đề thi và đáp án hsg quốc gia vòng 2 môn hóa học 2010

15 384 1
  • Loading ...
    Loading ...
    Loading ...

Tài liệu hạn chế xem trước, để xem đầy đủ mời bạn chọn Tải xuống

Tài liệu liên quan

Thông tin tài liệu

Ngày đăng: 11/10/2018, 11:02

Dưới đây là đề thi chọn đội tuyển hóa học toàn quốc 2010 tham dự ICHO mới nhất các bạn nhé. Bạn nào có nhu cầu mua tài liệu thì liên hệ anh nha. Các bạn có thể sử dụng tài liệu này như một cách để rèn luyện kiến thức. BỘ GIÁO DỤC ĐÀO TẠO KÌ THI CHỌN HỌC SINH VÀO CÁC ĐỘI TUYỂN QUỐC GIA DỰ THI OLYMPIC QUỐC TẾ NĂM 2010 HƯỚNG DẪN CHẤM ĐỀ THI CHÍNH THỨC Mơn: HỐ HỌC Ngày thi thứ hai: 18/04/2010 Câu (4,0 điểm) (0,5 điểm) Hãy viết công thức cấu tạo hiđrocacbon X (C14H26) mà có 50 đồng phân quang học Hướng dẫn chấm: Nếu X có n cacbon bất đối số đồng phân quang học tối đa X 2n Theo ta có: 2n> 50 , n ≥ Dưới số công thức cấu tạo có X thỏa mãn điều kiện (dấu * cacbon bất đối) * * * * * * * * * * * * * * * * * ** * * * * * (Ghi chú: học sinh cần vẽ số cơng thức vẽ cơng thức cấu tạo có số cacbon bất đối n ≥ 6, khác với ví dụ trên, cho điểm tối đa) (1,5 điểm) Vẽ cấu trúc đồng phân có cơng thức phân tử C4H8O trường hợp sau: a Là đồng phân hình học b Là đồng phân quang học c Vừa đồng phân hình học, vừa đồng phân quang học Hướng dẫn chấm: Các hợp chất bền có cơng thức phân tử C4H8O thỏa mãn điều kiện sau: a Là đồng phân hình học: CH3 CH3 H C C C H CH2OH H C CH2OH H E CH3 OCH3 H Z C C H OCH3 H E Z b Là đồng phân quang học: CH3 H CH2 CH3 H C C CH C * CH3 * OH O H c Vừa đồng phân hình học , vừa đồng phân quang học: CH H CH CH CH3 H CH3 OH H CH H H H OH H H O O meso ± ± (2,0 điểm) Từ tinh dầu bạc hà người ta tách (-)-menton (trans-2-isopropyl-5-metylxiclohexanon) Khi chế hóa (-)-menton với axit kiềm, chuyển phần thành xeton đồng phân (+)-isomenton Khi chế hóa (-)-menton với anhiđrit axetic dung dịch natri axetat thu hai đồng phân A B có cơng thức phân tử C12H20O2 a Vẽ cấu trúc đồng phân lập thể (-)-menton b Dùng cơng thức cấu trúc, giải thích tạo thành (+)-isomenton, A B từ (-)-menton ± Trang 1/7 Hướng dẫn chấm: a.Hai cặp đối quang: O O I O II O III IV b.(-)-Menton bị enol hóa, C2 có lai hóa sp trở thành lai hóa sp , trở lại xeton C2 có lai hóa sp3 với cấu hình S (ở I) R (ở IV): + + - - H (OH ) H (OH ) O O OH I IV I có dạng enol, phản ứng không thuận nghịch với Ac2O tạo este đồng phân A B NaAc Ac2O NaAc Ac2O -NaAc OAc O -NaAc O A OAc O B I Câu ( điểm) (1,0 điểm) Atenolol (C14H22N2O3) sử dụng để điều trị số bệnh tim mạch Atenolol tổng hợp qua bước sau: tổng hợp p-hiđroxiphenylaxetamit (A) từ phenol; tổng hợp epiclohiđrin Cl (B) từ propen; cho A phản ứng với B (xúc tác NaOH), thu hai sản phẩm D O E với sản phẩm phụ G Isopropylamin phản ứng với D, E cho atenolol Biết phân tử khối D = 207, E = 243,5 G = 358 Được sử dụng hóa chất cần thiết a Viết sơ đồ phản ứng tổng hợp A từ phenol; B từ propen Xác định công thức cấu tạo D, E, G b Viết phản ứng isopropylamin với D, E tạo thành atenolol, biết atenolol ete thơm Hướng dẫn chấm: a Tổng hợp A : OH OH OH HCHO/HCl OH + H3O NaCN/DMF 2.NH3, t CH2Cl CH2CN o CH2CONH2 (Chú ý: phản ứng clometyl hóa phenol cho sản phẩm phụ đồng phân octo-, cần tách loại) Có thể tổng hợp A theo cách khác sau: Trang 2/7 OH OH OH OHC-COOH H CH-OH + + COOH HC-OH COOH Axit o-hi®roximan®elic Axit p-hi®roximan®elic OH OH OH l CH3OH/H+ [H] 2.NH3(30%) HC-OH CH2-COOH CH2CONH2 A COOH Tổng hợp B: o CH2=CH-CH3 Cl2, 500 C CH2=CH-CH2Cl H2O2 hay RCO3H Cl O OH O A+B O O Cl O O OH NaOH + + CH2CONH2 CH2CONH2 D E CH2CONH2 CH2CONH2 G Tổng hợp atenolol: O CH2-CH CH2 O + H2N-CH-CH3 CH3 D CH2CONH2 CH3 O CH2-CH-CH2-N-CH-CH3 OH H O CH2-CH-CH2-Cl OH + H2N-CH-CH3 CH3 E CH2CONH2 Atenolol CH2CONH2 (1,0 điểm) Thủy phân hoàn toàn polypeptit A người ta thu amino axit: Val Trp Met2 Gly2 Lys Ala2 Ile Pro Asp Arg Tyr Cys Thủy phân A xúc tác trypsin thu phân đoạn sau: Val-Trp-Met-Gly-Lys, Ala-Ile-Pro-Met-Asp-Arg, Tyr-Ala-Gly-Cys Nếu dùng xúc tác chymotrypsin thu được: Ala-Gly-Cys, Met-Gly-Lys-Ala-Ile-Pro-Met-Asp-Arg-Tyr, Val-Trp Hãy xác định trình tự amino axit A Hướng dẫn chấm: Theo ra, ta có phân đoạn sau: Trang 3/7 Val-Trp-Met-Gly-Lys Met-Gly-Lys-Ala-Ile-Pro-Met-Asp-Arg-Tyr Val-Trp Ala-Ile-Pro-Met-Asp-Arg Tyr-Ala-Gly-Cys Ala-Gly-Cys Dựa vào phân đoạn trên, kết luận trình tự amino axit polypeptit A là: Val-Trp-Met-Gly-Lys-Ala-Ile-Pro-Met-Asp-Arg-Tyr-Ala-Gly-Cys Câu (4 điểm) Ete crao criptan hợp chất vòng có nhiều ứng dụng thực tiễn (2,0 điểm) Ete crao có khả tạo phức chọn lọc với kim loại kiềm Ete [18]crao-6 (A) sinh phản ứng Williamson thông thường (1) với hiệu suất (hs) thấp: Wiliamson hs ≈ 2% HOCH2CH2 OCH2CH2 4OCH2CH2Cl [OCH2CH2]6 (A) (1) Trái lại, điều chế A với hiệu suất cao theo phản ứng (2): TsOCH2CH2OCH2CH2OCH2CH2OTs + HOCH2CH2OCH2CH2OCH2CH2OH (CH3)3COK hs ≈ 99% A (2) Giải thích khác hiệu suất hai phản ứng Trình bày chế phản ứng (2) Hướng dẫn chấm: Phản ứng (1) theo chế SN2 nội phân tử, xảy khó khăn hai trung tâm phản ứng xa nhau: O SN2 - O O O O O O -Cl- Cl O O O O O A Phản ứng (2) theo chế hai lần SN2 Lần thứ xảy bình thường; lần thứ hai thuận lợi nhờ có tạo phức với ion K+ làm cho trung tâm phản ứng gần hơn: OTs O - O O O O O O + K -TsO - O K+ - O O O - -TsO O O O O K+ O O -K+ A O OTs OTs (2,0 điểm) Criptan B có cơng thức N(CH2CH2OCH2CH2OCH2CH2)3N Dùng công thức cấu trúc, viết sơ đồ phản ứng tổng hợp B từ 3,6-đioxaoctan-1,8-điamin, axit 3,6-đioxaoctanđioic hóa chất cần thiết Hướng dẫn chấm: Cl HOOC COOH O O SOCl2 Cl O O O O Trang 4/7 O H2N NH2 Cl O - 2HCl Cl O NH O O HN NH [H] O O O O O O O O HN O O O Cl Cl O O O O O O [H] O N N O O O O O N N O O O O O O B Câu ( 4,5 điểm) Ancol X (C15H26O) có tinh dầu patchoulis, tổng hợp sau: (1,0 điểm) Cho hợp chất đimetylxiclohexađien tác dụng với metyl vinyl xeton sinh hợp chất A sản phẩm Viết tên đầy đủ đimetylxiclohexađien dùng sơ đồ phản ứng tạo thành A Viết công thức cấu trúc sản phẩm phụ đồng phân A A Hướng dẫn chấm: + 1,3-Đimetylxiclohexa-1,3-đien O O O A Metyl vinyl xeton Cụng thc cấu trúc số sản phẩm phụ đồng phân A: O O O (1,0 điểm) Cho A tác dụng với hợp chất kẽm (sinh từ etyl bromoetanoat kẽm ete), sau thủy phân sản phẩm dung dịch axit lỗng thu monoeste B (C16H26O3) B tác dụng với (CH3CO)2O sinh đieste C Chất C bị tách CH3COOH tạo thành monoeste không no liên hợp D (C16H24O2) Viết công thức cấu trúc B, C, D sản phẩm đồng phân D sinh với D Hướng dẫn chấm: Zn BrCH2COOEt A Ete BrZnCH2COOEt Ac2O BrZnCH2COOEt 2.H3O + OAc OH B COOEt OEt -AcOH COOEt C D O Trang 5/7 Các sản phẩm đồng phân D sinh với D là: O OEt O OEt EtO O O OEt (1,5 điểm) Hiđro hóa chọn lọc nối đơi ngoại vòng D, thu este E (C16H26O2) Khử E LiAlH4 cho ancol F Cho F tác dụng với (C6H5)3CCl piriđin, tạo thành G (C33H38O) Hiđro-bo hóa G (dùng B2H6 tiếp đến H2O2/NaOH), sau oxi hóa (CrO3/piriđin), sinh xeton P Cho P tác dụng với NaH (để sinh cacbanion), sau với CH3I sản phẩm Q (C34H40O2) Viết cơng thức cấu trúc E, F, G, P Q với sơ đồ phản ứng Hướng dẫn chấm: D OEt H2/Pd LiAlH4 O E Ph3CCl Piridin OH F HO O B2H6 G CrO3/piridin H2O2/HO- OCPh3 NaH P OCPh3 G OCPh3 P O O CH3I OCPh3 Q OCPh3 (1,0 điểm) Trong môi trường axit, Q chuyển thành R đồng thời giải phóng (C6H5)3COH R tác dụng với TsCl sinh sản phẩm S Chất S phản ứng với KI/axeton tạo thành T (C15H25IO) T tham gia phản ứng đóng vòng (nhờ Na/THF) cho ancol X Dùng cơng thức cấu trúc, viết sơ đồ phản ứng cho biết X chứa nguyên tử cacbon bất đối Hướng dẫn chấm: Q + H O TsCl O KI/axeton O Na/THF HO - Ph3COH R OTs OH S I T Ancol X Ancol X chứa C* Câu (3,5 điểm) (1,5 điểm) Urani dùng làm nguyên liệu cho lò phản ứng hạt nhân nên cần làm Để tinh chế urani, người ta hòa tan muối uranyl nitrat UO2(NO3)2 (kí hiệu UN) vào nước, sau chiết nhiều lần với tributyl photphat (TBP) pha loãng dầu hỏa Biết TBP chất lỏng khó bay Ở 25 oC, TBP có khối lượng riêng 972,7 kg/m3, dầu hỏa có khối lượng riêng khoảng từ 780 - 810 kg/m3 Trang 6/7 Vì người ta phải chiết UN TBP pha loãng dầu hỏa mà không chiết TBP nguyên chất? Hướng dẫn chấm: TBP có khối lượng riêng 972,7 kg/m3 gần khối lượng riêng dung dịch nước chứa uranyl nitrat Nếu chiết TBP nguyên chất, tách pha hữu pha nước khó khăn Sự pha lỗng pha hữu dầu hỏa có khối lượng riêng nằm khoảng từ 780 kg/m3 đến 810kg/m3 làm cho khối lượng riêng pha hữu giảm đi, phân pha chiết trở nên dễ dàng (2,0 điểm) Hãy tìm số lần chiết thích hợp để chiết 95% UN chứa 90 ml nước, sử dụng 90 ml TBP [UN]hc Cho: KD = = 6; KD số phân bố, [UN]hc [UN]nc nồng độ [UN]nc cân (mol/L) UN pha hữu pha nước Hướng dẫn chấm: Giả sử người ta tiến hành chiết UN n lần lượng dung môi hữu Gọi Vnc thể tích pha nước (ml) Vhc tổng thể tích pha hữu (ml) xo hàm lượng ban đầu UN pha nước (mmol) xi (i = 1, 2, n) hàm lượng lại UN pha nước sau lần chiết thứ i (mmol) Khi đó: thể tích pha hữu sử dụng lần chiết Vhc/n ( xo  x1 )n Vhc Sau lần chiết thứ nhất, ta có : KD = Rút ra: x1 = xo x1 V  K D hc Vnc nc nV Theo ra, Vhc=Vnc (= 90 ml), x1 = x0 K 1 D n n         Sau lần chiết thứ 2: x2 = x1 = xo  Tương tự, sau lần chiết thứ n: xn = xo   K D  KD KD    1 1 1 n n  n    n     x Vậy % UN lại pha nước sau lần chiết thứ n là: n 100 =   100 xo  1 KD  n   Để chiết 95% UN vào pha hữu % UN lại pha nước phải nhỏ 5%, nghĩa n     là:   < 0,05  1 KD  n   Lập bảng biến thiên [1/(1+KD/n)]n theo n (ở KD = 6), ta có: n n [1/(1+KD/n)] 0,1428 0,0625 0,0370 Từ số liệu bảng trên, nhận thấy: từ sau lần chiết thứ 3, hàm lượng UN lại nước nhỏ 5% Kết luận: Để chiết 95% UN vào pha hữu cơ, người ta chia 90 ml dung môi hữu thành phần tiến hành chiết làm lần HẾT - Trang 7/7 BỘ GIÁO DỤC ĐÀO TẠO KÌ THI CHỌN HỌC SINH VÀO CÁC ĐỘI TUYỂN QUỐC GIA DỰ THI OLYMPIC QUỐC TẾ NĂM 2010 HƯỚNG DẪN CHẤM ĐỀ THI CHÍNH THỨC Mơn: HỐ HỌC Ngày thi thứ nhất: 17/04/2010 Câu (2,5 điểm) 1, điểm; 1,5 điểm Bằng thiết bị điều kiện thích hợp, xạ có độ dài sóng 58,43 nm chiếu vào dòng khí nitơ Người ta xác định tốc độ dòng electron 1,4072.106 m.s–1, tốc độ dòng electron 1,266.106 m.s–1 Tính lượng ion hóa thứ (I1) lượng ion hóa thứ hai (I2) theo kJ.mol–1 Cho biết electron thứ e1, electron thứ hai e2 bứt từ obitan phân tử nitơ? Vì sao? Vẽ giản đồ lượng obitan phân tử dùng cấu hình electron N2 để giải thích Cho: Hằng số Planck h = 6,6261.10–34 J.s; Tốc độ ánh sáng c = 2,9979.108 m.s–1; Số Avogađro NA = 6,0221.1023 mol–1; Khối lượng electron me = 9,1094.10–31 kg Hướng dẫn giải: 1 h = mvi2 + Ii  Ii = h - mvi2 (1) 2 hν = 6,6261.10–34 2,9979.108 6,0221.1023 10–3 = 2050,485 (kJ mol–1) -9 58,34.10 Thay số vào biểu thức (1), tính I1 = 1507,335 (kJ mol–1); I2 = 1610,867 (kJ.mol–1)  Từ giản đồ lượng cấu hình electron nitơ π π [1s21s2] σ 22s σ*2 2s π 2x,2y σ 2z : * z * x * y z 2pa 2pb x y  * s 2sa 2sb e1 bứt từ MO-σ2z (MO bị chiếm cao nhất) e2 có hai khả năng: e2 bứt từ MO- π 2x,2y (2 MO suy biến); e2 bứt từ MO-σ2z e ( σ12z ) Khả bứt từ MO- π 2x,2y chiếm ưu π 22x π 22y có lực đẩy e-e nên dễ bứt e s Câu (2,5 điểm) 1,75 im; 0,75 im FeSO4 Cho sơ đồ phản ứng: FeCl2 (dd) KCN đặc, d Fe2(SO4)3 đặc A (dd) AgNO3 B kÕt tđa tr¾ng C kÕt tđa xanh đậm D kết tủa trắng FeCl2 KMnO4, H+ E (dd) Pb(OH)2, KOH Viết phương trình ion phản ứng xảy theo sơ đồ Hãy cho biết từ tính hợp chất A, dùng thuyết lai hóa để giải thích Hướng dẫn giải: Các phương trình phản ứng: Fe2+ + CN-  [Fe(CN)64- ] G kÕt tña xanh A + F kÕt tña n©u (A) [Fe(CN)64- ] + Fe2+  Fe2[Fe(CN)6] trắng (B) [Fe(CN)64- ] + Fe3+  Fe4[Fe(CN)6]3 xanh đậm (C) [Fe(CN)64- ] + Ag+  Ag4[Fe(CN)6] trắng (D) Trang 1/8 [Fe(CN)64- ] + MnO-4 + H+  Mn2+ + H2O + [Fe(CN)36 ] (E) 2+ [Fe(CN)3 Fe3[Fe(CN)6]2 xanh ] + Fe (G) 42 [Fe(CN)36 ] + Pb(OH) + OH  [Fe(CN) ] + H2O + PbO2 nâu Cấu hình electron Fe2+ [Ar]3d64s04p04d0 (F) 4s0 4p0 4d0 3d6 Vì CN- phối tử trường mạnh, tạo phức với Fe2+, electron độc thân obitan 3d Fe(II) bị ghép đơi, giải phóng obitan 3d trống Hai obitan lai hóa với obitan 4s obitan 4p, tạo thành obitan lai hóa d2sp3 hướng đỉnh hình bát diện Mỗi obitan lai hóa xen phủ với obitan tự có hai electron CN-, tạo liên kết cho nhận, hình thành phức [Fe(CN)64- ] lai hóa trong, có cấu trúc bát diện Phức nghịch từ có tổng spin không: CN- CN↓ ↓ CN- CN- CN- CN- ↓ ↓ ↓ ↓ d2sp3 Câu (3,5 điểm) 0,5 điểm; điểm; điểm; điểm Cho giản đồ trình khử - khử: trình khử diễn theo chiều mũi tên, khử chuẩn ghi mũi tên đo pH = +0,293 Cr(VI) (Cr2O27) +0,55 Cr(V) +1,34 Cr(IV) Ex Cr3+ -0,408 Cr2+ Ey Cr -0,744 Tính E 0x E 0y Dựa vào tính tốn, cho biết Cr(IV) dị phân thành Cr3+ Cr(VI) không? Viết trình xảy với hệ oxi hóa – khử Cr2 O 72- /Cr3+ tính độ biến thiên hệ nhiệt độ 298 K, pH tăng đơn vị pH Phản ứng K2Cr2O7 với H2O2 mơi trường axit (lỗng) dùng để nhận biết crom sản phẩm tạo thành có màu xanh Viết phương trình ion phản ứng xảy cho biết phản ứng có thuộc loại phản ứng oxi hóa – khử hay khơng? Vì sao? Ghi số oxi hóa tương ứng nguyên tố Cho: E Cr O2- /Cr3+ = 1,33 V; Hằng số khí R = 8,3145 J.K–1.mol–1; Hằng số Farađay F = 96485 C.mol–1 Hướng dẫn giải: Từ giản đồ ta có: 3.(-0,744) = -0,408 + E 0y  E 0y = -0,912 (V) 0,55 + 1,34 + E 0x – 3.0,744 = 6.0,293  E 0x = +2,1 (V) 2Cr(IV) + e  2Cr3+ (1) E10 = E 0x = 2,1 V  G10 = -n E10 F = - 2.2,1.F 0,55  1,34 = 0,945 (V)  G 02 = -n E 02 F = - 2.0,945.F Cr(VI) + e  Cr(IV) (2) E 02 = 3+ Từ (1) (2) ta có: 3Cr(IV)  2Cr + Cr(VI) G 30 G 30 = G10 - G 02 = - 2.(2,1 - 0,945).F <  Cr(IV) có dị phân Cr2 O72- + 14H+ + 6e 2Cr3+ + 7H2O E1 = 1,33 + RT [Cr2 O72- ].(10-pH )14 ln 6.F [Cr 3+ ]2 E = 1,33 + RT [Cr2 O72- ].(10-(pH + 1) )14 ln 6.F [Cr 3+ ]2 Trang 2/8 8,3145 298 14ln10-1 = -0,138 (V) 96485 +6 -2 +1 -1 +1 +6,-2/-1 +1 -2 -2 + 2Cr2 O7 + 4H2O2 + 2H  2CrO5 + 5H2O O -1 Phản ứng phản ứng oxi hóa-khử O O số oxi hóa ngun tố khơng thay đổi q Cr trình phản ứng Trong CrO5, số oxi hóa crom +6 +6 O O oxi -2, -1 peoxit CrO5 có cấu trúc: Câu (4,5 điểm) 1,5 điểm; 1,5 điểm; 0,75 điểm; 0,75 điểm Dung dịch A gồm Na2S CH3COONa có pHA = 12,50 Thêm lượng Na3PO4 vào dung dịch A cho độ điện li ion S2- giảm 20% (coi thể tích dung dịch khơng đổi) Tính nồng độ Na3PO4 dung dịch A Chuẩn độ 20,00 ml dung dịch A dung dịch HCl 0,10 M: a Khi thị metyl da cam đổi màu (pH = 4,00) dùng hết 19,40 ml dung dịch HCl Tính nồng độ CH3COONa dung dịch A b Nếu dùng hết 17,68 ml HCl hệ thu có pH bao nhiêu? Để lâu dung dịch A khơng khí, phần Na2S bị oxi hóa thành S Tính số cân phản ứng xảy Hãy tìm thuốc thử để nhận biết dung dịch riêng biệt: H3PO4, Na3PO4, NaH2PO4 Giải thích tượng xảy Cho: pK a1(H2S)  7,02; pK a2(H2S)  12,9; pK a1(H3PO4 )  2,15; pK a2(H3PO4 )  7,21; pK a3(H3PO4 )  12,32; b Độ biến thiên thế: E - E1 = 0 pK a(CH3COOH)  4,76; ES/H = 0,14 V; E O2 /H2O =1,23 V; 25 oC: 2,303 2S Hướng dẫn chấm: Gọi nồng độ Na2S CH3COONa dung dịch A Na3PO4, dung dịch xảy trình: S2+ H2O HS- + OHHS + H2O H2S + OHCH3COO- + H2O CH3COOH + OHH2O H+ + OHSo sánh cân  tính theo (1): S2+ H2O HS- + OHC C1 [ ] C1- 10-1,5 10-1,5 10-1,5 RT l n = 0,0592lg F C1 (M) C2 (M) Khi chưa thêm  CS2- = C1 = 0,0442 (M) độ điện li αS2-  α1  10-1,1 10-6,98 10-9,24 10-14 (1) (2) (3) (4) 10-1,1 [HS- ] 101,5   0, 7153 CS20, 0442 Khi thêm Na3PO4 vào dung dịch A, cân trên, hệ có thêm cân sau: 10-1,68 (5) PO3-4 + H2O HPO 2-4 + OHHPO2-4 + H2O H PO + H2O H PO-4 + OH- - H PO + OH Khi αS, 2-  α = 0,7153.0,80 = 0,57224 = 10-6,79 -11,85 10 (6) (7) - [HS ]  [HS-] = 0,0442 0,57224 = 0,0253 (M) CS2- Vì mơi trường bazơ nên CS2- = [S2-] + [HS-] + [H2S]  [S2-] + [HS-]  [S2-] = 0,0442 – 0,0253 = 0,0189 (M) 101,1.0, 0189 Từ (1)  [OH-] = = 0,0593 (M) 0, 0253 So sánh cân (1)  (7), ta thấy (1) (5) định pH hệ: Trang 3/8 [OH-] = [HS-] + [ HPO 2-4 ][ HPO2-4 ] = [OH-] - [HS-] = 0,0593 – 0,0253 = 0,0340 (M) [HPO 2-4 ][OH - ] 0, 0340.0, 0593 Từ (5)  [ PO ] =  = 0,0965 (M) 10-1,68 10-1,68  C PO3-  [ PO3-4 ] + [ HPO2-4 ] + [ H PO-4 ] + [ H PO ]  [ PO3-4 ] + [ HPO 2-4 ] 34 CPO3-  0,0965 + 0,0340 = 0,1305 (M) Khi chuẩn độ dung dịch A HCl, xảy q trình sau: S2- + H+  HS1012,9 107,02 HS- + H+  H2S CH3COO- + H+  CH3COOH 104,76 [H S] 104,00 [HS- ] 104,00 Tại pH = 4,00: 2-  12,90 1 [HS-] [S2-]; -  7,02 1 [H2S] [HS-]; [HS ] 10 [S ] 10 [CH 3COOH] 104,00 [CH3COOH] 100,76 0,76   10     0,8519 [CH3COO- ] 104,76 [CH 3COOH]+[CH3COO- ]  100,76 Như chuẩn độ đến pH = 4,00 ion S2- bị trung hòa hoàn toàn thành H2S 85,19% CH3COO- tham gia phản ứng:  0,10 19,40 = 20,00.(2.0,0442 + 0,8519.C2)  CCH COO- = C2 = 0,010 (M) Khi chuẩn độ hết 17,68 ml HCl, ta thấy: nHCl = 0,1.17,68 = 1,768 (mmol); n S2- = 20 0,0442 = 0,884 (mmol) = 0,5 nHCl Vậy phản ứng xảy ra: S2- + 2H+  0,884 1, 768 C0 37, 68 37, 68 C 0 H2S 0,884 37, 68 0,884 0, 01.20 = 0,02346 (M) CH3COO-: = 5,308.10-3 (M) 37, 68 37, 68 + -7,02 Các trình: H2S H + HS 10 (8) + 2-12,9 HS H + S 10 (9) + -14 H2O H + OH 10 (10) CH3COO- + H2O CH3COOH + OH- 10-9,24 (11) pH hệ tính theo (8) (11): 107,02.[H 2S] - 104,76 [CH3COO-].h h = [H+] = [HS-] – [CH3COOH] = h -7,02 10 [H 2S] (12) h = + 104,76 [CH 3COO- ] Hệ thu gồm H2S: Chấp nhận [H2S]1 = CH2S = 0,02346 (M) [CH3COO-]1 = CCH COO- = 5,308.10-3 (M), thay vào (12), tính h1 = 2,704.10-6 = 10-5,57 (M) 105,57 Kiểm tra: [H2S]2 = 0,02346 5,57 = 0,02266 (M)  107,02 10 104,76 [CH3COO-]2 = 5,308.10-3 5,57 = 4,596.10-3 (M)  104,76 10 Thay giá trị [H2S]2 [CH3COO-]2 vào (12), ta h2 = 2,855.10-6 = 10-5,54  h1 Kết lặp, pH = 5,54 Vì pK a1(H3PO4 )  2,15; pK a2(H3PO4 )  7,21; pK a3(H3PO4 )  12,32  khoảng pH dung dịch sau: pH (H3PO4 ) <  dung dịch H3PO4 thị metyl đỏ có màu đỏ Trang 4/8 pH (Na3PO4 ) > pH (Na HPO4 )  pK a3  pK a2 = 9,765  dung dịch Na3PO4 làm thị metyl đỏ chuyển màu vàng pK a1  pK a2 = 4,68  5,00  thị metyl đỏ có màu hồng da cam dung dịch NaH2PO4 Vậy dung metyl đỏ để phân biệt dung dịch Oxi hóa S2- oxi khơng khí: 2x S2- S  + 2e K1-1  102E1 / 0,0592 pH (NaH2 PO4 )  4OH- O2 + 2H2O + 4e S2- + O2 + 2H2O S  + 4OH0 0 tính sau: Trong E10 = ES/S 2- E = E O /OH - K  104E2 / 0,0592 0 K  104(E2  E1 ) / 0,0592 + S + 2H + 2e H2S H2S 2H+ + S2- K  102E3 / 0,0592 Ka1.Ka2 = 10-19,92 S2K1  102E1 / 0,0592 19,92.0, 0592 19,92.0, 0592  E10 = E 30  ES/ = -0,45 V H 2S  2 K  104E4 / 0,0592 O2 + 4H+ + 4e 2H2O H2O H+ + OHKw = 10-14 S + 2e 4OH- O2 + 2H2O + 4e K  104E2 / 0,0592  E 02 = E 04 - 14.0,0592 = E 0O2 /H2O - 14.0,0592 = 0,4012 V 0 Vậy K  104(E2  E1 ) / 0,0592 = 104(0,4012+0,45) / 0,0592 = 1057,51 Câu (3,5 điểm) 0,5 điểm; 1,5 điểm; 1,5 điểm Những đại lượng số đại lượng nhiệt động học S, H, G số cân K: a Phụ thuộc nhiều vào nhiệt độ? b Có liên quan mật thiết với độ bền liên kết? c Có liên quan đến lượng chất phản ứng lượng sản phẩm phản ứng? d Là độ đo khả tự diễn biến phản ứng? e Là độ đo nhiệt kèm theo phản ứng? Cho cân bằng: Me3DBMe3 (k) Me3D (k) + BMe3 (k), B nguyên tố bo, Me nhóm CH3 Ở 100 oC, thực nghiệm thu kết sau: Với hợp chất Me3NBMe3 (D nitơ): Kp1 = 4,720.104 Pa; S10 = 191,3 JK–1mol–1 Me3PBMe3 (D photpho): Kp2 = 1,280.104 Pa; S02 = 167,6 JK–1mol–1 a Cho biết hợp chất khó phân li hơn? Vì sao? b Trong hai liên kết N–B P–B, liên kết bền hơn? Vì sao? Hãy cho biết phản ứng 2Ni (l) + O2 (k) 2NiO (r) 1627 oC tự diễn biến theo chiều thuận không áp suất riêng phần oxi nhỏ 150 Pa? Cho: G 0hình thành (NiO) 1627 oC -72,1 kJ mol–1; Áp suất chuẩn P0 = 1,000.105 Pa; oC thang Celsius 273,15 K Hướng dẫn chấm: a K, G phụ thuộc nhiều vào nhiệt độ b H có liên quan mật thiết với độ bền liên kết c K có liên quan đến lượng chất phản ứng lượng sản phẩm phản ứng? d G độ đo khả tự diễn biến phản ứng e H độ đo nhiệt kèm theo phản ứng Me3DBMe3 (k) Me3D (k) + BMe3 (k) (1) Trang 5/8 Kp Từ cân (1)  Δn (k) = P0Δn (k) K K p1 4, 720.104  = 0,472 Đối với hợp chất Me3NBMe3: K1 = p1  P0 1,000.105 1,000.105 a Ta có: G = -RTlnK, K =  G10 = - 8,3145.373,15.ln0,472 = 2329,33 (J/mol) K p2 K p2 1, 280.104   = 0,128 Tương tự hợp chất Me3PBMe3: K2 = P0 1,000.105 1,000.105  G 02 = - 8,3145.373,15.ln0,128 = 6376,29 (J/mol) G10 < G 02  hợp chất Me3PBMe3 khó phân li b H = G + T S0  H10 = 2329,33 + 373,15.191,3 = 73712,93 (J/mol) H 02 = 6376,29 + 373,15.167,6 = 68916,23 (J/mol)  H10 > H 02  liên kết N-B bền Từ phản ứng: 2Ni (l) + O2 (k) 2NiO (r) (2) ta có: G phản ứng = -72,1.2 = -144,2 kJ/mol = -144200 J/mol ΔG -144200  lnK = == 9,127  K = 9200,38 RT 8,3145.1900,15 K K Đối với phản ứng (2): Δn (k) = -1  K = Δn p(k)  -1p → Kp = K.P0-1 = 9200,38.(1,000.105)-1 P0 P0 Mặt khác: K p = 1,000.105 với p O2 áp suất cân oxi  p O2 = = 10,87 (Pa) p O2 9200,38 Vậy phản ứng có xảy 10,87Pa < p O2 < 150Pa Câu (3,5 điểm) X C + D (a), X xúc tác đồng thể Một phản ứng dung dịch biểu diễn: A + B Để nghiên cứu động học phản ứng (a), người ta tiến hành hai thí nghiệm 25 oC với nồng độ ban đầu (C0 ) chất phản ứng sau: Thí nghiệm 2: C0A = 3,00 M; C0B = 0,01 M Thí nghiệm 1: C0A = 0,012 M; C0B = 6,00 M Biến thiên nồng độ chất A B theo thời gian hai thí nghiệm biểu diễn hình hình 2; nồng độ chất xúc tác CX = 1,00 M không đổi suốt thời gian phản ứng 102 CA (mol/L) 102 CB (mol/L) 1,2 1,0 0,6 0,5 0,3 0,15 10 20 30 40 t (phút) 0,25 0,125 20 40 60 t (phút) Hình Hình Ở 25 oC số cân phản ứng (a) KC = 4.106 Tính thời gian cần thiết để hệ đạt đến trạng thái cân bằng, C0A = C0B = 1,00 M Cx = 1,00 M không thay đổi; lúc đầu hệ chưa có mặt sản phẩm phản ứng Ở 80 oC số cân phản ứng (a) KC = 1.105 Tính H S phản ứng (a) cho biết thời gian cần thiết để đạt đến cân tăng hay giảm (coi phụ thuộc H S vào nhiệt độ không đáng kể)? Người ta cho chế phản ứng (a) diễn qua giai đoạn sơ cấp sau: Trang 6/8 k1   AX (b) A + X   k AX + B k3   AXB   k (c) k5 AXB   C + D + X (d) Giai đoạn giai đoạn chậm để chế phù hợp với định luật tốc độ thu từ thực nghiệm? Hãy chứng minh Hướng dẫn chấm: Định luật tốc độ phản ứng có dạng chung: (1) v = k CaA CbB CXx Trong thí nghiệm 1, C0B = 6,00 M (rất dư)  k (C0B ) b CXx = const = k' (2)  v = k' CaA Từ hình rút thời gian phản ứng nửa (t1/2) không phụ thuộc vào nồng độ đầu A t1/2 = ln2 0, 693  10 (phút)  a = 1và k' = = 6,93.10-2 (phút-1) t1/2 10 Tương tự thí nghiệm 2, C0A = 3,00 M (rất dư)  k (C0A ) a C Xx = const = k'' v = k'' CbB Từ hình  thời gian phản ứng nửa không phụ thuộc vào nồng độ đầu B  b = Biểu thức định luật tốc độ (1) trở thành: v = k.CA.CB C Xx = kap.CA.CB với kap số tốc độ biểu kiến phản ứng kap=k C Xx Như phản ứng diễn theo quy luật động học bậc k' 6,93.102 = 0,01155 L/(mol.phút) Từ (2) ta có: kap = k C Xx =  CB 6, 00 X Xét phản ứng: A + B C + D Kc = 4.106 C0 1 0 C x x 1-x 1-x (1-x) = 4.106  x  5.10-4 (M) KC = x Vì phản ứng bậc C0A = C0B = 1,00 M nên phương trình động học tích phân có dạng: 1 1 -  kap.t   0,01155.t  t = 1,73.105 phút 4 C C 5.10 Vậy nhiệt độ 25 oC cần tới 1,73.105 phút để phản ứng đạt cân G 0298,15 = - 8,3145 298,15 ln(4.106 ) = - 37684,8 (J/mol) G 353,15 = - 8,3145 353,15 ln(1.105 ) = - 33805 (J/mol) G 0298,15 = -37684,8 = H – 298,15.S (3) G 353,15 = -33805 = H – 353,15.S (4) Từ (3) (4), tính được: S = -70,54 (J/mol); H = - 58716,3 (J/mol) Khi tăng nhiệt độ từ 25 oC lên 80 oC, tốc độ phản ứng thuận nghịch tăng lên, thời gian cần thiết để hệ đạt đến cân giảm k5 k3 k1 AXB   C + D + X (d)   AXB (c)   AX (b) AX + B  A + X    k k Tốc độ phản ứng xác định qua biến thiên nồng độ sản phẩm cuối C: dC (5) v = C = k5CAXB dt Ở trạng thái dừng, khoảng thời gian định, nồng độ sản phẩm trung gian không thay đổi theo thời gian: dCAXB = k3.CAX.CB – k4.CAXB – k5CAXB = (6) dt Trang 7/8  CAXB = k CAX CB k +k dCAX = k1.CACX – k2.CAX – k3.CAX.CB + k4.CAXB = dt Từ (6) (8) ta có: k1.CACX – k2.CAX – k5CAXB = (7) (8) (9) k1.CA CX - k CAXB (10) k2 k C C Khi k5
- Xem thêm -

Xem thêm: đề thi và đáp án hsg quốc gia vòng 2 môn hóa học 2010, đề thi và đáp án hsg quốc gia vòng 2 môn hóa học 2010