tương ứng với A và có công thứcphân tử là C10H10O2.B không làm mất màu dung dịch KMnO4 ở lạnh nên trong phân tử B khôngcó liên kết π C-CCho B tác dụng với lượng dư brom khi có mặt lượng dư HgO đỏ trong CCl4,thu được chất C là 1,2,3-tribrom-2-phenylpropan nên CTCT của B là:0,250,25COOHSuy ra công thức cấu tạo của A là:CHOCác phương trình phản ứng xảy ra:C6H5-C3H4-CHO + NaHSO3 → C6H5-C3H4-CH(OH)-SO3NaC6H5-C3H4-CHO + I2 + 3NaOH → C6H5-C3H4-COONa + 2NaI +2H2OC6H5-C3H4-COONa + H+ → C6H5-C3H4-COOH + Na+0,250,25CH2Br4Br222HgOCHBr2 CO2HgBr2 H2OCH2BrCOOH(C)4C6H5-C3H4-CHO + NaBH4 + 3H2O → 4C6H5-C3H4-CH2OH + NaH2BO3(D)0,250,250H2SO4, tH 2OCH2OH0,25(E)V.2.2(1,0)Cơ chế chuyển hoá D thành E:CH2OHHH2OHCH2121,0 KỲ THI OLYMPIC TRUYỀN THỐNG 30/4LẦN THỨ XIII TẠI THÀNH PHỐ HUẾĐỀ THI MÔN HÓA HỌC 11Thời gian làm bài 180 phútĐỀ THI CHÍNH THỨCChú ý: Mỗi câu hỏi thí sinh làm trên 01 tờ giấy riêng biệtCâu I (4 đ)I.1(1,5đ) Đối với phản ứng :k1→← Bk2Các hằng số tốc độ k1 = 300 giây -1 ; k2 = 100 giây -1 . Ở thời điểm t = 0 chỉ có chất A và không có chất B .Hỏi trong bao lâu thì một nửa lượng ban đầu chất A biến thành chất B?I.2(1,5ñ) Cho 2 caëp oxi hoaù khöû :Cu2+/ Cu+E10 = 0,15VAI2/ 2I-E20 = 0, 62V2.1. Vieát caùc phương trình phaûn öùng oxi hoaù khöû vaø phöông trình Nernst töông öùng. Ở điềukiện chuaån coù thể xaûy ra söï oxi hoaù I- baèng ion Cu2+ ?2.2. Khi ñoå dung dòch KI vaøo dung dòch Cu2+ thaáy coù phaûn öùng1Cu2+ +2ICuI ↓ + I22Haõy xaùc ñònh haèng soá caân baèng cuûa phaûn öùng treân . Bieát tích soá tan T cuûa CuI laø 10-12I.3(1đ) So sánh và giải thích ngắn gọn độ phân cực (momen lưỡng cực) của các chất sau: NF3, BF3.Câu II (4đ)II.1(1,5đ) Viết phương trình phản ứng và xác định thành phần giới hạn của hỗn hợp khi trộn H2SO4C1M với Na3PO4 C2M trong trường hợp sau:2C1 > C2 > C1II.2(0,5đ) Tính pH của dung dịch H3PO4 0,1MII.3(1đ) Cần cho vào 100ml dung dịch H3PO4 0,1M bao nhiêu gam NaOH để thu được dung dịch cópH= 4,72.Cho: H2SO4 : pKa2 = 2 ; H3PO4 : pKa1 = 2,23 , pKa2 = 7,21 , pKa3 = 12,32II.4(1đ)Cho biết chiều hướng của phản ứng oxi hóa - khử:2FeF3+ 2I2Fe2+ + I2 + 6FBiết : EoFe3+/Fe2+ = 0,77VEoI2/2I- = 0,54V+3Quá trình : Fe + 3FFeF3β = 1012,06 (Bỏ qua quá trình tạo phức hiđroxo của Fe3+, Fe2+)Câu III (4đ)III.1(2đ) Khi hòa tan SO2 vào nước có các cân bằng sau :SO2 + H2OH2SO3 (1)+H2SO3H + HSO3- (2)HSO3H+ + SO32(3)Hãy cho biết nồng độ cân bằng của SO2 thay đổi thế nào ở mỗi trường hợp sau (có giải thích).1.1 Đun nóng dung dịch1.2 Thêm dung dịch HCl1.3 Thêm dung dịch NaOH1.4 Thêm dung dịch KMnO4III.2(2đ) Cho m1 gam hỗn hợp gồm Mg, Al vào m2 gam dung dịch HNO3 24%. Sau khi các kim loạitan hết có 8,96 lít (ở đktc) hỗn hợp khí X gồm NO, N2O, N2 bay ra (ở đktc) và dung dịch A. Thêm mộtlượng vừa đủ O2 vào X, sau phản ứng thu được hỗn hợp khí Y. Dẫn Y từ từ qua dung dịch NaOH dư có 4,48lít hỗn hợp khí Z đi ra (ở đktc). Tỷ khối của Z đối với H2 bằng 20. Nếu cho dung dịch NaOH vào A để đượclượng kết tủa lớn nhất thu được 62,2 gam kết tủa.Tính m1, m2. Biết lượng HNO3 lấy dư 20% so với lượng cần thiết.Cho Mg = 24; Al = 27; N = 14; Na = 23; O =16; H = 1. Câu IV (4đ)IV.1(1,5đ) Hôïp chaát höõu cô X coù caáu taïo khoâng voøng, coù coâng thöùc phaân töû C4H7Cl vaø coù caáu hìnhE. Cho X taùc duïng vôùi dung dòch NaOH trong ñieàu kieän ñun noùng thu ñöôïc hoãn hôïp saûn phaåm beàn coùcuøng coâng thöùc C4H8O . Xaùc ñònh caáu truùc coù theå có cuûa X.IV.2 (1đ) Cho buten – 2 vaøo dd goàm HBr , C2H5OH hoaø tan trong nöôùc thu ñöôïc caùc chaát höõu cô gì ?Trình baøy cô cheá phaûn öùng taïo thaønh caùc chaát treân .IV.3(1,5đ) Phân tích 1 terpen A có trong tinh dầu chanh thu được kết quả sau: C chiếm 88,235% vềkhối lượng, khối lượng phân tử của A là 136 (đvC)A có khả năng làm mất màu dd Br2 , tác dụng với Br2 theo tỉ lệ mol 1:2, không tác dụng vớiAgNO3/NH3. Ozon phân hoàn toàn A tạo ra 2 sản phẩm hữu cơ : anđehitfomic và 3-axetyl-6-on heptanal.Xác định công thức cấu tạo của A. Xác định số đồng phân lập thể (nếu có).Cho C = 12; H = 1.Câu V (4đ)V.1(2đ) Từ các chất ban đầu có số nguyên tử cacbon ≤ 3, viết các phương trình phản ứng (ghi rõ điềukiện nếu có) điều chế: Axit xiclobutancacboxylic và Xiclopentanon .V.2(2đ)Từ dẫn xuất halogen có thể điều chế được axit cacboxylic theo sơ đồ sau :+ HXCO2 ( ete.khan )Mg ( ete.khan )RX + → RMgX + → R-COOMgXR-COOH− MgX 2Dựa theo sơ đồ trên từ metan hãy viết phương trình phản ứng điều chế:Axit metyl malonic...............................Hết................................ KỲ THI OLYMPIC TRUYỀN THỐNG 30/4LẦN THỨ XIII TẠI THÀNH PHỐ HUẾĐỀ THI MÔN HÓA HỌC 11Thời gian làm bài 180 phútPHẦN ĐÁP ÁNChú ý: Mỗi câu hỏi thí sinh làm trên 01 tờ giấy riêng biệtCâu 1(4 đ) :I.1.k1→←k2At=0aa2tB0a2xe1k1 + k 2 = lnt xe − xỞ đây nồng độ lúc cân bằng xe được xác định thông qua hằng số cân bằng K :[ B] = x eK =[ A ] a-x eÁp dụng công thức đã cho :aK1+ KaK-x(1+K)vàxe − x =1+ K2,303aKaCuối cùngVìk1 + k 2 =lgx=taK - x - Kx22,303aK2,3032K2,303 2Kk1 + k 2 =lgNên=lg=lgaatt2K - 1 - KtK -1aK - - K22Sau khi biến đổi ta được :VìNênxe =K = k1 / k2t=2k 12,303lgk1 + k 2 k1 - k 2=2,3032 . 300lg= 2,7.10 −3 giây300 + 100 300 - 1000,25I.22.1. Xeùt 2 caëp oxi hoaù khöû :2+CuI2+ e+ 2e+Cu2I-Cu 2+ E1 = E + 0, 059 lgCu + 01E2 = E20 +0,25[I ]0, 059lg 2 22 I − E10 〈 E20 : Khoâng theå coù phaûn öùng giöõa Cu2+ vaø I- ñöôïc.2.2. Giaû söû ñoå dung dòch KI vaøo dung dòch chöùa Cu2+ vaø moät ít Cu+. Vì CuI raátít tan neân [Cu+] raát nhoû, do ñoù E1 coù theå lôùn hôn E2.Nhö vaäy ta coù :Cu2+ + eCu++I+ CuCuI ↓1I2 + eI2Phaûn öùng oxi hoaù khöû toång quaùt laø :0,250,5 Cu2+2I-+CuI ↓ +1I22(1)0,25Luùc caân baèng ta coù:Cu 2+ [I ]0, 059E1 = 0,15 + 0, 059 lglg 2 2= E2 = 0, 62 +T2 I − −[I ]2Cu 2 +   I − 1⇔ 0,62 – 0,15 = 0, 059 lg= 0, 059 lg1T .KT [ I 2 ]2−0,62 + 0,150,5đ1⇒ K = .10 0,059 = 10 4TNhö vaäy vôùi K raát lôùn, phaûn öùng (1) xaûy ra hoaøn toaøn.I.3.FFNFFCâu 2 (4 đ):II.12C1 > C2 > C10,25Các vectơ momen lưỡngcực của các liên kết triệttiêu lẫn nhau nên momenlưỡng cực tổng bằng 0.phân tử không phân cực.H+ + PO43C2C1/C2 – C1HSO −4 +PO 34−C2 – C1/HSO −4 + HPO 24−2C1 – C2/FFCác vectơ momen lưỡngcực của các cặp electronkhông liên kết ngược chiềunên momen lưỡng cực củaphân tử bé hơn NH3C12C1 – C2BC22(C2 – C1)HPO42-C2 - C1C10,25đHPO 24−K1 = 1010,32C1C2C2 – C1SO 24 −−1K a3= 10 12 ,32C1SO 24 − ++0,25H2PO −40,25đK2 = 105,262C1 – C2Vậy TPGH : HPO 24 − : 2(C2 – C1) ; H 2 PO −4 : 2C1 – C2 ; SO 24− : C1 ; Na+ : 3C1II.2.H3PO4H+ + H2PO4- (1) K1 = 10-2,23H2PO4H+ + HPO42- (2) K2 = 10-7,21HPO42H+ + PO43- (3) K3 = 10-12,32H2OH+ + OH(4) KwK3 [...]... b = 0,02 mol T ú ta cú x = 2( 135. 0,01 + 162,5.0,02) = 9,2 gam Chỳ ý: Thí sinh có thể giải bài toán theo cách khác nếu lập luận đúng và tìm ra kết quả đúng vẫn cho điểm tối đa H v tờn thớ sinh: Ch ký giỏm th 1: S bỏo danh: . S GDT BC LIấU K THI CHN HSG LP 10, 11 VềNG TNH NM HC 2 011 - 2012 CHNH THC * Mụn thi: HểA HC * Bng: A * Lp: 11 * Thi gian: 180 phỳt (Khụng k thi gian giao ) (Gm 02 trang)... BC LIấU K THI CHN HSG LP 10, 11 VềNG TNH NM HC 2 011 - 2012 CHNH THC * Mụn thi: HểA HC * Bng: A * Lp: 11 * Thi gian: 180 phỳt (Khụng k thi gian giao ) (Gm 05 trang) HNG DN CHM Cõu 1: (4 im) 1 (1.0) Tớnh S ca phn ng : 1 O2(k) J SO3 (k) 2 1 D S 0298 = S 0298 (SO3, k) S 0298 (SO2, k) + S 0298 (O2, k) 2 205, 03 1 = 256, 22 248,52 + = 94,82 JK 2 SO2(k) + (1.0) 2 (1.0) a Ha = ( 435, 9 + 242,4)... (0.5) CH2CH2CH3 CH2CH2CH3 3 + 10KMnO4 3C6H5COOK + 3CH3COOK + 10MnO2 + 4KOH + (0.5) + 4H2O - HT 5 H v tờn thớ sinh: Ch ký giỏm th 1: S bỏo danh: . S GDT BC LIấU K THI CHN HSG LP 10, 11 VềNG TNH NM HC 2 011 - 2012 CHNH THC * Mụn thi: HểA HC * Bng: B * Lp: 11 * Thi gian: 180 phỳt (Khụng k thi gian giao ) (Gm 02 trang) Cõu 1: (4 im) 1 (1.0) Tớnh S ca phn ng sau: SO2(k) + Cho bit: Cht 0 S 298 (J.K-1.mol-1)... LIấU CHNH THC K THI CHN HSG LP 10, 11 VềNG TNH NM HC 2 011 - 2012 * Mụn thi: HểA HC * Bng: B * Lp: 11 * Thi gian: 180 phỳt (Khụng k thi gian giao ) (Gm 05 trang) HNG DN CHM Cõu 1: (4 im) 1 (1.0) Tớnh S ca phn ng : 1 O2(k) J SO3 (k) 2 1 D S 0298 = S 0298 (SO3, k) S 0298 (SO2, k) + S 0298 (O2, k) 2 205, 03 1 = 256, 22 248,52 + = 94,82 JK 2 SO2(k) + (1.0) 2 (1.0) a Ha = ( 435, 9 + 242,4)...UBND TNH THI NGUYấN S GIO DC V O TO CHNH THC HD CHM THI CHN HSG TNH NM HC 2 011- 2012 MễN THI: HO HC LP 11 (Thi gian lm bi 150 phỳt khụng k thi gian giao ) Cõu Ni dung im 1,5 1 Vỡ X thuc nhúm A, hp cht vi hidro cú dng XH3 nờn l nhúm VA (ns2np3) Vy: ms = +1/2; l = 1 ; m = +1... nng lng liờn kt cỏc cht nh sau: Cl2 HCl Hg O2 Cht H2 Elk(k.J.mol-1) 435, 9 242,4 431,0 61,2 498,7 3 (1.0) Xỏc nh H 0pu ca phn ng sau: 4FeCO3 (tt) + O2 (k) J 2Fe2O3 (tt) + 4CO2 (k) Bit H 0298 ca cỏc cht: O2 Fe2O3 Cht FeCO3 -1 0 747,68 0,0 821,32 H 298 (kJ.mol ) SO3(k) 256,22 0 HgO 355 ,7 CO2 393,51 4 (1.0) Tớnh nhit to thnh (entanpi sinh chun) H 0298 ca CaCO3 bit cỏc d kin: CaCO3 (r) J CaO (r) + CO2... Bit nng lng liờn kt cỏc cht nh sau: Cl2 HCl Hg O2 Cht H2 -1 Elk(k.J.mol ) 435, 9 242,4 431,0 61,2 498,7 0 3 (1.0) Xỏc nh H 0pu ca phn ng sau: 4FeCO3 (tt) + O2 (k) J 2Fe2O3 (tt) + 4CO2 (k) Bit H 0298 ca cỏc cht: O2 Fe2O3 Cht FeCO3 747,68 0,0 821,32 H 0298 (kJ.mol-1) HgO 355 ,7 CO2 393,51 4 (1.0) Tớnh nhit to thnh (entanpi sinh chun) H 0298 ca CaCO3 bit cỏc d kin: CaCO3 (r) J CaO (r) + CO2 (k); H1... CTG ca A l C2H7O2Nt (vỡ khi lng nhúm (0.25) C2H7O2 l 63 m khi lng anilin l 93) Phn ng t chỏy c vit li l: 3 11 O2 4CO2 + 7H2O + tN2 2 44.4 + 18.7 + 28.t = 13,75.2 t = 1 CTPT A: C2H7O2N 4+7+t 2C2H7O2Nt + (0.5) CTCT A: CH3COONH4 (0.25) Cõu 4: (4 im) 1 S mol CO2 = 0,5 mol S mol H2O = 0,75 mol t Y sinh ra: nH2O > n CO2 Y l ankan CnH2n+2 nCO2 + (n+1)H2O 0,5mol 0,75mol Ta cú: 0,75n = 0,5(n+1) n = 2 Y... dng va vi 200 ml dung dch NaOH 1M, lc kt ta em nung n khi lng khụng i, c 3,2 gam cht rn Tớnh khi lng cỏc cht trong A v nng % ca dung dch HNO3 (gi thit HNO3 khụng b mt do bay hi trong quỏ trỡnh phn ng) Cõu 3: (4 im) 1 Hóy biu din cỏc hp cht sau bng cụng thc chiu Fis: a Axit R - lactic b S - alanin 2 Gi tờn cỏc hp cht sau theo danh phỏp thay th a CH2 CH2 CH2 CH2 CH3 CH2 = C CH2 C C CH CH3 CH3 b... 183,7kJ < 0 J phn ng ta nhit b Hb = (2 x 355 ,7) (2 x 61,2 + 498,7) = 90,3kJ > 0 J phn ng thu nhit (0.25) (0.25 ) (0.25 ) (0.25) 3 (1.0) Xỏc nh H 0pu ca phn ng : 4FeCO3 (tt) + O2 (k) J 2Fe2O3 (tt) + 4CO2 (k) p dng cụng thc ta cú: 0 H pu =[2(821,32) + 4(393,51)] [ 4(747,68)] = 225,96Kj < 0 J phn ng ta nhit (0.5) (0.5) 4 (1.0) Tớnh nhit to thnh (entanpi sinh chun) H 0298 ca CaCO3 Theo nh lut Hess ... BIÊN KÌ THI CHỌN HỌC SINH GIỎI CẤP CƠ SỞ NĂM HỌC 2012 - 2013 ĐỀ CHÍNH THỨC Mơn: Hóa học - lớp 11 Ngày thi: 15/4/2013 Thời gian: 180 phút, khơng kể thời gian giao đề (Đề thi có 02 trang) ĐỀ BÀI... & ĐT VĨNH PHÚC ĐỀ CHÍNH THỨC KỲ THI CHỌN HỌC SINH GIỎI LỚP 11 NĂM HỌC 2 011- 2012 ĐỀ THI MƠN: HỐ HỌC (Dành cho học sinh THPT) (Thời gian làm bài: 180 phút, khơng kể thời gian giao đề) Bài (1,5 điểm... + Ca(OH)2 (0 ,111 mol) → CaCO3 (x)   Ba(OH) → BaCO (0 ,111 -x)+CaCO (0 ,111 -x) Ca(HCO3 ) (0 ,111 -x)  3 Nên 100x+(0 ,111 -x)100+(0 ,111 -x)197=20,95 → x= 0,061 → nCO2= 0,061+2(0 ,111 -0,061)= 0,161
- Xem thêm -

Xem thêm: Tuyển tập 35 đề thi học sinh giỏi môn Hóa học lớp 11 (có đáp án chi tiết), Tuyển tập 35 đề thi học sinh giỏi môn Hóa học lớp 11 (có đáp án chi tiết), Tuyển tập 35 đề thi học sinh giỏi môn Hóa học lớp 11 (có đáp án chi tiết)

Từ khóa liên quan